Search dblp for Publications

export results for "stream:journals/comgeo:"

more than 1000 matches, exporting first 1000 hits only!

 download as .bib file

@article{DBLP:journals/comgeo/AgarwalKS24,
  author       = {Pankaj K. Agarwal and
                  Matthew J. Katz and
                  Micha Sharir},
  title        = {On reverse shortest paths in geometric proximity graphs},
  journal      = {Comput. Geom.},
  volume       = {117},
  pages        = {102053},
  year         = {2024},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102053},
  doi          = {10.1016/J.COMGEO.2023.102053},
  timestamp    = {Fri, 20 Oct 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AgarwalKS24.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Brandenburg24,
  author       = {Franz J. Brandenburg},
  title        = {Straight-line drawings of 1-planar graphs},
  journal      = {Comput. Geom.},
  volume       = {116},
  pages        = {102036},
  year         = {2024},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102036},
  doi          = {10.1016/J.COMGEO.2023.102036},
  timestamp    = {Thu, 31 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Brandenburg24.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CurryDGHKM24,
  author       = {Justin Curry and
                  Jordan DeSha and
                  Ad{\'{e}}lie Garin and
                  Kathryn Hess and
                  Lida Kanari and
                  Brendan Mallery},
  title        = {From trees to barcodes and back again {II:} Combinatorial and probabilistic
                  aspects of a topological inverse problem},
  journal      = {Comput. Geom.},
  volume       = {116},
  pages        = {102031},
  year         = {2024},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102031},
  doi          = {10.1016/J.COMGEO.2023.102031},
  timestamp    = {Mon, 04 Dec 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CurryDGHKM24.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FoxHR24,
  author       = {Emily Fox and
                  Hongyao Huang and
                  Benjamin Raichel},
  title        = {Clustering with faulty centers},
  journal      = {Comput. Geom.},
  volume       = {117},
  pages        = {102052},
  year         = {2024},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102052},
  doi          = {10.1016/J.COMGEO.2023.102052},
  timestamp    = {Fri, 20 Oct 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/FoxHR24.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Glickenstein24,
  author       = {David Glickenstein},
  title        = {Geometric triangulations and discrete Laplacians on manifolds: An
                  update},
  journal      = {Comput. Geom.},
  volume       = {118},
  pages        = {102063},
  year         = {2024},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102063},
  doi          = {10.1016/J.COMGEO.2023.102063},
  timestamp    = {Sun, 31 Dec 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Glickenstein24.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HeS24,
  author       = {Meng He and
                  Don Sheehy},
  title        = {Guest editorial: Special issue on the 33rd Canadian Conference on
                  Computational Geometry {(CCCG)}},
  journal      = {Comput. Geom.},
  volume       = {116},
  pages        = {102035},
  year         = {2024},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102035},
  doi          = {10.1016/J.COMGEO.2023.102035},
  timestamp    = {Sun, 12 Nov 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HeS24.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MajhiVW24,
  author       = {Sushovan Majhi and
                  Jeffrey Vitter and
                  Carola Wenk},
  title        = {Approximating Gromov-Hausdorff distance in Euclidean space},
  journal      = {Comput. Geom.},
  volume       = {116},
  pages        = {102034},
  year         = {2024},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102034},
  doi          = {10.1016/J.COMGEO.2023.102034},
  timestamp    = {Thu, 31 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/MajhiVW24.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MajhiW24,
  author       = {Sushovan Majhi and
                  Carola Wenk},
  title        = {Distance measures for geometric graphs},
  journal      = {Comput. Geom.},
  volume       = {118},
  pages        = {102056},
  year         = {2024},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102056},
  doi          = {10.1016/J.COMGEO.2023.102056},
  timestamp    = {Sun, 31 Dec 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MajhiW24.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MalicS24,
  author       = {Goran Malic and
                  Ileana Streinu},
  title        = {Enumerating combinatorial resultant trees},
  journal      = {Comput. Geom.},
  volume       = {118},
  pages        = {102064},
  year         = {2024},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102064},
  doi          = {10.1016/J.COMGEO.2023.102064},
  timestamp    = {Fri, 08 Mar 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MalicS24.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PoureidiF24,
  author       = {Abolfazl Poureidi and
                  Mohammad Farshi},
  title        = {On algorithmic complexity of imprecise spanners},
  journal      = {Comput. Geom.},
  volume       = {117},
  pages        = {102051},
  year         = {2024},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102051},
  doi          = {10.1016/J.COMGEO.2023.102051},
  timestamp    = {Fri, 27 Oct 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/PoureidiF24.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Radons24,
  author       = {Manuel Radons},
  title        = {Edge-unfolding nested prismatoids},
  journal      = {Comput. Geom.},
  volume       = {116},
  pages        = {102033},
  year         = {2024},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102033},
  doi          = {10.1016/J.COMGEO.2023.102033},
  timestamp    = {Thu, 31 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Radons24.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RieckS24,
  author       = {Christian Rieck and
                  Christian Scheffer},
  title        = {The dispersive art gallery problem},
  journal      = {Comput. Geom.},
  volume       = {117},
  pages        = {102054},
  year         = {2024},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102054},
  doi          = {10.1016/J.COMGEO.2023.102054},
  timestamp    = {Fri, 08 Mar 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/RieckS24.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Abu-AffashCM23,
  author       = {A. Karim Abu{-}Affash and
                  Paz Carmi and
                  Meytal Maman},
  title        = {Piercing pairwise intersecting geodesic disks by five points},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101947},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101947},
  doi          = {10.1016/J.COMGEO.2022.101947},
  timestamp    = {Thu, 10 Nov 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Abu-AffashCM23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AfshaniK23,
  author       = {Peyman Afshani and
                  Rasmus Killmann},
  title        = {Rectangle stabbing and orthogonal range reporting lower bounds in
                  moderate dimensions},
  journal      = {Comput. Geom.},
  volume       = {111},
  pages        = {101959},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101959},
  doi          = {10.1016/J.COMGEO.2022.101959},
  timestamp    = {Thu, 16 Mar 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AfshaniK23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AgarwalGHT23,
  author       = {Pankaj K. Agarwal and
                  Tzvika Geft and
                  Dan Halperin and
                  Erin Taylor},
  title        = {Multi-robot motion planning for unit discs with revolving areas},
  journal      = {Comput. Geom.},
  volume       = {114},
  pages        = {102019},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102019},
  doi          = {10.1016/J.COMGEO.2023.102019},
  timestamp    = {Tue, 20 Jun 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AgarwalGHT23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerEH23,
  author       = {Oswin Aichholzer and
                  David Eppstein and
                  Eva{-}Maria Hainzl},
  title        = {Geometric dominating sets - a minimum version of the No-Three-In-Line
                  Problem},
  journal      = {Comput. Geom.},
  volume       = {108},
  pages        = {101913},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101913},
  doi          = {10.1016/J.COMGEO.2022.101913},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerEH23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovBCEIS23,
  author       = {Boris Aronov and
                  Mark de Berg and
                  Jean Cardinal and
                  Esther Ezra and
                  John Iacono and
                  Micha Sharir},
  title        = {Subquadratic algorithms for some 3Sum-hard geometric problems in the
                  algebraic decision-tree model},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101945},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101945},
  doi          = {10.1016/J.COMGEO.2022.101945},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AronovBCEIS23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovESZ23,
  author       = {Boris Aronov and
                  Esther Ezra and
                  Micha Sharir and
                  Guy Zigdon},
  title        = {Time and space efficient collinearity indexing},
  journal      = {Comput. Geom.},
  volume       = {110},
  pages        = {101963},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101963},
  doi          = {10.1016/J.COMGEO.2022.101963},
  timestamp    = {Fri, 20 Jan 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AronovESZ23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AshurK23,
  author       = {Stav Ashur and
                  Matthew J. Katz},
  title        = {A 4-approximation of the 2{\(\pi\)}3-MST},
  journal      = {Comput. Geom.},
  volume       = {108},
  pages        = {101914},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101914},
  doi          = {10.1016/J.COMGEO.2022.101914},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AshurK23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BakhajianF23,
  author       = {Ziv Bakhajian and
                  Ohad Noy Feldheim},
  title        = {Drawing outerplanar graphs using thirteen edge lengths},
  journal      = {Comput. Geom.},
  volume       = {110},
  pages        = {101964},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101964},
  doi          = {10.1016/J.COMGEO.2022.101964},
  timestamp    = {Tue, 31 Jan 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BakhajianF23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BalkoST23,
  author       = {Martin Balko and
                  Adam Sheffer and
                  Ruiwen Tang},
  title        = {The constant of point-line incidence constructions},
  journal      = {Comput. Geom.},
  volume       = {114},
  pages        = {102009},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102009},
  doi          = {10.1016/J.COMGEO.2023.102009},
  timestamp    = {Fri, 07 Jul 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BalkoST23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BanikRR23,
  author       = {Aritra Banik and
                  Rajiv Raman and
                  Saurabh Ray},
  title        = {On the geometric priority set cover problem},
  journal      = {Comput. Geom.},
  volume       = {112},
  pages        = {101984},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.101984},
  doi          = {10.1016/J.COMGEO.2023.101984},
  timestamp    = {Tue, 28 Mar 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BanikRR23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarequetM23,
  author       = {Gill Barequet and
                  Bar Magal},
  title        = {Automatic generation of formulae for polyominoes with a fixed perimeter
                  defect},
  journal      = {Comput. Geom.},
  volume       = {108},
  pages        = {101919},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101919},
  doi          = {10.1016/J.COMGEO.2022.101919},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BarequetM23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaumeisterK23,
  author       = {Markus Baumeister and
                  Leif Kobbelt},
  title        = {How close is a quad mesh to a polycube?},
  journal      = {Comput. Geom.},
  volume       = {111},
  pages        = {101978},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101978},
  doi          = {10.1016/J.COMGEO.2022.101978},
  timestamp    = {Tue, 28 Mar 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaumeisterK23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergS23,
  author       = {Sarita de Berg and
                  Frank Staals},
  title        = {Dynamic data structures for \emph{k}-nearest neighbor queries},
  journal      = {Comput. Geom.},
  volume       = {111},
  pages        = {101976},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101976},
  doi          = {10.1016/J.COMGEO.2022.101976},
  timestamp    = {Sat, 13 May 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BergS23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BertschingerRM23,
  author       = {Daniel Bertschinger and
                  Meghana M. Reddy and
                  Enrico Mann},
  title        = {Lions and contamination: Monotone clearings},
  journal      = {Comput. Geom.},
  volume       = {110},
  pages        = {101961},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101961},
  doi          = {10.1016/J.COMGEO.2022.101961},
  timestamp    = {Tue, 31 Jan 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BertschingerRM23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BhoreLNRW23,
  author       = {Sujoy Bhore and
                  Guangping Li and
                  Martin N{\"{o}}llenburg and
                  Ignaz Rutter and
                  Hsiang{-}Yun Wu},
  title        = {Untangling circular drawings: Algorithms and complexity},
  journal      = {Comput. Geom.},
  volume       = {111},
  pages        = {101975},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101975},
  doi          = {10.1016/J.COMGEO.2022.101975},
  timestamp    = {Sat, 13 May 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BhoreLNRW23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazBW23,
  author       = {Ahmad Biniaz and
                  Prosenjit Bose and
                  Yunkai Wang},
  title        = {Simple linear time algorithms for piercing pairwise intersecting disks},
  journal      = {Comput. Geom.},
  volume       = {114},
  pages        = {102011},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102011},
  doi          = {10.1016/J.COMGEO.2023.102011},
  timestamp    = {Mon, 26 Jun 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiniazBW23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BinucciDM23,
  author       = {Carla Binucci and
                  Walter Didimo and
                  Fabrizio Montecchiani},
  title        = {1-planarity testing and embedding: An experimental study},
  journal      = {Comput. Geom.},
  volume       = {108},
  pages        = {101900},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101900},
  doi          = {10.1016/J.COMGEO.2022.101900},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BinucciDM23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BlasiusFKM23,
  author       = {Thomas Bl{\"{a}}sius and
                  Tobias Friedrich and
                  Martin S. Krejca and
                  Louise Molitor},
  title        = {The impact of geometry on monochrome regions in the flip Schelling
                  process},
  journal      = {Comput. Geom.},
  volume       = {108},
  pages        = {101902},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101902},
  doi          = {10.1016/J.COMGEO.2022.101902},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BlasiusFKM23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BonerathHMN23,
  author       = {Annika Bonerath and
                  Jan{-}Henrik Haunert and
                  Joseph S. B. Mitchell and
                  Benjamin Niedermann},
  title        = {Shortcut hulls: Vertex-restricted outer simplifications of polygons},
  journal      = {Comput. Geom.},
  volume       = {112},
  pages        = {101983},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.101983},
  doi          = {10.1016/J.COMGEO.2023.101983},
  timestamp    = {Tue, 21 Mar 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BonerathHMN23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCDMMMS23,
  author       = {Prosenjit Bose and
                  Paz Carmi and
                  Vida Dujmovic and
                  Saeed Mehrabi and
                  Fabrizio Montecchiani and
                  Pat Morin and
                  Lu{\'{\i}}s Fernando Schultz Xavier da Silveira},
  title        = {Geodesic obstacle representation of graphs},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101946},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101946},
  doi          = {10.1016/J.COMGEO.2022.101946},
  timestamp    = {Sun, 13 Nov 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseCDMMMS23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Buchin23,
  author       = {Kevin Buchin},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {113},
  pages        = {102008},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102008},
  doi          = {10.1016/J.COMGEO.2023.102008},
  timestamp    = {Wed, 17 May 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Buchin23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinLOPUV23,
  author       = {Kevin Buchin and
                  Maarten L{\"{o}}ffler and
                  Tim Ophelders and
                  Aleksandr Popov and
                  J{\'{e}}r{\^{o}}me Urhausen and
                  Kevin Verbeek},
  title        = {Computing the Fr{\'{e}}chet distance between uncertain curves
                  in one dimension},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101923},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101923},
  doi          = {10.1016/J.COMGEO.2022.101923},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BuchinLOPUV23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CalesCEF23,
  author       = {Ludovic Cal{\`{e}}s and
                  Apostolos Chalkis and
                  Ioannis Z. Emiris and
                  Vissarion Fisikopoulos},
  title        = {Practical volume approximation of high-dimensional convex bodies,
                  applied to modeling portfolio dependencies and financial crises},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101916},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101916},
  doi          = {10.1016/J.COMGEO.2022.101916},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CalesCEF23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CardinalKMPUV23,
  author       = {Jean Cardinal and
                  Kolja Knauer and
                  Piotr Micek and
                  D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi and
                  Torsten Ueckerdt and
                  Narmada Varadarajan},
  title        = {Colouring bottomless rectangles and arborescences},
  journal      = {Comput. Geom.},
  volume       = {115},
  pages        = {102020},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102020},
  doi          = {10.1016/J.COMGEO.2023.102020},
  timestamp    = {Fri, 21 Jul 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CardinalKMPUV23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChacholskiGJL23,
  author       = {Wojciech Chach{\'{o}}lski and
                  Barbara Giunti and
                  Alvin Jin and
                  Claudia Landi},
  title        = {Decomposing filtered chain complexes: Geometry behind barcoding algorithms},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101938},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101938},
  doi          = {10.1016/J.COMGEO.2022.101938},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChacholskiGJL23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChoO23,
  author       = {Kyungjin Cho and
                  Eunjin Oh},
  title        = {Linear-time approximation scheme for \emph{k}-means clustering of
                  axis-parallel affine subspaces},
  journal      = {Comput. Geom.},
  volume       = {112},
  pages        = {101981},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.101981},
  doi          = {10.1016/J.COMGEO.2023.101981},
  timestamp    = {Thu, 16 Mar 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChoO23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChoiJA23,
  author       = {Jongmin Choi and
                  Dahye Jeong and
                  Hee{-}Kap Ahn},
  title        = {Covering convex polygons by two congruent disks},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101936},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101936},
  doi          = {10.1016/J.COMGEO.2022.101936},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChoiJA23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DamianF23,
  author       = {Mirela Damian and
                  Robin Y. Flatland},
  title        = {Unfolding 3-separated polycube graphs of arbitrary genus},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101944},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101944},
  doi          = {10.1016/J.COMGEO.2022.101944},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DamianF23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DasDFGR23,
  author       = {Arun Kumar Das and
                  Sandip Das and
                  Guilherme Dias da Fonseca and
                  Yan Gerard and
                  Bastien Rivier},
  title        = {Complexity results on untangling red-blue matchings},
  journal      = {Comput. Geom.},
  volume       = {111},
  pages        = {101974},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101974},
  doi          = {10.1016/J.COMGEO.2022.101974},
  timestamp    = {Tue, 28 Mar 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DasDFGR23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeL23,
  author       = {Minati De and
                  Abhiruk Lahiri},
  title        = {Geometric dominating-set and set-cover via local-search},
  journal      = {Comput. Geom.},
  volume       = {113},
  pages        = {102007},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102007},
  doi          = {10.1016/J.COMGEO.2023.102007},
  timestamp    = {Fri, 02 Jun 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DeL23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeVW23,
  author       = {Anway De and
                  Thong Vo and
                  Matthew Wright},
  title        = {Value-offset bifiltrations for digital images},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101939},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101939},
  doi          = {10.1016/J.COMGEO.2022.101939},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DeVW23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineDDKUZ23,
  author       = {Erik D. Demaine and
                  Martin L. Demaine and
                  Yevhenii Diomidov and
                  Tonan Kamata and
                  Ryuhei Uehara and
                  Hanyu Alice Zhang},
  title        = {Any platonic solid can transform to another by \emph{O}(1) refoldings},
  journal      = {Comput. Geom.},
  volume       = {113},
  pages        = {101995},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.101995},
  doi          = {10.1016/J.COMGEO.2023.101995},
  timestamp    = {Wed, 17 May 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DemaineDDKUZ23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineDU23,
  author       = {Erik D. Demaine and
                  Martin L. Demaine and
                  Ryuhei Uehara},
  title        = {Developing a tetramonohedron with minimum cut length},
  journal      = {Comput. Geom.},
  volume       = {108},
  pages        = {101903},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101903},
  doi          = {10.1016/J.COMGEO.2022.101903},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DemaineDU23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineLS23,
  author       = {Erik D. Demaine and
                  Maarten L{\"{o}}ffler and
                  Christiane Schmidt},
  title        = {Rectangular Spiral Galaxies are still hard},
  journal      = {Comput. Geom.},
  volume       = {110},
  pages        = {101949},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101949},
  doi          = {10.1016/J.COMGEO.2022.101949},
  timestamp    = {Tue, 31 Jan 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DemaineLS23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DevadossH23,
  author       = {Satyan L. Devadoss and
                  Matthew S. Harvey},
  title        = {Unfoldings and nets of regular polytopes},
  journal      = {Comput. Geom.},
  volume       = {111},
  pages        = {101977},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101977},
  doi          = {10.1016/J.COMGEO.2022.101977},
  timestamp    = {Tue, 28 Mar 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DevadossH23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EastHP23,
  author       = {James East and
                  Michael Hendriksen and
                  Laurence Park},
  title        = {On the enumeration of integer tetrahedra},
  journal      = {Comput. Geom.},
  volume       = {108},
  pages        = {101915},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101915},
  doi          = {10.1016/J.COMGEO.2022.101915},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/EastHP23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EderHLP23,
  author       = {G{\"{u}}nther Eder and
                  Martin Held and
                  Stefan de Lorenzo and
                  Peter Palfrader},
  title        = {On the recognition and reconstruction of weighted Voronoi diagrams
                  and bisector graphs},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101935},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101935},
  doi          = {10.1016/J.COMGEO.2022.101935},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/EderHLP23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ElkindSS23,
  author       = {Edith Elkind and
                  Erel Segal{-}Halevi and
                  Warut Suksompong},
  title        = {Keep your distance: Land division with separation},
  journal      = {Comput. Geom.},
  volume       = {113},
  pages        = {102006},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102006},
  doi          = {10.1016/J.COMGEO.2023.102006},
  timestamp    = {Tue, 12 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ElkindSS23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EppsteinFO23,
  author       = {David Eppstein and
                  Daniel Frishberg and
                  Martha C. Osegueda},
  title        = {Angles of arc-polygons and Lombardi drawings of cacti},
  journal      = {Comput. Geom.},
  volume       = {112},
  pages        = {101982},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.101982},
  doi          = {10.1016/J.COMGEO.2023.101982},
  timestamp    = {Tue, 28 Mar 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/EppsteinFO23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EvansS23,
  author       = {William S. Evans and
                  Lucca Morais de Arruda Siaudzionis},
  title        = {On path-greedy geometric spanners},
  journal      = {Comput. Geom.},
  volume       = {110},
  pages        = {101948},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101948},
  doi          = {10.1016/J.COMGEO.2022.101948},
  timestamp    = {Tue, 31 Jan 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/EvansS23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FerniqueP23,
  author       = {Thomas Fernique and
                  Daria Pchelina},
  title        = {Density of triangulated ternary disc packings},
  journal      = {Comput. Geom.},
  volume       = {115},
  pages        = {102032},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102032},
  doi          = {10.1016/J.COMGEO.2023.102032},
  timestamp    = {Fri, 21 Jul 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/FerniqueP23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FriederichGGHS23,
  author       = {Rachel Friederich and
                  Anirban Ghosh and
                  Matthew Graham and
                  Brian Hicks and
                  Ronald Shevchenko},
  title        = {Experiments with unit disk cover algorithms for covering massive pointsets},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101925},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101925},
  doi          = {10.1016/J.COMGEO.2022.101925},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/FriederichGGHS23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Fuentes-Sepulveda23,
  author       = {Jos{\'{e}} Fuentes{-}Sep{\'{u}}lveda and
                  Gonzalo Navarro and
                  Diego Seco},
  title        = {Navigating planar topologies in near-optimal space and time},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101922},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101922},
  doi          = {10.1016/J.COMGEO.2022.101922},
  timestamp    = {Wed, 28 Feb 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Fuentes-Sepulveda23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FugacciKR23,
  author       = {Ulderico Fugacci and
                  Michael Kerber and
                  Alexander Rolle},
  title        = {Compression for 2-parameter persistent homology},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101940},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101940},
  doi          = {10.1016/J.COMGEO.2022.101940},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/FugacciKR23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiacomoM23,
  author       = {Emilio Di Giacomo and
                  Fabrizio Montecchiani},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {111},
  pages        = {101980},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101980},
  doi          = {10.1016/J.COMGEO.2022.101980},
  timestamp    = {Thu, 16 Mar 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GiacomoM23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GitikJ23,
  author       = {Rivka Gitik and
                  Leo Joskowicz},
  title        = {Half-plane point retrieval queries with independent and dependent
                  geometric uncertainties},
  journal      = {Comput. Geom.},
  volume       = {115},
  pages        = {102021},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102021},
  doi          = {10.1016/J.COMGEO.2023.102021},
  timestamp    = {Fri, 21 Jul 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GitikJ23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GonzalezDiazST23,
  author       = {Roc{\'{\i}}o Gonz{\'{a}}lez{-}D{\'{\i}}az and
                  M. Soriano{-}Trigueros and
                  {\'{A}}lvaro Torras{-}Casas},
  title        = {Partial matchings induced by morphisms between persistence modules},
  journal      = {Comput. Geom.},
  volume       = {112},
  pages        = {101985},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.101985},
  doi          = {10.1016/J.COMGEO.2023.101985},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GonzalezDiazST23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonS23,
  author       = {Joachim Gudmundsson and
                  Yuan Sha},
  title        = {Augmenting graphs to minimize the radius},
  journal      = {Comput. Geom.},
  volume       = {113},
  pages        = {101996},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.101996},
  doi          = {10.1016/J.COMGEO.2023.101996},
  timestamp    = {Fri, 02 Jun 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GudmundssonS23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonS23a,
  author       = {Joachim Gudmundsson and
                  Yuan Sha},
  title        = {Algorithms for radius-optimally augmenting trees in a metric space},
  journal      = {Comput. Geom.},
  volume       = {114},
  pages        = {102018},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102018},
  doi          = {10.1016/J.COMGEO.2023.102018},
  timestamp    = {Fri, 07 Jul 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GudmundssonS23a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonSW23,
  author       = {Joachim Gudmundsson and
                  Yuan Sha and
                  Sampson Wong},
  title        = {Approximating the packedness of polygonal curves},
  journal      = {Comput. Geom.},
  volume       = {108},
  pages        = {101920},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101920},
  doi          = {10.1016/J.COMGEO.2022.101920},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GudmundssonSW23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HeLS23,
  author       = {Meng He and
                  Anna Lubiw and
                  Mohammad R. Salavatipour},
  title        = {Preface},
  journal      = {Comput. Geom.},
  volume       = {110},
  pages        = {101958},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101958},
  doi          = {10.1016/J.COMGEO.2022.101958},
  timestamp    = {Thu, 24 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/HeLS23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HeldNS23,
  author       = {Martin Held and
                  Martin N{\"{o}}llenburg and
                  Peter Sanders},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {110},
  pages        = {101950},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101950},
  doi          = {10.1016/J.COMGEO.2022.101950},
  timestamp    = {Fri, 20 Jan 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HeldNS23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HiraniKWW23,
  author       = {Anil N. Hirani and
                  Kaushik Kalyanaraman and
                  Han Wang and
                  Seth Watts},
  title        = {Computing discrete harmonic differential forms in a given cohomology
                  class using finite element exterior calculus},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101937},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101937},
  doi          = {10.1016/J.COMGEO.2022.101937},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/HiraniKWW23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KangCA23,
  author       = {Byeonguk Kang and
                  Jongmin Choi and
                  Hee{-}Kap Ahn},
  title        = {Intersecting disks using two congruent disks},
  journal      = {Comput. Geom.},
  volume       = {110},
  pages        = {101966},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101966},
  doi          = {10.1016/J.COMGEO.2022.101966},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KangCA23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KarlT23,
  author       = {J{\'{a}}nos Karl and
                  G{\'{e}}za T{\'{o}}th},
  title        = {Crossing lemma for the odd-crossing number},
  journal      = {Comput. Geom.},
  volume       = {108},
  pages        = {101901},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101901},
  doi          = {10.1016/J.COMGEO.2022.101901},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KarlT23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KatzS23,
  author       = {Matthew J. Katz and
                  Micha Sharir},
  title        = {Bottleneck matching in the plane},
  journal      = {Comput. Geom.},
  volume       = {112},
  pages        = {101986},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.101986},
  doi          = {10.1016/J.COMGEO.2023.101986},
  timestamp    = {Thu, 16 Mar 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KatzS23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimLA23,
  author       = {Hwi Kim and
                  Jaegun Lee and
                  Hee{-}Kap Ahn},
  title        = {Rectangular partitions of a rectilinear polygon},
  journal      = {Comput. Geom.},
  volume       = {110},
  pages        = {101965},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101965},
  doi          = {10.1016/J.COMGEO.2022.101965},
  timestamp    = {Tue, 31 Jan 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KimLA23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Klost23,
  author       = {Katharina Klost},
  title        = {An algorithmic framework for the single source shortest path problem
                  with applications to disk graphs},
  journal      = {Comput. Geom.},
  volume       = {111},
  pages        = {101979},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101979},
  doi          = {10.1016/J.COMGEO.2022.101979},
  timestamp    = {Tue, 28 Mar 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Klost23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LavasaniP23,
  author       = {Ali Mohammad Lavasani and
                  Denis Pankratov},
  title        = {Advice complexity of online non-crossing matching},
  journal      = {Comput. Geom.},
  volume       = {110},
  pages        = {101943},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101943},
  doi          = {10.1016/J.COMGEO.2022.101943},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/LavasaniP23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LuT23,
  author       = {Shangqi Lu and
                  Yufei Tao},
  title        = {Range updates and range sum queries on multidimensional points with
                  monoid weights},
  journal      = {Comput. Geom.},
  volume       = {115},
  pages        = {102030},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102030},
  doi          = {10.1016/J.COMGEO.2023.102030},
  timestamp    = {Fri, 21 Jul 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/LuT23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MchedlidzeA23,
  author       = {Tamara Mchedlidze and
                  Elena Arseneva},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {110},
  pages        = {101962},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101962},
  doi          = {10.1016/J.COMGEO.2022.101962},
  timestamp    = {Fri, 20 Jan 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MchedlidzeA23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Medina-Mardones23,
  author       = {Anibal M. Medina{-}Mardones},
  title        = {New formulas for cup-\emph{i} products and fast computation of Steenrod
                  squares},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101921},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101921},
  doi          = {10.1016/J.COMGEO.2022.101921},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Medina-Mardones23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ORourkeV23,
  author       = {Joseph O'Rourke and
                  Costin V{\^{\i}}lcu},
  title        = {Cut locus realizations on convex polyhedra},
  journal      = {Comput. Geom.},
  volume       = {114},
  pages        = {102010},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2023.102010},
  doi          = {10.1016/J.COMGEO.2023.102010},
  timestamp    = {Mon, 26 Jun 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ORourkeV23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Raussen23,
  author       = {Martin Raussen},
  title        = {Connectivity of spaces of directed paths in geometric models for concurrent
                  computation},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101942},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101942},
  doi          = {10.1016/J.COMGEO.2022.101942},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Raussen23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Scheucher23,
  author       = {Manfred Scheucher},
  title        = {Many order types on integer grids of polynomial size},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101924},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101924},
  doi          = {10.1016/J.COMGEO.2022.101924},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Scheucher23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SethMN23,
  author       = {Ritesh Seth and
                  Anil Maheshwari and
                  Subhas C. Nandy},
  title        = {Acrophobic guard watchtower problem},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101918},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101918},
  doi          = {10.1016/J.COMGEO.2022.101918},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/SethMN23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/StehrK23,
  author       = {Eva Stehr and
                  Linda Kleist},
  title        = {Folding polyiamonds into octahedra},
  journal      = {Comput. Geom.},
  volume       = {108},
  pages        = {101917},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101917},
  doi          = {10.1016/J.COMGEO.2022.101917},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/StehrK23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/UngerKM23,
  author       = {Florian Unger and
                  Jonathan Krebs and
                  Michael G. M{\"{u}}ller},
  title        = {Simplex closing probabilities in directed graphs},
  journal      = {Comput. Geom.},
  volume       = {109},
  pages        = {101941},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101941},
  doi          = {10.1016/J.COMGEO.2022.101941},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/UngerKM23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Vodolazskiy23,
  author       = {Evgeniy Vodolazskiy},
  title        = {Discrete Fr{\'{e}}chet distance for closed curves},
  journal      = {Comput. Geom.},
  volume       = {111},
  pages        = {101967},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101967},
  doi          = {10.1016/J.COMGEO.2022.101967},
  timestamp    = {Sat, 13 May 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Vodolazskiy23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WangZ23,
  author       = {Haitao Wang and
                  Yiming Zhao},
  title        = {An optimal algorithm for \emph{L}\({}_{\mbox{1}}\) shortest paths
                  in unit-disk graphs},
  journal      = {Comput. Geom.},
  volume       = {110},
  pages        = {101960},
  year         = {2023},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101960},
  doi          = {10.1016/J.COMGEO.2022.101960},
  timestamp    = {Fri, 20 Jan 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/WangZ23.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Abu-AffashBC22,
  author       = {A. Karim Abu{-}Affash and
                  Gali Bar{-}On and
                  Paz Carmi},
  title        = {\emph{{\(\delta\)}}-Greedy \emph{t}-spanner},
  journal      = {Comput. Geom.},
  volume       = {100},
  pages        = {101807},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101807},
  doi          = {10.1016/J.COMGEO.2021.101807},
  timestamp    = {Sat, 08 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Abu-AffashBC22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnCCABY22,
  author       = {Taehoon Ahn and
                  Jongmin Choi and
                  Chaeyoon Chung and
                  Hee{-}Kap Ahn and
                  Sang Won Bae and
                  Sang Duk Yoon},
  title        = {Rearranging a sequence of points onto a line},
  journal      = {Comput. Geom.},
  volume       = {107},
  pages        = {101887},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101887},
  doi          = {10.1016/J.COMGEO.2022.101887},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnCCABY22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnMS22,
  author       = {Hee{-}Kap Ahn and
                  Tamara Mtsentlintze and
                  J{\"{o}}rg{-}R{\"{u}}diger Sack},
  title        = {{CGTA} Awards},
  journal      = {Comput. Geom.},
  volume       = {107},
  pages        = {101896},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101896},
  doi          = {10.1016/J.COMGEO.2022.101896},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnMS22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerKSVV22,
  author       = {Oswin Aichholzer and
                  Jan Kyncl and
                  Manfred Scheucher and
                  Birgit Vogtenhuber and
                  Pavel Valtr},
  title        = {On crossing-families in planar point sets},
  journal      = {Comput. Geom.},
  volume       = {107},
  pages        = {101899},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101899},
  doi          = {10.1016/J.COMGEO.2022.101899},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerKSVV22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkitayaBB22,
  author       = {Hugo A. Akitaya and
                  Ahmad Biniaz and
                  Prosenjit Bose},
  title        = {On the spanning and routing ratios of the directed {\(\Theta\)}\({}_{\mbox{6}}\)-graph},
  journal      = {Comput. Geom.},
  volume       = {105-106},
  pages        = {101881},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101881},
  doi          = {10.1016/J.COMGEO.2022.101881},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AkitayaBB22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkitayaDETU22,
  author       = {Hugo A. Akitaya and
                  Erik D. Demaine and
                  David Eppstein and
                  Tomohiro Tachi and
                  Ryuhei Uehara},
  title        = {Ununfoldable polyhedra with 6 vertices or 6 faces},
  journal      = {Comput. Geom.},
  volume       = {103},
  pages        = {101857},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101857},
  doi          = {10.1016/J.COMGEO.2021.101857},
  timestamp    = {Sun, 12 Nov 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AkitayaDETU22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Almendra-Hernandez22,
  author       = {V{\'{\i}}ctor Hugo Almendra{-}Hern{\'{a}}ndez and
                  Leonardo Mart{\'{\i}}nez{-}Sandoval},
  title        = {On prescribing total orders and preorders to pairwise distances of
                  points in Euclidean space},
  journal      = {Comput. Geom.},
  volume       = {107},
  pages        = {101898},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101898},
  doi          = {10.1016/J.COMGEO.2022.101898},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Almendra-Hernandez22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlpertBBMNTY22,
  author       = {Hannah Alpert and
                  Russell J. Barnes and
                  Seth Bell and
                  Anna Mauro and
                  Na'ama Nevo and
                  Nataya Tucker and
                  Hanna Yang},
  title        = {Routing by matching on convex pieces of grid graphs},
  journal      = {Comput. Geom.},
  volume       = {104},
  pages        = {101862},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101862},
  doi          = {10.1016/J.COMGEO.2022.101862},
  timestamp    = {Fri, 13 May 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AlpertBBMNTY22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AsashibaBENY22,
  author       = {Hideto Asashiba and
                  Micka{\"{e}}l Buchet and
                  Emerson G. Escolar and
                  Ken Nakashima and
                  Michio Yoshiwaki},
  title        = {On interval decomposability of 2D persistence modules},
  journal      = {Comput. Geom.},
  volume       = {105-106},
  pages        = {101879},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101879},
  doi          = {10.1016/J.COMGEO.2022.101879},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AsashibaBENY22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AshurFKS22,
  author       = {Stav Ashur and
                  Omrit Filtser and
                  Matthew J. Katz and
                  Rachel Saban},
  title        = {Terrain-like graphs: PTASs for guarding weakly-visible polygons and
                  terrains},
  journal      = {Comput. Geom.},
  volume       = {101},
  pages        = {101832},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101832},
  doi          = {10.1016/J.COMGEO.2021.101832},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AshurFKS22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BakhsheshF22,
  author       = {Davood Bakhshesh and
                  Mohammad Farshi},
  title        = {On the plane angle-monotone graphs},
  journal      = {Comput. Geom.},
  volume       = {100},
  pages        = {101818},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101818},
  doi          = {10.1016/J.COMGEO.2021.101818},
  timestamp    = {Sat, 08 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BakhsheshF22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaloghCL22,
  author       = {J{\'{o}}zsef Balogh and
                  Felix Christian Clemen and
                  Bernard Lidick{\'{y}}},
  title        = {Maximum number of almost similar triangles in the plane},
  journal      = {Comput. Geom.},
  volume       = {105-106},
  pages        = {101880},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101880},
  doi          = {10.1016/J.COMGEO.2022.101880},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaloghCL22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BauernoppelMS22,
  author       = {Frank Bauern{\"{o}}ppel and
                  Anil Maheshwari and
                  J{\"{o}}rg{-}R{\"{u}}diger Sack},
  title        = {An {\(\Omega\)}(\emph{n}\({}^{\mbox{\emph{d}}}\)) lower bound on the
                  number of cell crossings for weighted shortest paths in \emph{d}-dimensional
                  polyhedral structures},
  journal      = {Comput. Geom.},
  volume       = {107},
  pages        = {101897},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101897},
  doi          = {10.1016/J.COMGEO.2022.101897},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BauernoppelMS22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeltramoS22,
  author       = {Gabriele Beltramo and
                  Primoz Skraba},
  title        = {Persistent homology in \emph{{\(\mathscr{l}\)}}\({}_{\mbox{{\(\infty\)}}}\)
                  metric},
  journal      = {Comput. Geom.},
  volume       = {101},
  pages        = {101821},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101821},
  doi          = {10.1016/J.COMGEO.2021.101821},
  timestamp    = {Sat, 08 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BeltramoS22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCKM0MS22,
  author       = {Prosenjit Bose and
                  Paz Carmi and
                  J. Mark Keil and
                  Anil Maheshwari and
                  Saeed Mehrabi and
                  Debajyoti Mondal and
                  Michiel Smid},
  title        = {Computing maximum independent set on outerstring graphs and their
                  relatives},
  journal      = {Comput. Geom.},
  volume       = {103},
  pages        = {101852},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101852},
  doi          = {10.1016/J.COMGEO.2021.101852},
  timestamp    = {Tue, 15 Mar 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseCKM0MS22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BubenikE22,
  author       = {Peter Bubenik and
                  Alex Elchesen},
  title        = {Universality of persistence diagrams and the bottleneck and Wasserstein
                  distances},
  journal      = {Comput. Geom.},
  volume       = {105-106},
  pages        = {101882},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101882},
  doi          = {10.1016/J.COMGEO.2022.101882},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BubenikE22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinK22,
  author       = {Maike Buchin and
                  Bernhard Kilgus},
  title        = {Fr{\'{e}}chet distance between two point sets},
  journal      = {Comput. Geom.},
  volume       = {102},
  pages        = {101842},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101842},
  doi          = {10.1016/J.COMGEO.2021.101842},
  timestamp    = {Mon, 03 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BuchinK22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CanoTUV22,
  author       = {Javier Cano and
                  Csaba D. T{\'{o}}th and
                  Jorge Urrutia and
                  Giovanni Viglietta},
  title        = {Edge guards for polyhedra in three-space},
  journal      = {Comput. Geom.},
  volume       = {104},
  pages        = {101859},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101859},
  doi          = {10.1016/J.COMGEO.2022.101859},
  timestamp    = {Fri, 01 Apr 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CanoTUV22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarufelF22,
  author       = {Jean{-}Lou De Carufel and
                  Zachary Friggstad},
  title        = {Preface},
  journal      = {Comput. Geom.},
  volume       = {101},
  pages        = {101776},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101776},
  doi          = {10.1016/J.COMGEO.2021.101776},
  timestamp    = {Mon, 27 Dec 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CarufelF22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChakrabortyDM22,
  author       = {Dibyayan Chakraborty and
                  Sandip Das and
                  Joydeep Mukherjee},
  title        = {On dominating set of some subclasses of string graphs},
  journal      = {Comput. Geom.},
  volume       = {107},
  pages        = {101884},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101884},
  doi          = {10.1016/J.COMGEO.2022.101884},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChakrabortyDM22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanR22,
  author       = {Timothy M. Chan and
                  Zahed Rahmati},
  title        = {Corrigendum to "Approximating the minimum closest pair distance and
                  nearest neighbor distances of linearly moving points" [Comput. Geom.
                  60 {(2017)} 2-7]},
  journal      = {Comput. Geom.},
  volume       = {101},
  pages        = {101831},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101831},
  doi          = {10.1016/J.COMGEO.2021.101831},
  timestamp    = {Mon, 27 Dec 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChanR22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DezaP22,
  author       = {Antoine Deza and
                  Lionel Pournin},
  title        = {A linear optimization oracle for zonotope computation},
  journal      = {Comput. Geom.},
  volume       = {100},
  pages        = {101809},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101809},
  doi          = {10.1016/J.COMGEO.2021.101809},
  timestamp    = {Mon, 27 Dec 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DezaP22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuGT22,
  author       = {Adrian Dumitrescu and
                  Anirban Ghosh and
                  Csaba D. T{\'{o}}th},
  title        = {Sparse hop spanners for unit disk graphs},
  journal      = {Comput. Geom.},
  volume       = {100},
  pages        = {101808},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101808},
  doi          = {10.1016/J.COMGEO.2021.101808},
  timestamp    = {Mon, 03 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DumitrescuGT22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EvansFKSSW22,
  author       = {William S. Evans and
                  Krzysztof Fleszar and
                  Philipp Kindermann and
                  Noushin Saeedi and
                  Chan{-}Su Shin and
                  Alexander Wolff},
  title        = {Minimum rectilinear polygons for given angle sequences},
  journal      = {Comput. Geom.},
  volume       = {100},
  pages        = {101820},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101820},
  doi          = {10.1016/J.COMGEO.2021.101820},
  timestamp    = {Sat, 08 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/EvansFKSSW22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Frati22,
  author       = {Fabrizio Frati},
  title        = {Planar rectilinear drawings of outerplanar graphs in linear time},
  journal      = {Comput. Geom.},
  volume       = {103},
  pages        = {101854},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101854},
  doi          = {10.1016/J.COMGEO.2021.101854},
  timestamp    = {Tue, 01 Mar 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Frati22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Guo0P22,
  author       = {Zhengyang Guo and
                  Yi Li and
                  Shaoyu Pei},
  title        = {Expected size of random Tukey layers and convex layers},
  journal      = {Comput. Geom.},
  volume       = {103},
  pages        = {101856},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101856},
  doi          = {10.1016/J.COMGEO.2021.101856},
  timestamp    = {Tue, 15 Mar 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Guo0P22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HoriyamaKKPUY22,
  author       = {Takashi Horiyama and
                  Fabian Klute and
                  Matias Korman and
                  Irene Parada and
                  Ryuhei Uehara and
                  Katsuhisa Yamanaka},
  title        = {Efficient segment folding is hard},
  journal      = {Comput. Geom.},
  volume       = {104},
  pages        = {101860},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101860},
  doi          = {10.1016/J.COMGEO.2022.101860},
  timestamp    = {Fri, 01 Apr 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/HoriyamaKKPUY22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HuicocheaLR22,
  author       = {Mario Huicochea and
                  Jes{\'{u}}s Lea{\~{n}}os and
                  Luis Manuel Rivera},
  title        = {A note on the minimum number of red lines needed to pierce the intersections
                  of blue lines},
  journal      = {Comput. Geom.},
  volume       = {104},
  pages        = {101863},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101863},
  doi          = {10.1016/J.COMGEO.2022.101863},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/HuicocheaLR22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/JanaMR22,
  author       = {Satyabrata Jana and
                  Anil Maheshwari and
                  Sasanka Roy},
  title        = {Linear-size planar Manhattan network for convex point sets},
  journal      = {Comput. Geom.},
  volume       = {100},
  pages        = {101819},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101819},
  doi          = {10.1016/J.COMGEO.2021.101819},
  timestamp    = {Mon, 03 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/JanaMR22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KaziS22,
  author       = {Abrar Kazi and
                  Michiel Smid},
  title        = {Closest-pair queries and minimum-weight queries are equivalent for
                  squares},
  journal      = {Comput. Geom.},
  volume       = {100},
  pages        = {101810},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101810},
  doi          = {10.1016/J.COMGEO.2021.101810},
  timestamp    = {Sat, 08 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KaziS22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimA22,
  author       = {Mincheol Kim and
                  Hee{-}Kap Ahn},
  title        = {Minimum-link shortest paths for polygons amidst rectilinear obstacles},
  journal      = {Comput. Geom.},
  volume       = {103},
  pages        = {101858},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101858},
  doi          = {10.1016/J.COMGEO.2022.101858},
  timestamp    = {Tue, 15 Mar 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KimA22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KodmonL22,
  author       = {Csenge Lili K{\"{o}}dm{\"{o}}n and
                  Zsolt L{\'{a}}ngi},
  title        = {Extremal convex polygons inscribed in a given convex polygon},
  journal      = {Comput. Geom.},
  volume       = {102},
  pages        = {101844},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101844},
  doi          = {10.1016/J.COMGEO.2021.101844},
  timestamp    = {Sat, 08 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KodmonL22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KreveldMOSV22,
  author       = {Marc J. van Kreveld and
                  Tillmann Miltzow and
                  Tim Ophelders and
                  Willem Sonke and
                  Jordi L. Vermeulen},
  title        = {Between shapes, using the Hausdorff distance},
  journal      = {Comput. Geom.},
  volume       = {100},
  pages        = {101817},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101817},
  doi          = {10.1016/J.COMGEO.2021.101817},
  timestamp    = {Sat, 08 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KreveldMOSV22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KumarSS22,
  author       = {Neeraj Kumar and
                  Stavros Sintos and
                  Subhash Suri},
  title        = {The maximum exposure problem},
  journal      = {Comput. Geom.},
  volume       = {104},
  pages        = {101861},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101861},
  doi          = {10.1016/J.COMGEO.2022.101861},
  timestamp    = {Fri, 01 Apr 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KumarSS22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LenchnerP22,
  author       = {Jonathan Lenchner and
                  Eli Packer},
  title        = {Line segment visibility with sidedness constraints},
  journal      = {Comput. Geom.},
  volume       = {107},
  pages        = {101885},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101885},
  doi          = {10.1016/J.COMGEO.2022.101885},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/LenchnerP22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Matthews22,
  author       = {Polly Matthews Jr.},
  title        = {Distinct distances with \emph{{\(\mathscr{l}\)}}\({}_{\mbox{\emph{p}}}\)
                  metrics},
  journal      = {Comput. Geom.},
  volume       = {100},
  pages        = {101785},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101785},
  doi          = {10.1016/J.COMGEO.2021.101785},
  timestamp    = {Mon, 27 Dec 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Matthews22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MessinaS22,
  author       = {John A. Messina and
                  Pablo Sober{\'{o}}n},
  title        = {Isometric and affine copies of a set in volumetric Helly results},
  journal      = {Comput. Geom.},
  volume       = {103},
  pages        = {101855},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101855},
  doi          = {10.1016/J.COMGEO.2021.101855},
  timestamp    = {Tue, 15 Mar 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MessinaS22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PedersenW22,
  author       = {Logan Pedersen and
                  Haitao Wang},
  title        = {Algorithms for the line-constrained disk coverage and related problems},
  journal      = {Comput. Geom.},
  volume       = {105-106},
  pages        = {101883},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101883},
  doi          = {10.1016/J.COMGEO.2022.101883},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/PedersenW22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RadermacherR22,
  author       = {Marcel Radermacher and
                  Ignaz Rutter},
  title        = {Inserting an edge into a geometric embedding},
  journal      = {Comput. Geom.},
  volume       = {102},
  pages        = {101843},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101843},
  doi          = {10.1016/J.COMGEO.2021.101843},
  timestamp    = {Sat, 08 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/RadermacherR22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Scheffer22,
  author       = {Christian Scheffer},
  title        = {The prefix Fr{\'{e}}chet similarity},
  journal      = {Comput. Geom.},
  volume       = {103},
  pages        = {101853},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101853},
  doi          = {10.1016/J.COMGEO.2021.101853},
  timestamp    = {Tue, 15 Mar 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Scheffer22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WangX22,
  author       = {Haitao Wang and
                  Jie Xue},
  title        = {Improved algorithms for the bichromatic two-center problem for pairs
                  of points},
  journal      = {Comput. Geom.},
  volume       = {100},
  pages        = {101806},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101806},
  doi          = {10.1016/J.COMGEO.2021.101806},
  timestamp    = {Thu, 04 Aug 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/WangX22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZinkWBW22,
  author       = {Johannes Zink and
                  Julian Walter and
                  Joachim Baumeister and
                  Alexander Wolff},
  title        = {Layered drawing of undirected graphs with generalized port constraints},
  journal      = {Comput. Geom.},
  volume       = {105-106},
  pages        = {101886},
  year         = {2022},
  url          = {https://doi.org/10.1016/j.comgeo.2022.101886},
  doi          = {10.1016/J.COMGEO.2022.101886},
  timestamp    = {Wed, 14 Feb 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ZinkWBW22.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbelACDDHKLRR21,
  author       = {Zachary Abel and
                  Hugo A. Akitaya and
                  Man{-}Kwun Chiu and
                  Erik D. Demaine and
                  Martin L. Demaine and
                  Adam Hesterberg and
                  Matias Korman and
                  Jayson Lynch and
                  Andr{\'{e}} van Renssen and
                  Marcel Roeloffzen},
  title        = {Snipperclips: Cutting tools into desired polygons using themselves},
  journal      = {Comput. Geom.},
  volume       = {98},
  pages        = {101784},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101784},
  doi          = {10.1016/J.COMGEO.2021.101784},
  timestamp    = {Tue, 13 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AbelACDDHKLRR21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbelDDKLIN21,
  author       = {Zachary Abel and
                  Erik D. Demaine and
                  Martin L. Demaine and
                  Jason S. Ku and
                  Jayson Lynch and
                  Jin{-}ichi Itoh and
                  Chie Nara},
  title        = {Continuous flattening of all polyhedral manifolds using countably
                  infinite creases},
  journal      = {Comput. Geom.},
  volume       = {98},
  pages        = {101773},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101773},
  doi          = {10.1016/J.COMGEO.2021.101773},
  timestamp    = {Tue, 13 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AbelDDKLIN21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AckermanKP21,
  author       = {Eyal Ackerman and
                  Bal{\'{a}}zs Keszegh and
                  D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi},
  title        = {Coloring Delaunay-edges and their generalizations},
  journal      = {Comput. Geom.},
  volume       = {96},
  pages        = {101745},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101745},
  doi          = {10.1016/J.COMGEO.2021.101745},
  timestamp    = {Thu, 29 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AckermanKP21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerACDDF21,
  author       = {Oswin Aichholzer and
                  Hugo A. Akitaya and
                  Kenneth C. Cheung and
                  Erik D. Demaine and
                  Martin L. Demaine and
                  S{\'{a}}ndor P. Fekete and
                  Linda Kleist and
                  Irina Kostitsyna and
                  Maarten L{\"{o}}ffler and
                  Zuzana Mas{\'{a}}rov{\'{a}} and
                  Klara Mundilova and
                  Christiane Schmidt},
  title        = {Folding polyominoes with holes into a cube},
  journal      = {Comput. Geom.},
  volume       = {93},
  pages        = {101700},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101700},
  doi          = {10.1016/J.COMGEO.2020.101700},
  timestamp    = {Sat, 14 Nov 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerACDDF21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkitayaBKSW21,
  author       = {Hugo A. Akitaya and
                  Maike Buchin and
                  Bernhard Kilgus and
                  Stef Sijben and
                  Carola Wenk},
  title        = {Distance measures for embedded graphs},
  journal      = {Comput. Geom.},
  volume       = {95},
  pages        = {101743},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101743},
  doi          = {10.1016/J.COMGEO.2020.101743},
  timestamp    = {Tue, 02 Mar 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AkitayaBKSW21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovDEP21,
  author       = {Boris Aronov and
                  Anirudh Donakonda and
                  Esther Ezra and
                  Rom Pinchasi},
  title        = {On pseudo-disk hypergraphs},
  journal      = {Comput. Geom.},
  volume       = {92},
  pages        = {101687},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101687},
  doi          = {10.1016/J.COMGEO.2020.101687},
  timestamp    = {Mon, 26 Oct 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AronovDEP21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArsenevaCKMOORR21,
  author       = {Elena Arseneva and
                  Man{-}Kwun Chiu and
                  Matias Korman and
                  Aleksandar Markovic and
                  Yoshio Okamoto and
                  Aur{\'{e}}lien Ooms and
                  Andr{\'{e}} van Renssen and
                  Marcel Roeloffzen},
  title        = {Rectilinear link diameter and radius in a rectilinear polygonal domain},
  journal      = {Comput. Geom.},
  volume       = {92},
  pages        = {101685},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101685},
  doi          = {10.1016/J.COMGEO.2020.101685},
  timestamp    = {Thu, 29 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ArsenevaCKMOORR21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bae21,
  author       = {Sang Won Bae},
  title        = {On the minimum-area rectangular and square annulus problem},
  journal      = {Comput. Geom.},
  volume       = {92},
  pages        = {101697},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101697},
  doi          = {10.1016/J.COMGEO.2020.101697},
  timestamp    = {Thu, 16 Sep 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Bae21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeBM21,
  author       = {Sang Won Bae and
                  Arpita Baral and
                  Priya Ranjan Sinha Mahapatra},
  title        = {Maximum-width empty square and rectangular annulus},
  journal      = {Comput. Geom.},
  volume       = {96},
  pages        = {101747},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101747},
  doi          = {10.1016/J.COMGEO.2021.101747},
  timestamp    = {Sat, 09 Apr 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaeBM21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BakhsheshF21,
  author       = {Davood Bakhshesh and
                  Mohammad Farshi},
  title        = {Angle-monotonicity of Delaunay triangulation},
  journal      = {Comput. Geom.},
  volume       = {94},
  pages        = {101711},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101711},
  doi          = {10.1016/J.COMGEO.2020.101711},
  timestamp    = {Thu, 17 Dec 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BakhsheshF21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BankovicM21,
  author       = {Milan Bankovic and
                  Filip Maric},
  title        = {Farad{\v{z}}ev Read-type enumeration of non-isomorphic {CC} systems},
  journal      = {Comput. Geom.},
  volume       = {97},
  pages        = {101770},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101770},
  doi          = {10.1016/J.COMGEO.2021.101770},
  timestamp    = {Tue, 01 Jun 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BankovicM21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarequetBO21,
  author       = {Gill Barequet and
                  Gil Ben{-}Shachar and
                  Martha C. Osegueda},
  title        = {Concatenation arguments and their applications to polyominoes and
                  polycubes},
  journal      = {Comput. Geom.},
  volume       = {98},
  pages        = {101790},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101790},
  doi          = {10.1016/J.COMGEO.2021.101790},
  timestamp    = {Tue, 13 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BarequetBO21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BekosGMPST21,
  author       = {Michael A. Bekos and
                  Martin Gronemann and
                  Fabrizio Montecchiani and
                  D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi and
                  Antonios Symvonis and
                  Leonidas Theocharous},
  title        = {Grid drawings of graphs with constant edge-vertex resolution},
  journal      = {Comput. Geom.},
  volume       = {98},
  pages        = {101789},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101789},
  doi          = {10.1016/J.COMGEO.2021.101789},
  timestamp    = {Tue, 13 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BekosGMPST21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BhattacharyaBCD21,
  author       = {Binay Bhattacharya and
                  Arijit Bishnu and
                  Otfried Cheong and
                  Sandip Das and
                  Arindam Karmakar and
                  Jack Snoeyink},
  title        = {Computation of spatial skyline points},
  journal      = {Comput. Geom.},
  volume       = {93},
  pages        = {101698},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101698},
  doi          = {10.1016/J.COMGEO.2020.101698},
  timestamp    = {Sat, 14 Nov 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BhattacharyaBCD21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlBL21,
  author       = {Therese Biedl and
                  Ahmad Biniaz and
                  Anna Lubiw},
  title        = {Minimum ply covering of points with disks and squares},
  journal      = {Comput. Geom.},
  volume       = {94},
  pages        = {101712},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101712},
  doi          = {10.1016/J.COMGEO.2020.101712},
  timestamp    = {Thu, 11 Aug 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiedlBL21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCS21,
  author       = {Prosenjit Bose and
                  Paz Carmi and
                  Thomas C. Shermer},
  title        = {Piercing pairwise intersecting geodesic disks},
  journal      = {Comput. Geom.},
  volume       = {98},
  pages        = {101774},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101774},
  doi          = {10.1016/J.COMGEO.2021.101774},
  timestamp    = {Tue, 13 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseCS21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseS21,
  author       = {Prosenjit Bose and
                  Thomas C. Shermer},
  title        = {Attraction-convexity and normal visibility},
  journal      = {Comput. Geom.},
  volume       = {96},
  pages        = {101748},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101748},
  doi          = {10.1016/J.COMGEO.2021.101748},
  timestamp    = {Thu, 29 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseS21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloM21,
  author       = {Sergio Cabello and
                  Wolfgang Mulzer},
  title        = {Minimum cuts in geometric intersection graphs},
  journal      = {Comput. Geom.},
  volume       = {94},
  pages        = {101720},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101720},
  doi          = {10.1016/J.COMGEO.2020.101720},
  timestamp    = {Thu, 17 Dec 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CabelloM21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CaraballoDMHLM21,
  author       = {Luis Evaristo Caraballo and
                  Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
                  Ruy Fabila Monroy and
                  Carlos Hidalgo{-}Toscano and
                  Jes{\'{u}}s Lea{\~{n}}os and
                  Amanda Montejano},
  title        = {On the number of order types in integer grids of small size},
  journal      = {Comput. Geom.},
  volume       = {95},
  pages        = {101730},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101730},
  doi          = {10.1016/J.COMGEO.2020.101730},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CaraballoDMHLM21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiKSS21,
  author       = {Paz Carmi and
                  Matthew J. Katz and
                  Rachel Saban and
                  Yael Stein},
  title        = {Improved PTASs for convex barrier coverage},
  journal      = {Comput. Geom.},
  volume       = {92},
  pages        = {101684},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101684},
  doi          = {10.1016/J.COMGEO.2020.101684},
  timestamp    = {Mon, 21 Sep 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CarmiKSS21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChoiA21,
  author       = {Jongmin Choi and
                  Hee{-}Kap Ahn},
  title        = {Efficient planar two-center algorithms},
  journal      = {Comput. Geom.},
  volume       = {97},
  pages        = {101768},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101768},
  doi          = {10.1016/J.COMGEO.2021.101768},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChoiA21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChoiLA21,
  author       = {Yujin Choi and
                  Seungjun Lee and
                  Hee{-}Kap Ahn},
  title        = {Maximum-area and maximum-perimeter rectangles in polygons},
  journal      = {Comput. Geom.},
  volume       = {94},
  pages        = {101710},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101710},
  doi          = {10.1016/J.COMGEO.2020.101710},
  timestamp    = {Thu, 17 Dec 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChoiLA21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChuggEW21,
  author       = {Ben Chugg and
                  William S. Evans and
                  Kelvin Wong},
  title        = {Simultaneous visibility representations of undirected pairs of graphs},
  journal      = {Comput. Geom.},
  volume       = {98},
  pages        = {101788},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101788},
  doi          = {10.1016/J.COMGEO.2021.101788},
  timestamp    = {Tue, 13 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChuggEW21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DaescuT21,
  author       = {Ovidiu Daescu and
                  Ka Yaw Teo},
  title        = {Characterization and computation of feasible trajectories for an articulated
                  probe with a variable-length end segment},
  journal      = {Comput. Geom.},
  volume       = {96},
  pages        = {101756},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101756},
  doi          = {10.1016/J.COMGEO.2021.101756},
  timestamp    = {Wed, 21 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DaescuT21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DamianF21,
  author       = {Mirela Damian and
                  Robin Y. Flatland},
  title        = {Unfolding polycube trees with constant refinement},
  journal      = {Comput. Geom.},
  volume       = {98},
  pages        = {101793},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101793},
  doi          = {10.1016/J.COMGEO.2021.101793},
  timestamp    = {Tue, 13 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DamianF21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Diaz-BanezMU21,
  author       = {Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
                  Ruy Fabila Monroy and
                  Jorge Urrutia},
  title        = {A note on empty balanced tetrahedra in two-colored point sets in {R3}},
  journal      = {Comput. Geom.},
  volume       = {96},
  pages        = {101757},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101757},
  doi          = {10.1016/J.COMGEO.2021.101757},
  timestamp    = {Thu, 29 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Diaz-BanezMU21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EderHP21,
  author       = {G{\"{u}}nther Eder and
                  Martin Held and
                  Peter Palfrader},
  title        = {Implementing straight skeletons with exact arithmetic: Challenges
                  and experiences},
  journal      = {Comput. Geom.},
  volume       = {96},
  pages        = {101760},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101760},
  doi          = {10.1016/J.COMGEO.2021.101760},
  timestamp    = {Sat, 09 Apr 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/EderHP21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Flores-VelazcoM21,
  author       = {Alejandro Flores{-}Velazco and
                  David M. Mount},
  title        = {Guarantees on nearest-neighbor condensation heuristics},
  journal      = {Comput. Geom.},
  volume       = {95},
  pages        = {101732},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101732},
  doi          = {10.1016/J.COMGEO.2020.101732},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Flores-VelazcoM21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GitikBJ21,
  author       = {Rivka Gitik and
                  Or Bartal and
                  Leo Joskowicz},
  title        = {Euclidean minimum spanning trees with independent and dependent geometric
                  uncertainties},
  journal      = {Comput. Geom.},
  volume       = {96},
  pages        = {101744},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101744},
  doi          = {10.1016/J.COMGEO.2020.101744},
  timestamp    = {Mon, 05 Feb 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GitikBJ21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GuimaraesC21,
  author       = {Dilson Almeida Guimar{\~{a}}es and
                  Alexandre Salles da Cunha},
  title        = {The minimum area spanning tree problem: Formulations, Benders decomposition
                  and branch-and-cut algorithms},
  journal      = {Comput. Geom.},
  volume       = {97},
  pages        = {101771},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101771},
  doi          = {10.1016/J.COMGEO.2021.101771},
  timestamp    = {Tue, 01 Jun 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GuimaraesC21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HuangCX21,
  author       = {Ziyun Huang and
                  Danny Z. Chen and
                  Jinhui Xu},
  title        = {Influence-based Voronoi diagrams of clusters},
  journal      = {Comput. Geom.},
  volume       = {96},
  pages        = {101746},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101746},
  doi          = {10.1016/J.COMGEO.2021.101746},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/HuangCX21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/JohnsonW21,
  author       = {Christopher Johnson and
                  Haitao Wang},
  title        = {A linear-time algorithm for radius-optimally augmenting paths in a
                  metric space},
  journal      = {Comput. Geom.},
  volume       = {96},
  pages        = {101759},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101759},
  doi          = {10.1016/J.COMGEO.2021.101759},
  timestamp    = {Thu, 29 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/JohnsonW21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KeikhaLM21,
  author       = {Vahideh Keikha and
                  Maarten L{\"{o}}ffler and
                  Ali Mohades},
  title        = {Largest and smallest area triangles on imprecise points},
  journal      = {Comput. Geom.},
  volume       = {95},
  pages        = {101742},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101742},
  doi          = {10.1016/J.COMGEO.2020.101742},
  timestamp    = {Thu, 14 Oct 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KeikhaLM21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Kejlberg-Rasmussen21,
  author       = {Casper Kejlberg{-}Rasmussen and
                  Yufei Tao and
                  Konstantinos Tsakalidis and
                  Kostas Tsichlas and
                  Jeonghun Yoon},
  title        = {I/O-efficient 2-d orthogonal range skyline and attrition priority
                  queues},
  journal      = {Comput. Geom.},
  volume       = {93},
  pages        = {101689},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101689},
  doi          = {10.1016/J.COMGEO.2020.101689},
  timestamp    = {Wed, 07 Dec 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Kejlberg-Rasmussen21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KilicKO21,
  author       = {Mehmet Kili{\c{c}} and
                  Sahin Ko{\c{c}}ak and
                  Yunus {\"{O}}zdemir},
  title        = {An algorithm for the construction of the tight span of finite subsets
                  of the Manhattan plane},
  journal      = {Comput. Geom.},
  volume       = {95},
  pages        = {101741},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101741},
  doi          = {10.1016/J.COMGEO.2020.101741},
  timestamp    = {Tue, 02 Mar 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KilicKO21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimKKLS21,
  author       = {Sang{-}Sub Kim and
                  Rolf Klein and
                  David K{\"{u}}bel and
                  Elmar Langetepe and
                  Barbara Schwarzwald},
  title        = {Geometric firefighting in the half-plane},
  journal      = {Comput. Geom.},
  volume       = {95},
  pages        = {101728},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101728},
  doi          = {10.1016/J.COMGEO.2020.101728},
  timestamp    = {Tue, 02 Mar 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KimKKLS21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimYA21,
  author       = {Mincheol Kim and
                  Sang Duk Yoon and
                  Hee{-}Kap Ahn},
  title        = {Shortest rectilinear path queries to rectangles in a rectangular domain},
  journal      = {Comput. Geom.},
  volume       = {99},
  pages        = {101796},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101796},
  doi          = {10.1016/J.COMGEO.2021.101796},
  timestamp    = {Sat, 08 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KimYA21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KipouridisKPT21,
  author       = {Evangelos Kipouridis and
                  Andreas Kosmatopoulos and
                  Apostolos N. Papadopoulos and
                  Kostas Tsichlas},
  title        = {Dynamic layers of maxima with applications to dominating queries},
  journal      = {Comput. Geom.},
  volume       = {93},
  pages        = {101699},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101699},
  doi          = {10.1016/J.COMGEO.2020.101699},
  timestamp    = {Thu, 14 Oct 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KipouridisKPT21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KlimenkoRB21,
  author       = {Georgiy Klimenko and
                  Benjamin Raichel and
                  Gregory Van Buskirk},
  title        = {Sparse convex hull coverage},
  journal      = {Comput. Geom.},
  volume       = {98},
  pages        = {101787},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101787},
  doi          = {10.1016/J.COMGEO.2021.101787},
  timestamp    = {Tue, 13 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KlimenkoRB21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KluteLN21,
  author       = {Fabian Klute and
                  Maarten L{\"{o}}ffler and
                  Martin N{\"{o}}llenburg},
  title        = {Labeling nonograms: Boundary labeling for curve arrangements},
  journal      = {Comput. Geom.},
  volume       = {98},
  pages        = {101791},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101791},
  doi          = {10.1016/J.COMGEO.2021.101791},
  timestamp    = {Tue, 13 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KluteLN21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KubelL21,
  author       = {David K{\"{u}}bel and
                  Elmar Langetepe},
  title        = {On the approximation of shortest escape paths},
  journal      = {Comput. Geom.},
  volume       = {93},
  pages        = {101709},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101709},
  doi          = {10.1016/J.COMGEO.2020.101709},
  timestamp    = {Fri, 13 Nov 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KubelL21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Laczkovich21,
  author       = {Mikl{\'{o}}s Laczkovich},
  title        = {Tilings of the regular \emph{N}-gon with triangles of angles \emph{{\(\pi\)}}/\emph{N},
                  \emph{{\(\pi\)}}/\emph{N}, (\emph{N}{\unicode{8239}}-{\unicode{8239}}2)\emph{{\(\pi\)}}/\emph{N}
                  for \emph{N}{\unicode{8239}}={\unicode{8239}}5, 8, 10 and 12},
  journal      = {Comput. Geom.},
  volume       = {92},
  pages        = {101690},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101690},
  doi          = {10.1016/J.COMGEO.2020.101690},
  timestamp    = {Fri, 14 May 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Laczkovich21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LeeEA21,
  author       = {Seungjun Lee and
                  Taekang Eom and
                  Hee{-}Kap Ahn},
  title        = {Largest triangles in a polygon},
  journal      = {Comput. Geom.},
  volume       = {98},
  pages        = {101792},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101792},
  doi          = {10.1016/J.COMGEO.2021.101792},
  timestamp    = {Tue, 13 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/LeeEA21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Lund21,
  author       = {Ben Lund},
  title        = {Two theorems on point-flat incidences},
  journal      = {Comput. Geom.},
  volume       = {92},
  pages        = {101681},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101681},
  doi          = {10.1016/J.COMGEO.2020.101681},
  timestamp    = {Thu, 29 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Lund21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/McCoyS21,
  author       = {Stephanie McCoy and
                  N{\'{a}}ndor Sieben},
  title        = {Impartial achievement games on convex geometries},
  journal      = {Comput. Geom.},
  volume       = {98},
  pages        = {101786},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101786},
  doi          = {10.1016/J.COMGEO.2021.101786},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/McCoyS21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MonroyPT21,
  author       = {Ruy Fabila Monroy and
                  Daniel Perz and
                  Ana Laura Trujillo{-}Negrete},
  title        = {Empty rainbow triangles in \emph{k}-colored point sets},
  journal      = {Comput. Geom.},
  volume       = {95},
  pages        = {101731},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101731},
  doi          = {10.1016/J.COMGEO.2020.101731},
  timestamp    = {Tue, 02 Mar 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MonroyPT21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/NassihANANH21,
  author       = {Bouchra Nassih and
                  Aouatif Amine and
                  Mohammed Ngadi and
                  Youssef Azdoud and
                  Driss Naji and
                  Nabil Hmina},
  title        = {An efficient three-dimensional face recognition system based random
                  forest and geodesic curves},
  journal      = {Comput. Geom.},
  volume       = {97},
  pages        = {101758},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101758},
  doi          = {10.1016/J.COMGEO.2021.101758},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/NassihANANH21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ParkC21,
  author       = {Ji{-}won Park and
                  Otfried Cheong},
  title        = {Smallest universal covers for families of triangles},
  journal      = {Comput. Geom.},
  volume       = {92},
  pages        = {101686},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101686},
  doi          = {10.1016/J.COMGEO.2020.101686},
  timestamp    = {Sun, 25 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ParkC21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PilzS21,
  author       = {Alexander Pilz and
                  Patrick Schnider},
  title        = {Bisecting three classes of lines},
  journal      = {Comput. Geom.},
  volume       = {98},
  pages        = {101775},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101775},
  doi          = {10.1016/J.COMGEO.2021.101775},
  timestamp    = {Wed, 27 Jul 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/PilzS21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SapucaiaRS21,
  author       = {Allan Sapucaia and
                  Pedro J. de Rezende and
                  Cid C. de Souza},
  title        = {Solving the minimum convex partition of point sets with integer programming},
  journal      = {Comput. Geom.},
  volume       = {99},
  pages        = {101794},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101794},
  doi          = {10.1016/J.COMGEO.2021.101794},
  timestamp    = {Sat, 08 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SapucaiaRS21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Sastry21,
  author       = {Shankar P. Sastry},
  title        = {A 2D advancing-front Delaunay mesh refinement algorithm},
  journal      = {Comput. Geom.},
  volume       = {97},
  pages        = {101772},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101772},
  doi          = {10.1016/J.COMGEO.2021.101772},
  timestamp    = {Mon, 25 Apr 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Sastry21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Smid21,
  author       = {Michiel H. M. Smid},
  title        = {An improved construction for spanners of disks},
  journal      = {Comput. Geom.},
  volume       = {92},
  pages        = {101682},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101682},
  doi          = {10.1016/J.COMGEO.2020.101682},
  timestamp    = {Mon, 21 Sep 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Smid21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/TanJ21,
  author       = {Xuehou Tan and
                  Bo Jiang},
  title        = {On the upper bound on the average distance from the Fermat-Weber center
                  of a convex body},
  journal      = {Comput. Geom.},
  volume       = {97},
  pages        = {101769},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101769},
  doi          = {10.1016/J.COMGEO.2021.101769},
  timestamp    = {Tue, 01 Jun 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/TanJ21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/TillmannK21,
  author       = {Andreas M. Tillmann and
                  Leif Kobbelt},
  title        = {Structured discrete shape approximation: Theoretical complexity and
                  practical algorithm},
  journal      = {Comput. Geom.},
  volume       = {99},
  pages        = {101795},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2021.101795},
  doi          = {10.1016/J.COMGEO.2021.101795},
  timestamp    = {Thu, 23 Jun 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/TillmannK21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Verdonschot21,
  author       = {Sander Verdonschot},
  title        = {Flipping in spirals},
  journal      = {Comput. Geom.},
  volume       = {95},
  pages        = {101729},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101729},
  doi          = {10.1016/J.COMGEO.2020.101729},
  timestamp    = {Tue, 02 Mar 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Verdonschot21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZhouCY21,
  author       = {Bo Zhou and
                  Yi{-}Jen Chiang and
                  Chee Yap},
  title        = {Soft subdivision motion planning for complex planar robots},
  journal      = {Comput. Geom.},
  volume       = {92},
  pages        = {101683},
  year         = {2021},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101683},
  doi          = {10.1016/J.COMGEO.2020.101683},
  timestamp    = {Thu, 29 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ZhouCY21.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AgrawalLXJ20,
  author       = {Akash Agrawal and
                  Yuan Li and
                  Jie Xue and
                  Ravi Janardan},
  title        = {The most-likely skyline problem for stochastic points},
  journal      = {Comput. Geom.},
  volume       = {88},
  pages        = {101609},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101609},
  doi          = {10.1016/J.COMGEO.2020.101609},
  timestamp    = {Fri, 27 Nov 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AgrawalLXJ20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnABOSW20,
  author       = {Hee{-}Kap Ahn and
                  Helmut Alt and
                  Maike Buchin and
                  Eunjin Oh and
                  Ludmila Scharf and
                  Carola Wenk},
  title        = {Middle curves based on discrete Fr{\'{e}}chet distance},
  journal      = {Comput. Geom.},
  volume       = {89},
  pages        = {101621},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101621},
  doi          = {10.1016/J.COMGEO.2020.101621},
  timestamp    = {Sun, 12 Nov 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnABOSW20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AigerKS20,
  author       = {Dror Aiger and
                  Haim Kaplan and
                  Micha Sharir},
  title        = {Output sensitive algorithms for approximate incidences and their applications},
  journal      = {Comput. Geom.},
  volume       = {91},
  pages        = {101666},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101666},
  doi          = {10.1016/J.COMGEO.2020.101666},
  timestamp    = {Thu, 23 Jul 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AigerKS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Aldana-GalvanAA20,
  author       = {Israel Aldana{-}Galv{\'{a}}n and
                  Carlos Alegr{\'{\i}}a and
                  Jose Luis {\'{A}}lvarez{-}Rebollar and
                  Nestaly Mar{\'{\i}}n{-}Nev{\'{a}}rez and
                  Erick Sol{\'{\i}}s{-}Villarreal and
                  Jorge Urrutia and
                  Carlos Velarde},
  title        = {Finding minimum witness sets in orthogonal polygons},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101656},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101656},
  doi          = {10.1016/J.COMGEO.2020.101656},
  timestamp    = {Sat, 09 Apr 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Aldana-GalvanAA20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AmentaR20,
  author       = {Nina Amenta and
                  Carlos Rojas},
  title        = {Dihedral deformation and rigidity},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101657},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101657},
  doi          = {10.1016/J.COMGEO.2020.101657},
  timestamp    = {Thu, 16 Jul 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AmentaR20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BandyapadhyayKS20,
  author       = {Sayan Bandyapadhyay and
                  Neeraj Kumar and
                  Subhash Suri and
                  Kasturi R. Varadarajan},
  title        = {Improved approximation bounds for the minimum constraint removal problem},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101650},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101650},
  doi          = {10.1016/J.COMGEO.2020.101650},
  timestamp    = {Thu, 06 Aug 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BandyapadhyayKS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BanikSS20,
  author       = {Aritra Banik and
                  Vibha Sahlot and
                  Saket Saurabh},
  title        = {Approximation algorithms for geometric conflict free covering problems},
  journal      = {Comput. Geom.},
  volume       = {89},
  pages        = {101591},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101591},
  doi          = {10.1016/J.COMGEO.2019.101591},
  timestamp    = {Tue, 16 Jun 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BanikSS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BanyassadyCKMRR20,
  author       = {Bahareh Banyassady and
                  Man{-}Kwun Chiu and
                  Matias Korman and
                  Wolfgang Mulzer and
                  Andr{\'{e}} van Renssen and
                  Marcel Roeloffzen and
                  Paul Seiferth and
                  Yannik Stein and
                  Birgit Vogtenhuber and
                  Max Willert},
  title        = {Routing in polygonal domains},
  journal      = {Comput. Geom.},
  volume       = {87},
  pages        = {101593},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101593},
  doi          = {10.1016/J.COMGEO.2019.101593},
  timestamp    = {Mon, 09 Mar 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BanyassadyCKMRR20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaranyM20,
  author       = {Imre B{\'{a}}r{\'{a}}ny and
                  Nabil H. Mustafa},
  title        = {An application of the universality theorem for Tverberg partitions
                  to data depth and hitting convex sets},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101649},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101649},
  doi          = {10.1016/J.COMGEO.2020.101649},
  timestamp    = {Thu, 16 Jul 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaranyM20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeltonFMMMSSSW20,
  author       = {Robin Lynne Belton and
                  Brittany Terese Fasy and
                  Rostik Mertz and
                  Samuel Micka and
                  David L. Millman and
                  Daniel Salinas and
                  Anna Schenfisch and
                  Jordan Schupbach and
                  Lucia Williams},
  title        = {Reconstructing embedded graphs from persistence diagrams},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101658},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101658},
  doi          = {10.1016/J.COMGEO.2020.101658},
  timestamp    = {Sat, 09 Apr 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BeltonFMMMSSSW20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BenbernouDDL20,
  author       = {Nadia M. Benbernou and
                  Erik D. Demaine and
                  Martin L. Demaine and
                  Anna Lubiw},
  title        = {Universal hinge patterns for folding strips efficiently into any grid
                  polyhedron},
  journal      = {Comput. Geom.},
  volume       = {89},
  pages        = {101633},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101633},
  doi          = {10.1016/J.COMGEO.2020.101633},
  timestamp    = {Mon, 15 Jun 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BenbernouDDL20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BhattacharyaM20,
  author       = {Amitava Bhattacharya and
                  Anupam Mondal},
  title        = {Covering the plane by a sequence of circular disks with a constraint},
  journal      = {Comput. Geom.},
  volume       = {91},
  pages        = {101680},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101680},
  doi          = {10.1016/J.COMGEO.2020.101680},
  timestamp    = {Fri, 31 Jul 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BhattacharyaM20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlBMM20,
  author       = {Therese Biedl and
                  Ahmad Biniaz and
                  Anil Maheshwari and
                  Saeed Mehrabi},
  title        = {Packing boundary-anchored rectangles and squares},
  journal      = {Comput. Geom.},
  volume       = {88},
  pages        = {101610},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101610},
  doi          = {10.1016/J.COMGEO.2020.101610},
  timestamp    = {Thu, 11 Aug 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiedlBMM20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Biniaz20,
  author       = {Ahmad Biniaz},
  title        = {Plane hop spanners for unit disk graphs: Simpler and better},
  journal      = {Comput. Geom.},
  volume       = {89},
  pages        = {101622},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101622},
  doi          = {10.1016/J.COMGEO.2020.101622},
  timestamp    = {Mon, 15 Jun 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Biniaz20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazG20,
  author       = {Ahmad Biniaz and
                  Alfredo Garc{\'{\i}}a},
  title        = {Packing plane spanning trees into a point set},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101653},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101653},
  doi          = {10.1016/J.COMGEO.2020.101653},
  timestamp    = {Thu, 16 Jul 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiniazG20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BinucciGHLMSW20,
  author       = {Carla Binucci and
                  Emilio Di Giacomo and
                  Seok{-}Hee Hong and
                  Giuseppe Liotta and
                  Henk Meijer and
                  Vera Sacrist{\'{a}}n and
                  Stephen K. Wismath},
  title        = {Colored anchored visibility representations in 2D and 3D space},
  journal      = {Comput. Geom.},
  volume       = {89},
  pages        = {101592},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101592},
  doi          = {10.1016/J.COMGEO.2019.101592},
  timestamp    = {Thu, 27 Apr 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BinucciGHLMSW20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCSS20,
  author       = {Prosenjit Bose and
                  Jean{-}Lou De Carufel and
                  Alina Shaikhet and
                  Michiel H. M. Smid},
  title        = {Optimal Art Gallery Localization is NP-hard},
  journal      = {Comput. Geom.},
  volume       = {88},
  pages        = {101607},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101607},
  doi          = {10.1016/J.COMGEO.2020.101607},
  timestamp    = {Wed, 22 Apr 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseCSS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCSS20a,
  author       = {Prosenjit Bose and
                  Pilar Cano and
                  Maria Saumell and
                  Rodrigo I. Silveira},
  title        = {Hamiltonicity for convex shape Delaunay and Gabriel graphs},
  journal      = {Comput. Geom.},
  volume       = {89},
  pages        = {101629},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101629},
  doi          = {10.1016/J.COMGEO.2020.101629},
  timestamp    = {Tue, 16 Jun 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseCSS20a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseKL20,
  author       = {Prosenjit Bose and
                  Irina Kostitsyna and
                  Stefan Langerman},
  title        = {Self-approaching paths in simple polygons},
  journal      = {Comput. Geom.},
  volume       = {87},
  pages        = {101595},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101595},
  doi          = {10.1016/J.COMGEO.2019.101595},
  timestamp    = {Mon, 09 Mar 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseKL20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseS20,
  author       = {Prosenjit Bose and
                  Thomas C. Shermer},
  title        = {Gathering by repulsion},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101627},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101627},
  doi          = {10.1016/J.COMGEO.2020.101627},
  timestamp    = {Thu, 06 Aug 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinKR20,
  author       = {Kevin Buchin and
                  Maximilian Konzack and
                  Wim Reddingius},
  title        = {Progressive simplification of polygonal curves},
  journal      = {Comput. Geom.},
  volume       = {88},
  pages        = {101620},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101620},
  doi          = {10.1016/J.COMGEO.2020.101620},
  timestamp    = {Mon, 04 May 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BuchinKR20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiCKKORRSS20,
  author       = {Paz Carmi and
                  Man{-}Kwun Chiu and
                  Matthew J. Katz and
                  Matias Korman and
                  Yoshio Okamoto and
                  Andr{\'{e}} van Renssen and
                  Marcel Roeloffzen and
                  Taichi Shiitada and
                  Shakhar Smorodinsky},
  title        = {Balanced line separators of unit disk graphs},
  journal      = {Comput. Geom.},
  volume       = {86},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101575},
  doi          = {10.1016/J.COMGEO.2019.101575},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CarmiCKKORRSS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarufelGMSS20,
  author       = {Jean{-}Lou De Carufel and
                  Carsten Grimm and
                  Anil Maheshwari and
                  Stefan Schirra and
                  Michiel H. M. Smid},
  title        = {Minimizing the continuous diameter when augmenting a geometric tree
                  with a shortcut},
  journal      = {Comput. Geom.},
  volume       = {89},
  pages        = {101631},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101631},
  doi          = {10.1016/J.COMGEO.2020.101631},
  timestamp    = {Mon, 15 Jun 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CarufelGMSS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanR020,
  author       = {Timothy M. Chan and
                  Saladi Rahul and
                  Jie Xue},
  title        = {Range closest-pair search in higher dimensions},
  journal      = {Comput. Geom.},
  volume       = {91},
  pages        = {101669},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101669},
  doi          = {10.1016/J.COMGEO.2020.101669},
  timestamp    = {Fri, 31 Jul 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChanR020.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChuangpishitMNO20,
  author       = {Huda Chuangpishit and
                  Saeed Mehrabi and
                  Lata Narayanan and
                  Jaroslav Opatrny},
  title        = {Evacuating equilateral triangles and squares in the face-to-face model},
  journal      = {Comput. Geom.},
  volume       = {89},
  pages        = {101624},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101624},
  doi          = {10.1016/J.COMGEO.2020.101624},
  timestamp    = {Mon, 15 Jun 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChuangpishitMNO20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CleveM20,
  author       = {Jonas Cleve and
                  Wolfgang Mulzer},
  title        = {Combinatorics of beacon-based routing in three dimensions},
  journal      = {Comput. Geom.},
  volume       = {91},
  pages        = {101667},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101667},
  doi          = {10.1016/J.COMGEO.2020.101667},
  timestamp    = {Fri, 31 Jul 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CleveM20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineKKMORRUU20,
  author       = {Erik D. Demaine and
                  Matias Korman and
                  Jason S. Ku and
                  Joseph S. B. Mitchell and
                  Yota Otachi and
                  Andr{\'{e}} van Renssen and
                  Marcel Roeloffzen and
                  Ryuhei Uehara and
                  Yushi Uno},
  title        = {Symmetric assembly puzzles are hard, beyond a few pieces},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101648},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101648},
  doi          = {10.1016/J.COMGEO.2020.101648},
  timestamp    = {Tue, 29 Dec 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DemaineKKMORRUU20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Do20,
  author       = {Thao Do},
  title        = {Extending Erd{\H{o}}s-Beck's theorem to higher dimensions},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101625},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101625},
  doi          = {10.1016/J.COMGEO.2020.101625},
  timestamp    = {Thu, 16 Jul 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Do20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Dumitrescu20,
  author       = {Adrian Dumitrescu},
  title        = {On the shortest separating cycle},
  journal      = {Comput. Geom.},
  volume       = {88},
  pages        = {101612},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101612},
  doi          = {10.1016/J.COMGEO.2020.101612},
  timestamp    = {Wed, 22 Apr 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Dumitrescu20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuT20,
  author       = {Adrian Dumitrescu and
                  Csaba D. T{\'{o}}th},
  title        = {Problems on track runners},
  journal      = {Comput. Geom.},
  volume       = {88},
  pages        = {101611},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101611},
  doi          = {10.1016/J.COMGEO.2020.101611},
  timestamp    = {Wed, 22 Apr 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DumitrescuT20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherK20,
  author       = {Stephane Durocher and
                  Shahin Kamali},
  title        = {Foreword},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101652},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101652},
  doi          = {10.1016/J.COMGEO.2020.101652},
  timestamp    = {Thu, 16 Jul 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DurocherK20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EllenS20,
  author       = {Faith Ellen and
                  J{\"{o}}rg{-}R{\"{u}}diger Sack},
  title        = {Preface},
  journal      = {Comput. Geom.},
  volume       = {89},
  pages        = {101632},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101632},
  doi          = {10.1016/J.COMGEO.2020.101632},
  timestamp    = {Mon, 15 Jun 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/EllenS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FerresFGHN20,
  author       = {Leo Ferres and
                  Jos{\'{e}} Fuentes{-}Sep{\'{u}}lveda and
                  Travis Gagie and
                  Meng He and
                  Gonzalo Navarro},
  title        = {Fast and compact planar embeddings},
  journal      = {Comput. Geom.},
  volume       = {89},
  pages        = {101630},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101630},
  doi          = {10.1016/J.COMGEO.2020.101630},
  timestamp    = {Wed, 28 Feb 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FerresFGHN20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FriggstadSS20,
  author       = {Zachary Friggstad and
                  J{\"{o}}rg{-}R{\"{u}}diger Sack and
                  Mohammad R. Salavatipour},
  title        = {Preface},
  journal      = {Comput. Geom.},
  volume       = {91},
  pages        = {101671},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101671},
  doi          = {10.1016/J.COMGEO.2020.101671},
  timestamp    = {Thu, 23 Jul 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/FriggstadSS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GangopadhyayS20,
  author       = {Rahul Gangopadhyay and
                  Saswata Shannigrahi},
  title        = {\emph{k}-Sets and rectilinear crossings in complete uniform hypergraphs},
  journal      = {Comput. Geom.},
  volume       = {86},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101578},
  doi          = {10.1016/J.COMGEO.2019.101578},
  timestamp    = {Mon, 09 Dec 2019 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GangopadhyayS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiacomoLM20,
  author       = {Emilio Di Giacomo and
                  Giuseppe Liotta and
                  Fabrizio Montecchiani},
  title        = {1-bend upward planar slope number of SP-digraphs},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101628},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101628},
  doi          = {10.1016/J.COMGEO.2020.101628},
  timestamp    = {Thu, 16 Jul 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GiacomoLM20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonS20,
  author       = {Joachim Gudmundsson and
                  Michiel H. M. Smid},
  title        = {Special issue on the 29th Canadian Conference on Computational Geometry,
                  Guest Editors' foreword},
  journal      = {Comput. Geom.},
  volume       = {88},
  pages        = {101608},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101608},
  doi          = {10.1016/J.COMGEO.2020.101608},
  timestamp    = {Wed, 22 Apr 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GudmundssonS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HaverkortKLS20,
  author       = {Herman J. Haverkort and
                  David K{\"{u}}bel and
                  Elmar Langetepe and
                  Barbara Schwarzwald},
  title        = {How to play hot and cold},
  journal      = {Comput. Geom.},
  volume       = {87},
  pages        = {101596},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101596},
  doi          = {10.1016/J.COMGEO.2019.101596},
  timestamp    = {Mon, 09 Mar 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HaverkortKLS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LozzoBF20,
  author       = {Giordano Da Lozzo and
                  Giuseppe Di Battista and
                  Fabrizio Frati},
  title        = {Extending upward planar graph drawings},
  journal      = {Comput. Geom.},
  volume       = {91},
  pages        = {101668},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101668},
  doi          = {10.1016/J.COMGEO.2020.101668},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/LozzoBF20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LubiwMO20,
  author       = {Anna Lubiw and
                  Daniela Maftuleac and
                  Megan Owen},
  title        = {Shortest paths and convex hulls in 2D complexes with non-positive
                  curvature},
  journal      = {Comput. Geom.},
  volume       = {89},
  pages        = {101626},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101626},
  doi          = {10.1016/J.COMGEO.2020.101626},
  timestamp    = {Mon, 15 Jun 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/LubiwMO20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MasoodRN20,
  author       = {Talha Bin Masood and
                  Tathagata Ray and
                  Vijay Natarajan},
  title        = {Parallel computation of alpha complexes for biomolecules},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101651},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101651},
  doi          = {10.1016/J.COMGEO.2020.101651},
  timestamp    = {Tue, 29 Dec 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MasoodRN20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Messerschmidt20,
  author       = {Miek Messerschmidt},
  title        = {On compact packings of the plane with circles of three radii},
  journal      = {Comput. Geom.},
  volume       = {86},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2019.05.002},
  doi          = {10.1016/J.COMGEO.2019.05.002},
  timestamp    = {Mon, 09 Dec 2019 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Messerschmidt20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Munao20,
  author       = {Simone Munao},
  title        = {Introducing article numbering to \emph{Computational Geometry: Theory
                  and Applications}},
  journal      = {Comput. Geom.},
  volume       = {86},
  year         = {2020},
  url          = {https://doi.org/10.1016/S0925-7721(19)30145-2},
  doi          = {10.1016/S0925-7721(19)30145-2},
  timestamp    = {Mon, 09 Dec 2019 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Munao20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PolishchukS20,
  author       = {Valentin Polishchuk and
                  Christiane Schmidt},
  title        = {Special Issue on the 33rd European Workshop on Computational Geometry,
                  Guest Editors' Foreword},
  journal      = {Comput. Geom.},
  volume       = {87},
  pages        = {101590},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101590},
  doi          = {10.1016/J.COMGEO.2019.101590},
  timestamp    = {Wed, 07 Dec 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/PolishchukS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ScaramucciaIFL20,
  author       = {Sara Scaramuccia and
                  Federico Iuricich and
                  Leila De Floriani and
                  Claudia Landi},
  title        = {Computing multiparameter persistent homology through a discrete Morse-based
                  approach},
  journal      = {Comput. Geom.},
  volume       = {89},
  pages        = {101623},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101623},
  doi          = {10.1016/J.COMGEO.2020.101623},
  timestamp    = {Wed, 15 Mar 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ScaramucciaIFL20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Scheucher20,
  author       = {Manfred Scheucher},
  title        = {Two disjoint 5-holes in point sets},
  journal      = {Comput. Geom.},
  volume       = {91},
  pages        = {101670},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101670},
  doi          = {10.1016/J.COMGEO.2020.101670},
  timestamp    = {Fri, 31 Jul 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Scheucher20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SchiblerS20,
  author       = {Thomas Schibler and
                  Subhash Suri},
  title        = {K-dominance in multidimensional data: Theory and applications},
  journal      = {Comput. Geom.},
  volume       = {87},
  pages        = {101594},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101594},
  doi          = {10.1016/J.COMGEO.2019.101594},
  timestamp    = {Mon, 09 Mar 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SchiblerS20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/TeoDF20,
  author       = {Ka Yaw Teo and
                  Ovidiu Daescu and
                  Kyle Fox},
  title        = {Trajectory planning for an articulated probe},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101655},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101655},
  doi          = {10.1016/J.COMGEO.2020.101655},
  timestamp    = {Thu, 16 Jul 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/TeoDF20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Viglietta20,
  author       = {Giovanni Viglietta},
  title        = {Optimally guarding 2-reflex orthogonal polyhedra by reflex edge guards},
  journal      = {Comput. Geom.},
  volume       = {86},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101589},
  doi          = {10.1016/J.COMGEO.2019.101589},
  timestamp    = {Mon, 09 Dec 2019 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Viglietta20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WangW20,
  author       = {Yuan Wang and
                  Bei Wang},
  title        = {Topological inference of manifolds with boundary},
  journal      = {Comput. Geom.},
  volume       = {88},
  pages        = {101606},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101606},
  doi          = {10.1016/J.COMGEO.2019.101606},
  timestamp    = {Mon, 23 Aug 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/WangW20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/XueLJ20,
  author       = {Jie Xue and
                  Yuan Li and
                  Ravi Janardan},
  title        = {Approximate range closest-pair queries},
  journal      = {Comput. Geom.},
  volume       = {90},
  pages        = {101654},
  year         = {2020},
  url          = {https://doi.org/10.1016/j.comgeo.2020.101654},
  doi          = {10.1016/J.COMGEO.2020.101654},
  timestamp    = {Fri, 27 Nov 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/XueLJ20.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/0001KW19,
  author       = {Matt Gibson and
                  Erik Krohn and
                  Qing Wang},
  title        = {The VC-dimension of visibility on the boundary of monotone polygons},
  journal      = {Comput. Geom.},
  volume       = {77},
  pages        = {62--72},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.10.006},
  doi          = {10.1016/J.COMGEO.2018.10.006},
  timestamp    = {Tue, 09 Jun 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/0001KW19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AcharyyaNPR19,
  author       = {Ankush Acharyya and
                  Subhas C. Nandy and
                  Supantha Pandit and
                  Sasanka Roy},
  title        = {Covering segments with unit squares},
  journal      = {Comput. Geom.},
  volume       = {79},
  pages        = {1--13},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.01.001},
  doi          = {10.1016/J.COMGEO.2019.01.001},
  timestamp    = {Wed, 07 Dec 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AcharyyaNPR19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ackerman19,
  author       = {Eyal Ackerman},
  title        = {On topological graphs with at most four crossings per edge},
  journal      = {Comput. Geom.},
  volume       = {85},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101574},
  doi          = {10.1016/J.COMGEO.2019.101574},
  timestamp    = {Mon, 09 Dec 2019 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Ackerman19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnABCDPS19,
  author       = {Hee{-}Kap Ahn and
                  Judit Abardia and
                  Sang Won Bae and
                  Otfried Cheong and
                  Susanna Dann and
                  Dongwoo Park and
                  Chan{-}Su Shin},
  title        = {The minimum convex container of two convex polytopes under translations},
  journal      = {Comput. Geom.},
  volume       = {77},
  pages        = {40--50},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.02.004},
  doi          = {10.1016/J.COMGEO.2018.02.004},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnABCDPS19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBCKMOPRV19,
  author       = {Hee{-}Kap Ahn and
                  Sang Won Bae and
                  Jong Min Choi and
                  Matias Korman and
                  Wolfgang Mulzer and
                  Eunjin Oh and
                  Ji{-}won Park and
                  Andr{\'{e}} van Renssen and
                  Antoine Vigneron},
  title        = {Faster algorithms for growing prioritized disks and rectangles},
  journal      = {Comput. Geom.},
  volume       = {80},
  pages        = {23--39},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.02.001},
  doi          = {10.1016/J.COMGEO.2019.02.001},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnBCKMOPRV19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnOSSS19,
  author       = {Hee{-}Kap Ahn and
                  Eunjin Oh and
                  Lena Schlipf and
                  Fabian Stehn and
                  Darren Strash},
  title        = {On Romeo and Juliet problems: Minimizing distance-to-sight},
  journal      = {Comput. Geom.},
  volume       = {84},
  pages        = {12--21},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.07.003},
  doi          = {10.1016/J.COMGEO.2019.07.003},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnOSSS19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerHKPRR19,
  author       = {Oswin Aichholzer and
                  Thomas Hackl and
                  Matias Korman and
                  Alexander Pilz and
                  Andr{\'{e}} van Renssen and
                  Marcel Roeloffzen and
                  G{\"{u}}nter Rote and
                  Birgit Vogtenhuber},
  title        = {Packing plane spanning graphs with short edges in complete geometric
                  graphs},
  journal      = {Comput. Geom.},
  volume       = {82},
  pages        = {1--15},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.04.001},
  doi          = {10.1016/J.COMGEO.2019.04.001},
  timestamp    = {Fri, 31 May 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerHKPRR19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMHPRU19,
  author       = {Oswin Aichholzer and
                  Ruy Fabila Monroy and
                  Ferran Hurtado and
                  Pablo P{\'{e}}rez{-}Lantero and
                  Andres J. Ruiz{-}Vargas and
                  Jorge Urrutia and
                  Birgit Vogtenhuber},
  title        = {Cross-sections of line configurations in {R3} and (\emph{d} - 2)-flat
                  configurations in Rd},
  journal      = {Comput. Geom.},
  volume       = {77},
  pages        = {51--61},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.02.005},
  doi          = {10.1016/J.COMGEO.2018.02.005},
  timestamp    = {Tue, 04 Dec 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerMHPRU19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisCCKL19,
  author       = {Greg Aloupis and
                  Paz Carmi and
                  Lilach Chaitman{-}Yerushalmi and
                  Matthew J. Katz and
                  Stefan Langerman},
  title        = {Bottleneck detour tree of points on a path},
  journal      = {Comput. Geom.},
  volume       = {79},
  pages        = {30--36},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.01.005},
  doi          = {10.1016/J.COMGEO.2019.01.005},
  timestamp    = {Thu, 04 Apr 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AloupisCCKL19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AtalayM19,
  author       = {F. Bet{\"{u}}l Atalay and
                  David M. Mount},
  title        = {Bounds on the cost of compatible refinement of simplex decomposition
                  trees in arbitrary dimensions},
  journal      = {Comput. Geom.},
  volume       = {79},
  pages        = {14--29},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.01.004},
  doi          = {10.1016/J.COMGEO.2019.01.004},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AtalayM19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AurenhammerSK19,
  author       = {Franz Aurenhammer and
                  Michael Steinkogler and
                  Rolf Klein},
  title        = {Partially walking a polygon},
  journal      = {Comput. Geom.},
  volume       = {84},
  pages        = {3--11},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.07.002},
  doi          = {10.1016/J.COMGEO.2019.07.002},
  timestamp    = {Tue, 10 Sep 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AurenhammerSK19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bae19,
  author       = {Sang Won Bae},
  title        = {Computing a minimum-width square or rectangular annulus with outliers},
  journal      = {Comput. Geom.},
  volume       = {76},
  pages        = {33--45},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.08.002},
  doi          = {10.1016/J.COMGEO.2018.08.002},
  timestamp    = {Wed, 25 Sep 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Bae19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeBCGL19,
  author       = {Sang Won Bae and
                  Mark de Berg and
                  Otfried Cheong and
                  Joachim Gudmundsson and
                  Christos Levcopoulos},
  title        = {Shortcuts for the circle},
  journal      = {Comput. Geom.},
  volume       = {79},
  pages        = {37--54},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.01.006},
  doi          = {10.1016/J.COMGEO.2019.01.006},
  timestamp    = {Mon, 03 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaeBCGL19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeKO19,
  author       = {Sang Won Bae and
                  Matias Korman and
                  Yoshio Okamoto},
  title        = {Computing the geodesic centers of a polygonal domain},
  journal      = {Comput. Geom.},
  volume       = {77},
  pages        = {3--9},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2015.10.009},
  doi          = {10.1016/J.COMGEO.2015.10.009},
  timestamp    = {Wed, 25 Sep 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaeKO19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeOS19,
  author       = {Sang Won Bae and
                  Yoshio Okamoto and
                  Chan{-}Su Shin},
  title        = {Area bounds of rectilinear polygons realized by angle sequences},
  journal      = {Comput. Geom.},
  volume       = {83},
  pages        = {9--29},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.05.004},
  doi          = {10.1016/J.COMGEO.2019.05.004},
  timestamp    = {Mon, 15 Jun 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaeOS19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeS19,
  author       = {Sang Won Bae and
                  Michiel H. M. Smid},
  title        = {Closest-pair queries in fat rectangles},
  journal      = {Comput. Geom.},
  volume       = {83},
  pages        = {1--8},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.05.003},
  doi          = {10.1016/J.COMGEO.2019.05.003},
  timestamp    = {Fri, 15 Nov 2019 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaeS19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeSV19,
  author       = {Sang Won Bae and
                  Chan{-}Su Shin and
                  Antoine Vigneron},
  title        = {Tight bounds for beacon-based coverage in simple rectilinear polygons},
  journal      = {Comput. Geom.},
  volume       = {80},
  pages        = {40--52},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.02.002},
  doi          = {10.1016/J.COMGEO.2019.02.002},
  timestamp    = {Sat, 19 Oct 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaeSV19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BakhsheshF19,
  author       = {Davood Bakhshesh and
                  Mohammad Farshi},
  title        = {(Weakly) Self-approaching geometric graphs and spanners},
  journal      = {Comput. Geom.},
  volume       = {78},
  pages        = {20--36},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.10.002},
  doi          = {10.1016/J.COMGEO.2018.10.002},
  timestamp    = {Tue, 04 Dec 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BakhsheshF19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BandyapadhyayMM19,
  author       = {Sayan Bandyapadhyay and
                  Anil Maheshwari and
                  Saeed Mehrabi and
                  Subhash Suri},
  title        = {Approximating dominating set on intersection graphs of rectangles
                  and L-frames},
  journal      = {Comput. Geom.},
  volume       = {82},
  pages        = {32--44},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.04.004},
  doi          = {10.1016/J.COMGEO.2019.04.004},
  timestamp    = {Fri, 31 May 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BandyapadhyayMM19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergM19,
  author       = {Mark de Berg and
                  Aleksandar Markovic},
  title        = {Dynamic conflict-free colorings in the plane},
  journal      = {Comput. Geom.},
  volume       = {78},
  pages        = {61--73},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.10.005},
  doi          = {10.1016/J.COMGEO.2018.10.005},
  timestamp    = {Mon, 03 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BergM19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazMS19,
  author       = {Ahmad Biniaz and
                  Anil Maheshwari and
                  Michiel H. M. Smid},
  title        = {Flip distance to some plane configurations},
  journal      = {Comput. Geom.},
  volume       = {81},
  pages        = {12--21},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.01.008},
  doi          = {10.1016/J.COMGEO.2019.01.008},
  timestamp    = {Tue, 14 May 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiniazMS19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrazilVZRT19,
  author       = {Marcus Brazil and
                  Marcus Volz and
                  Martin Zachariasen and
                  Charl J. Ras and
                  Doreen A. Thomas},
  title        = {New pruning rules for the Steiner tree problem and 2-connected Steiner
                  network problem},
  journal      = {Comput. Geom.},
  volume       = {78},
  pages        = {37--49},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.10.003},
  doi          = {10.1016/J.COMGEO.2018.10.003},
  timestamp    = {Wed, 07 Dec 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BrazilVZRT19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinBMS19,
  author       = {Kevin Buchin and
                  Maike Buchin and
                  Wouter Meulemans and
                  Bettina Speckmann},
  title        = {Locally correct Fr{\'{e}}chet matchings},
  journal      = {Comput. Geom.},
  volume       = {76},
  pages        = {1--18},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.09.002},
  doi          = {10.1016/J.COMGEO.2018.09.002},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BuchinBMS19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiCO19,
  author       = {Paz Carmi and
                  Lilach Chaitman{-}Yerushalmi and
                  Bat{-}Chen Ozeri},
  title        = {Minimizing the sum of distances to a server in a constraint network},
  journal      = {Comput. Geom.},
  volume       = {80},
  pages        = {1--12},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.01.003},
  doi          = {10.1016/J.COMGEO.2019.01.003},
  timestamp    = {Tue, 14 May 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CarmiCO19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChaplickLWZ19,
  author       = {Steven Chaplick and
                  Fabian Lipp and
                  Alexander Wolff and
                  Johannes Zink},
  title        = {Compact drawings of 1-planar graphs with right-angle crossings and
                  few bends},
  journal      = {Comput. Geom.},
  volume       = {84},
  pages        = {50--68},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.07.006},
  doi          = {10.1016/J.COMGEO.2019.07.006},
  timestamp    = {Wed, 14 Feb 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChaplickLWZ19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChoudharyG19,
  author       = {Aruni Choudhary and
                  Arijit Ghosh},
  title        = {Delaunay simplices in diagonally distorted lattices},
  journal      = {Comput. Geom.},
  volume       = {81},
  pages        = {33--44},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.01.010},
  doi          = {10.1016/J.COMGEO.2019.01.010},
  timestamp    = {Fri, 31 May 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChoudharyG19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DaescuFMPS19,
  author       = {Ovidiu Daescu and
                  Stephan Friedrichs and
                  Hemant Malik and
                  Valentin Polishchuk and
                  Christiane Schmidt},
  title        = {Altitude terrain guarding and guarding uni-monotone polygons},
  journal      = {Comput. Geom.},
  volume       = {84},
  pages        = {22--35},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.07.004},
  doi          = {10.1016/J.COMGEO.2019.07.004},
  timestamp    = {Wed, 07 Dec 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DaescuFMPS19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeyPRS19,
  author       = {Tamal K. Dey and
                  Pan Peng and
                  Alfred Rossi and
                  Anastasios Sidiropoulos},
  title        = {Spectral concentration and greedy \emph{k}-clustering},
  journal      = {Comput. Geom.},
  volume       = {76},
  pages        = {19--32},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.09.001},
  doi          = {10.1016/J.COMGEO.2018.09.001},
  timestamp    = {Fri, 13 Sep 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DeyPRS19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Dumitrescu19,
  author       = {Adrian Dumitrescu},
  title        = {A product inequality for extreme distances},
  journal      = {Comput. Geom.},
  volume       = {85},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101577},
  doi          = {10.1016/J.COMGEO.2019.101577},
  timestamp    = {Mon, 09 Dec 2019 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Dumitrescu19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherM19,
  author       = {Stephane Durocher and
                  Debajyoti Mondal},
  title        = {Drawing plane triangulations with few segments},
  journal      = {Comput. Geom.},
  volume       = {77},
  pages        = {27--39},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.02.003},
  doi          = {10.1016/J.COMGEO.2018.02.003},
  timestamp    = {Tue, 04 Dec 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DurocherM19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FoxPS19,
  author       = {Jacob Fox and
                  J{\'{a}}nos Pach and
                  Andrew Suk},
  title        = {Approximating the rectilinear crossing number},
  journal      = {Comput. Geom.},
  volume       = {81},
  pages        = {45--53},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.04.003},
  doi          = {10.1016/J.COMGEO.2019.04.003},
  timestamp    = {Tue, 14 May 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/FoxPS19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HeZ19,
  author       = {Meng He and
                  Norbert Zeh},
  title        = {Editorial: Special issue on the 26th Canadian Conference on Computational
                  Geometry {(CCCG)}},
  journal      = {Comput. Geom.},
  volume       = {77},
  pages        = {1--2},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.08.001},
  doi          = {10.1016/J.COMGEO.2018.08.001},
  timestamp    = {Sun, 12 Nov 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HeZ19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HlinenyPR19,
  author       = {Petr Hlinen{\'{y}} and
                  Filip Pokr{\'{y}}vka and
                  Bodhayan Roy},
  title        = {{FO} model checking on geometric graphs},
  journal      = {Comput. Geom.},
  volume       = {78},
  pages        = {1--19},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.10.001},
  doi          = {10.1016/J.COMGEO.2018.10.001},
  timestamp    = {Wed, 25 Sep 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/HlinenyPR19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HuemerPS19,
  author       = {Clemens Huemer and
                  Alexander Pilz and
                  Rodrigo I. Silveira},
  title        = {A new lower bound on the maximum number of plane graphs using production
                  matrices},
  journal      = {Comput. Geom.},
  volume       = {84},
  pages        = {36--49},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.07.005},
  doi          = {10.1016/J.COMGEO.2019.07.005},
  timestamp    = {Sat, 19 Oct 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/HuemerPS19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KaplanRS19,
  author       = {Haim Kaplan and
                  Sasanka Roy and
                  Micha Sharir},
  title        = {Finding axis-parallel rectangles of fixed perimeter or area containing
                  the largest number of points},
  journal      = {Comput. Geom.},
  volume       = {81},
  pages        = {1--11},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.01.007},
  doi          = {10.1016/J.COMGEO.2019.01.007},
  timestamp    = {Tue, 14 May 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KaplanRS19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KawamuraMOP19,
  author       = {Akitoshi Kawamura and
                  Sonoko Moriyama and
                  Yota Otachi and
                  J{\'{a}}nos Pach},
  title        = {A lower bound on opaque sets},
  journal      = {Comput. Geom.},
  volume       = {80},
  pages        = {13--22},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.01.002},
  doi          = {10.1016/J.COMGEO.2019.01.002},
  timestamp    = {Sat, 19 Oct 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KawamuraMOP19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KleistKLSSS19,
  author       = {Linda Kleist and
                  Boris Klemz and
                  Anna Lubiw and
                  Lena Schlipf and
                  Frank Staals and
                  Darren Strash},
  title        = {Convexity-increasing morphs of planar graphs},
  journal      = {Comput. Geom.},
  volume       = {84},
  pages        = {69--88},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.07.007},
  doi          = {10.1016/J.COMGEO.2019.07.007},
  timestamp    = {Mon, 03 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KleistKLSSS19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KormanM19,
  author       = {Matias Korman and
                  Wolfgang Mulzer},
  title        = {Special Issue on the 34th European Workshop on Computational Geometry,
                  Guest Editors' Foreword},
  journal      = {Comput. Geom.},
  volume       = {84},
  pages        = {1--2},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.07.001},
  doi          = {10.1016/J.COMGEO.2019.07.001},
  timestamp    = {Tue, 10 Sep 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KormanM19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MartinY19,
  author       = {Pedro Mart{\'{\i}}n and
                  Diego Y{\'{a}}{\~{n}}ez},
  title        = {Geometric clustering in normed planes},
  journal      = {Comput. Geom.},
  volume       = {78},
  pages        = {50--60},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.10.004},
  doi          = {10.1016/J.COMGEO.2018.10.004},
  timestamp    = {Thu, 23 Sep 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/MartinY19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/OhA19,
  author       = {Eunjin Oh and
                  Hee{-}Kap Ahn},
  title        = {Assigning weights to minimize the covering radius in the plane},
  journal      = {Comput. Geom.},
  volume       = {81},
  pages        = {22--32},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2018.10.007},
  doi          = {10.1016/J.COMGEO.2018.10.007},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/OhA19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/OhA19a,
  author       = {Eunjin Oh and
                  Hee{-}Kap Ahn},
  title        = {Finding pairwise intersections of rectangles in a query rectangle},
  journal      = {Comput. Geom.},
  volume       = {85},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.101576},
  doi          = {10.1016/J.COMGEO.2019.101576},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/OhA19a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/OhBA19,
  author       = {Eunjin Oh and
                  Sang Won Bae and
                  Hee{-}Kap Ahn},
  title        = {Computing a geodesic two-center of points in a simple polygon},
  journal      = {Comput. Geom.},
  volume       = {82},
  pages        = {45--59},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.05.001},
  doi          = {10.1016/J.COMGEO.2019.05.001},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/OhBA19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RahmatiAKW19,
  author       = {Zahed Rahmati and
                  Mohammad Ali Abam and
                  Valerie King and
                  Sue Whitesides},
  title        = {Kinetic \emph{k}-Semi-Yao graph and its applications},
  journal      = {Comput. Geom.},
  volume       = {77},
  pages        = {10--26},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2015.11.001},
  doi          = {10.1016/J.COMGEO.2015.11.001},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/RahmatiAKW19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SattariI19,
  author       = {Sattar Sattari and
                  Mohammad Izadi},
  title        = {An improved upper bound on dilation of regular polygons},
  journal      = {Comput. Geom.},
  volume       = {80},
  pages        = {53--68},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.01.009},
  doi          = {10.1016/J.COMGEO.2019.01.009},
  timestamp    = {Fri, 31 May 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/SattariI19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/XueLJ19,
  author       = {Jie Xue and
                  Yuan Li and
                  Ravi Janardan},
  title        = {On the expected diameter, width, and complexity of a stochastic convex
                  hull},
  journal      = {Comput. Geom.},
  volume       = {82},
  pages        = {16--31},
  year         = {2019},
  url          = {https://doi.org/10.1016/j.comgeo.2019.04.002},
  doi          = {10.1016/J.COMGEO.2019.04.002},
  timestamp    = {Fri, 27 Nov 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/XueLJ19.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbelDDISU18,
  author       = {Zachary Abel and
                  Erik D. Demaine and
                  Martin L. Demaine and
                  Hiro Ito and
                  Jack Snoeyink and
                  Ryuhei Uehara},
  title        = {Bumpy pyramid folding},
  journal      = {Comput. Geom.},
  volume       = {75},
  pages        = {22--31},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.06.007},
  doi          = {10.1016/J.COMGEO.2018.06.007},
  timestamp    = {Tue, 29 Dec 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AbelDDISU18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerBHPRV18,
  author       = {Oswin Aichholzer and
                  Martin Balko and
                  Thomas Hackl and
                  Alexander Pilz and
                  Pedro Ramos and
                  Pavel Valtr and
                  Birgit Vogtenhuber},
  title        = {Holes in 2-convex point sets},
  journal      = {Comput. Geom.},
  volume       = {74},
  pages        = {38--49},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.06.002},
  doi          = {10.1016/J.COMGEO.2018.06.002},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerBHPRV18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerBHPV18,
  author       = {Oswin Aichholzer and
                  Luis Barba and
                  Thomas Hackl and
                  Alexander Pilz and
                  Birgit Vogtenhuber},
  title        = {Linear transformation distance for bichromatic matchings},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {77--88},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.05.003},
  doi          = {10.1016/J.COMGEO.2017.05.003},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerBHPV18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMFHUV18,
  author       = {Oswin Aichholzer and
                  Ruy Fabila Monroy and
                  David Flores{-}Pe{\~{n}}aloza and
                  Thomas Hackl and
                  Jorge Urrutia and
                  Birgit Vogtenhuber},
  title        = {Modem illumination of monotone polygons},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {101--118},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.05.010},
  doi          = {10.1016/J.COMGEO.2017.05.010},
  timestamp    = {Mon, 27 Nov 2017 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerMFHUV18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkitayaDDHHKL18,
  author       = {Hugo A. Akitaya and
                  Erik D. Demaine and
                  Martin L. Demaine and
                  Adam Hesterberg and
                  Ferran Hurtado and
                  Jason S. Ku and
                  Jayson Lynch},
  title        = {Pachinko},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {226--242},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.011},
  doi          = {10.1016/J.COMGEO.2017.06.011},
  timestamp    = {Mon, 27 Nov 2017 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AkitayaDDHHKL18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Alegria-Galicia18,
  author       = {Carlos Alegr{\'{\i}}a{-}Galicia and
                  David Orden and
                  Carlos Seara and
                  Jorge Urrutia},
  title        = {On the {\unicode{119978}}\({}_{\mbox{{\(\beta\)}}}\) of a planar point
                  set},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {277--291},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.003},
  doi          = {10.1016/J.COMGEO.2017.06.003},
  timestamp    = {Mon, 27 Nov 2017 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Alegria-Galicia18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArleoBGEGLMMWW18,
  author       = {Alessio Arleo and
                  Carla Binucci and
                  Emilio Di Giacomo and
                  William S. Evans and
                  Luca Grilli and
                  Giuseppe Liotta and
                  Henk Meijer and
                  Fabrizio Montecchiani and
                  Sue Whitesides and
                  Stephen K. Wismath},
  title        = {Visibility representations of boxes in 2.5 dimensions},
  journal      = {Comput. Geom.},
  volume       = {72},
  pages        = {19--33},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.02.007},
  doi          = {10.1016/J.COMGEO.2018.02.007},
  timestamp    = {Mon, 15 Jun 2020 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ArleoBGEGLMMWW18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AsinowskiR18,
  author       = {Andrei Asinowski and
                  G{\"{u}}nter Rote},
  title        = {Point sets with many non-crossing perfect matchings},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {7--33},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.05.006},
  doi          = {10.1016/J.COMGEO.2017.05.006},
  timestamp    = {Fri, 30 Nov 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AsinowskiR18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BakhsheshBBCDFF18,
  author       = {Davood Bakhshesh and
                  Luis Barba and
                  Prosenjit Bose and
                  Jean{-}Lou De Carufel and
                  Mirela Damian and
                  Rolf Fagerberg and
                  Mohammad Farshi and
                  Andr{\'{e}} van Renssen and
                  Perouz Taslakian and
                  Sander Verdonschot},
  title        = {Continuous Yao graphs},
  journal      = {Comput. Geom.},
  volume       = {67},
  pages        = {42--52},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.10.002},
  doi          = {10.1016/J.COMGEO.2017.10.002},
  timestamp    = {Fri, 30 Nov 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BakhsheshBBCDFF18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaramFHHM18,
  author       = {Alon Baram and
                  Efi Fogel and
                  Dan Halperin and
                  Michael Hemmer and
                  Sebastian Morr},
  title        = {Exact Minkowski sums of polygons with holes},
  journal      = {Comput. Geom.},
  volume       = {73},
  pages        = {46--56},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.06.005},
  doi          = {10.1016/J.COMGEO.2018.06.005},
  timestamp    = {Mon, 29 Oct 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaramFHHM18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaranyFMMOP18,
  author       = {Imre B{\'{a}}r{\'{a}}ny and
                  Ferenc Fodor and
                  {\'{A}}lvaro Mart{\'{\i}}nez{-}P{\'{e}}rez and
                  Luis Montejano and
                  Deborah Oliveros and
                  Attila P{\'{o}}r},
  title        = {Acknowledgement of priority - {A} fractional Helly theorem for boxes},
  journal      = {Comput. Geom.},
  volume       = {67},
  pages        = {1},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2016.09.001},
  doi          = {10.1016/J.COMGEO.2016.09.001},
  timestamp    = {Fri, 29 Jul 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaranyFMMOP18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazMS18,
  author       = {Ahmad Biniaz and
                  Anil Maheshwari and
                  Michiel H. M. Smid},
  title        = {Strong matching of points with geometric shapes},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {186--205},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.009},
  doi          = {10.1016/J.COMGEO.2017.06.009},
  timestamp    = {Mon, 27 Nov 2017 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiniazMS18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BohlerKLL18,
  author       = {Cecilia Bohler and
                  Rolf Klein and
                  Andrzej Lingas and
                  Chih{-}Hung Liu},
  title        = {Forest-like abstract Voronoi diagrams in linear time},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {134--145},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.013},
  doi          = {10.1016/J.COMGEO.2017.06.013},
  timestamp    = {Tue, 14 Sep 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BohlerKLL18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCR18,
  author       = {Prosenjit Bose and
                  Jean{-}Lou De Carufel and
                  Andr{\'{e}} van Renssen},
  title        = {Constrained generalized Delaunay graphs are plane spanners},
  journal      = {Comput. Geom.},
  volume       = {74},
  pages        = {50--65},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.06.006},
  doi          = {10.1016/J.COMGEO.2018.06.006},
  timestamp    = {Fri, 30 Nov 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseCR18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseLPV18,
  author       = {Prosenjit Bose and
                  Anna Lubiw and
                  Vinayak Pathak and
                  Sander Verdonschot},
  title        = {Flipping edge-labelled triangulations},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {309--326},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.005},
  doi          = {10.1016/J.COMGEO.2017.06.005},
  timestamp    = {Fri, 30 Nov 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseLPV18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseR18,
  author       = {Prosenjit Bose and
                  Pedro Ramos},
  title        = {Editorial: Special issue in memory of Dr. Ferran Hurtado},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {1},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.10.001},
  doi          = {10.1016/J.COMGEO.2017.10.001},
  timestamp    = {Mon, 27 Nov 2017 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseR18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Brandenburg18,
  author       = {Franz J. Brandenburg},
  title        = {T-shape visibility representations of 1-planar graphs},
  journal      = {Comput. Geom.},
  volume       = {69},
  pages        = {16--30},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.10.007},
  doi          = {10.1016/J.COMGEO.2017.10.007},
  timestamp    = {Wed, 20 Dec 2017 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Brandenburg18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Brenner18,
  author       = {Ulrich Brenner},
  title        = {\emph{{\(\gamma\)}}-Soft packings of rectangles},
  journal      = {Comput. Geom.},
  volume       = {70-71},
  pages        = {49--64},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.01.005},
  doi          = {10.1016/J.COMGEO.2018.01.005},
  timestamp    = {Mon, 29 Oct 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Brenner18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrodnikC18,
  author       = {Andrej Brodnik and
                  Sergio Cabello},
  title        = {Editorial: EuroCG2015},
  journal      = {Comput. Geom.},
  volume       = {73},
  pages        = {1},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.06.010},
  doi          = {10.1016/J.COMGEO.2018.06.010},
  timestamp    = {Mon, 29 Oct 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BrodnikC18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinOS18,
  author       = {Kevin Buchin and
                  Tim Ophelders and
                  Bettina Speckmann},
  title        = {Computing the similarity between moving curves},
  journal      = {Comput. Geom.},
  volume       = {73},
  pages        = {2--14},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.01.002},
  doi          = {10.1016/J.COMGEO.2017.01.002},
  timestamp    = {Sun, 02 Jun 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BuchinOS18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloM18,
  author       = {Sergio Cabello and
                  Lazar Milinkovic},
  title        = {Two optimization problems for unit disks},
  journal      = {Comput. Geom.},
  volume       = {70-71},
  pages        = {1--12},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.12.001},
  doi          = {10.1016/J.COMGEO.2017.12.001},
  timestamp    = {Mon, 29 Oct 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CabelloM18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CannonFILS18,
  author       = {Sarah Cannon and
                  Thomas G. Fai and
                  Justin Iwerks and
                  Undine Leopold and
                  Christiane Schmidt},
  title        = {Combinatorics and complexity of guarding polygons with edge and point
                  2-transmitters},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {89--100},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.004},
  doi          = {10.1016/J.COMGEO.2017.06.004},
  timestamp    = {Wed, 07 Dec 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CannonFILS18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CardinalHKTW18,
  author       = {Jean Cardinal and
                  Michael Hoffmann and
                  Vincent Kusters and
                  Csaba D. T{\'{o}}th and
                  Manuel Wettstein},
  title        = {Arc diagrams, flip distances, and Hamiltonian triangulations},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {206--225},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.001},
  doi          = {10.1016/J.COMGEO.2017.06.001},
  timestamp    = {Mon, 27 Nov 2017 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CardinalHKTW18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChambersFHMMVSW18,
  author       = {Erin W. Chambers and
                  S{\'{a}}ndor P. Fekete and
                  Hella{-}Franziska Hoffmann and
                  Dimitri Marinakis and
                  Joseph S. B. Mitchell and
                  Srinivasan Venkatesh and
                  Ulrike Stege and
                  Sue Whitesides},
  title        = {Connecting a set of circles with minimum sum of radii},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {62--76},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.002},
  doi          = {10.1016/J.COMGEO.2017.06.002},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChambersFHMMVSW18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ClaverolOGST18,
  author       = {Merc{\`{e}} Claverol and
                  Alfredo Garc{\'{\i}}a Olaverri and
                  Delia Garijo and
                  Carlos Seara and
                  Javier Tejel},
  title        = {On Hamiltonian alternating cycles and paths},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {146--166},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.05.009},
  doi          = {10.1016/J.COMGEO.2017.05.009},
  timestamp    = {Tue, 29 Dec 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ClaverolOGST18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Damian18,
  author       = {Mirela Damian},
  title        = {Cone-based spanners of constant degree},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {48--61},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.05.004},
  doi          = {10.1016/J.COMGEO.2017.05.004},
  timestamp    = {Mon, 27 Nov 2017 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Damian18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DevroyeM18,
  author       = {Luc Devroye and
                  Pat Morin},
  title        = {A note on interference in random networks},
  journal      = {Comput. Geom.},
  volume       = {67},
  pages        = {2--10},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.10.006},
  doi          = {10.1016/J.COMGEO.2017.10.006},
  timestamp    = {Wed, 25 Sep 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DevroyeM18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuJ18,
  author       = {Adrian Dumitrescu and
                  Minghui Jiang},
  title        = {Minimum rectilinear Steiner tree of n points in the unit square},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {253--261},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.007},
  doi          = {10.1016/J.COMGEO.2017.06.007},
  timestamp    = {Mon, 27 Nov 2017 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DumitrescuJ18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EdelsbrunnerH18,
  author       = {Herbert Edelsbrunner and
                  Mabel Iglesias Ham},
  title        = {Multiple covers with balls {I:} Inclusion-exclusion},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {119--133},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.014},
  doi          = {10.1016/J.COMGEO.2017.06.014},
  timestamp    = {Mon, 27 Nov 2017 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/EdelsbrunnerH18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EderHP18,
  author       = {G{\"{u}}nther Eder and
                  Martin Held and
                  Peter Palfrader},
  title        = {Parallelized ear clipping for the triangulation and constrained Delaunay
                  triangulation of polygons},
  journal      = {Comput. Geom.},
  volume       = {73},
  pages        = {15--23},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.01.004},
  doi          = {10.1016/J.COMGEO.2018.01.004},
  timestamp    = {Mon, 03 Feb 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/EderHP18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EvansFKKMNV18,
  author       = {William S. Evans and
                  Stefan Felsner and
                  Michael Kaufmann and
                  Stephen G. Kobourov and
                  Debajyoti Mondal and
                  Rahnuma Islam Nishat and
                  Kevin Verbeek},
  title        = {Table cartogram},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {174--185},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.010},
  doi          = {10.1016/J.COMGEO.2017.06.010},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/EvansFKKMNV18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GyorgyiHK18,
  author       = {P{\'{e}}ter Gy{\"{o}}rgyi and
                  B{\'{a}}lint Hujter and
                  S{\'{a}}ndor Kisfaludi{-}Bak},
  title        = {On the number of touching pairs in a set of planar curves},
  journal      = {Comput. Geom.},
  volume       = {67},
  pages        = {29--37},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.10.004},
  doi          = {10.1016/J.COMGEO.2017.10.004},
  timestamp    = {Sat, 09 Apr 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GyorgyiHK18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HoffmannKSVW18,
  author       = {Frank Hoffmann and
                  Klaus Kriegel and
                  Subhash Suri and
                  Kevin Verbeek and
                  Max Willert},
  title        = {Tight bounds for conflict-free chromatic guarding of orthogonal art
                  galleries},
  journal      = {Comput. Geom.},
  volume       = {73},
  pages        = {24--34},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.01.003},
  doi          = {10.1016/J.COMGEO.2018.01.003},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/HoffmannKSVW18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HurtadoKKLSSSST18,
  author       = {Ferran Hurtado and
                  Matias Korman and
                  Marc J. van Kreveld and
                  Maarten L{\"{o}}ffler and
                  Vera Sacrist{\'{a}}n and
                  Akiyoshi Shioura and
                  Rodrigo I. Silveira and
                  Bettina Speckmann and
                  Takeshi Tokuyama},
  title        = {Colored spanning graphs for set visualization},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {262--276},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.006},
  doi          = {10.1016/J.COMGEO.2017.06.006},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/HurtadoKKLSSSST18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KanoK18,
  author       = {Mikio Kano and
                  Jan Kyncl},
  title        = {The hamburger theorem},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {167--173},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.012},
  doi          = {10.1016/J.COMGEO.2017.06.012},
  timestamp    = {Fri, 30 Nov 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KanoK18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KellerS18,
  author       = {Chaya Keller and
                  Yael Stein},
  title        = {Reconstruction of the path graph},
  journal      = {Comput. Geom.},
  volume       = {72},
  pages        = {1--10},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.02.002},
  doi          = {10.1016/J.COMGEO.2018.02.002},
  timestamp    = {Mon, 29 Oct 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KellerS18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KellerS18a,
  author       = {Chaya Keller and
                  Shakhar Smorodinsky},
  title        = {On piercing numbers of families satisfying the (\emph{p}, \emph{q})\({}_{\mbox{\emph{r}}}\)
                  property},
  journal      = {Comput. Geom.},
  volume       = {72},
  pages        = {11--18},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.02.001},
  doi          = {10.1016/J.COMGEO.2018.02.001},
  timestamp    = {Sat, 19 Oct 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KellerS18a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Klein18,
  author       = {Rolf Klein},
  title        = {Reversibility properties of the fire-fighting problem in graphs},
  journal      = {Comput. Geom.},
  volume       = {67},
  pages        = {38--41},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.10.003},
  doi          = {10.1016/J.COMGEO.2017.10.003},
  timestamp    = {Mon, 27 Nov 2017 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Klein18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KnauerSS18,
  author       = {Christian Knauer and
                  Luise Sommer and
                  Fabian Stehn},
  title        = {Elastic geometric shape matching for translations under the Manhattan
                  norm},
  journal      = {Comput. Geom.},
  volume       = {73},
  pages        = {57--69},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.01.002},
  doi          = {10.1016/J.COMGEO.2018.01.002},
  timestamp    = {Mon, 29 Oct 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KnauerSS18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KormanLMPSV18,
  author       = {Matias Korman and
                  Stefan Langerman and
                  Wolfgang Mulzer and
                  Alexander Pilz and
                  Maria Saumell and
                  Birgit Vogtenhuber},
  title        = {The dual diameter of triangulations},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {243--252},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.008},
  doi          = {10.1016/J.COMGEO.2017.06.008},
  timestamp    = {Fri, 30 Nov 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KormanLMPSV18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KormanLSS18,
  author       = {Matias Korman and
                  Maarten L{\"{o}}ffler and
                  Rodrigo I. Silveira and
                  Darren Strash},
  title        = {On the complexity of barrier resilience for fat regions and bounded
                  ply},
  journal      = {Comput. Geom.},
  volume       = {72},
  pages        = {34--51},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.02.006},
  doi          = {10.1016/J.COMGEO.2018.02.006},
  timestamp    = {Sat, 19 Oct 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KormanLSS18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KormanMRRSS18,
  author       = {Matias Korman and
                  Wolfgang Mulzer and
                  Andr{\'{e}} van Renssen and
                  Marcel Roeloffzen and
                  Paul Seiferth and
                  Yannik Stein},
  title        = {Time-space trade-offs for triangulations and Voronoi diagrams},
  journal      = {Comput. Geom.},
  volume       = {73},
  pages        = {35--45},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.01.001},
  doi          = {10.1016/J.COMGEO.2017.01.001},
  timestamp    = {Fri, 30 Nov 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KormanMRRSS18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KouhestaniRS18,
  author       = {Bahram Kouhestani and
                  David Rappaport and
                  Kai Salomaa},
  title        = {Routing in a polygonal terrain with the shortest beacon watchtower},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {34--47},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.05.005},
  doi          = {10.1016/J.COMGEO.2017.05.005},
  timestamp    = {Mon, 27 Nov 2017 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KouhestaniRS18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LeeY18,
  author       = {Seunghun Lee and
                  Kang Min Yoo},
  title        = {On a conjecture of Karasev},
  journal      = {Comput. Geom.},
  volume       = {75},
  pages        = {1--10},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.06.003},
  doi          = {10.1016/J.COMGEO.2018.06.003},
  timestamp    = {Sun, 22 Oct 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/LeeY18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MaheshwariSS18,
  author       = {Anil Maheshwari and
                  J{\"{o}}rg{-}R{\"{u}}diger Sack and
                  Christian Scheffer},
  title        = {Approximating the integral Fr{\'{e}}chet distance},
  journal      = {Comput. Geom.},
  volume       = {70-71},
  pages        = {13--30},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.01.001},
  doi          = {10.1016/J.COMGEO.2018.01.001},
  timestamp    = {Mon, 29 Oct 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MaheshwariSS18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MonroyOHJPSSTU18,
  author       = {Ruy Fabila Monroy and
                  Alfredo Garc{\'{\i}}a Olaverri and
                  Ferran Hurtado and
                  Rafel Jaume and
                  Pablo P{\'{e}}rez{-}Lantero and
                  Maria Saumell and
                  Rodrigo I. Silveira and
                  Javier Tejel and
                  Jorge Urrutia},
  title        = {Colored ray configurations},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {292--308},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.05.008},
  doi          = {10.1016/J.COMGEO.2017.05.008},
  timestamp    = {Tue, 29 Dec 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MonroyOHJPSSTU18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/OhCA18,
  author       = {Eunjin Oh and
                  Jean{-}Lou De Carufel and
                  Hee{-}Kap Ahn},
  title        = {The geodesic 2-center problem in a simple polygon},
  journal      = {Comput. Geom.},
  volume       = {74},
  pages        = {21--37},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.02.008},
  doi          = {10.1016/J.COMGEO.2018.02.008},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/OhCA18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PachSTT18,
  author       = {J{\'{a}}nos Pach and
                  L{\'{a}}szl{\'{o}} A. Sz{\'{e}}kely and
                  Csaba D. T{\'{o}}th and
                  G{\'{e}}za T{\'{o}}th},
  title        = {Note on k-planar crossing numbers},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {2--6},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.015},
  doi          = {10.1016/J.COMGEO.2017.06.015},
  timestamp    = {Mon, 20 May 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/PachSTT18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RamaswamiS18,
  author       = {Suneeta Ramaswami and
                  Marcelo Siqueira},
  title        = {A fast algorithm for computing irreducible triangulations of closed
                  surfaces in {\(\mathbb{E}\)}\({}^{\mbox{d}}\)},
  journal      = {Comput. Geom.},
  volume       = {68},
  pages        = {327--357},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.05.007},
  doi          = {10.1016/J.COMGEO.2017.05.007},
  timestamp    = {Tue, 21 Mar 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/RamaswamiS18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Sack18,
  author       = {J{\"{o}}rg{-}R{\"{u}}diger Sack},
  title        = {Editor's note},
  journal      = {Comput. Geom.},
  volume       = {69},
  pages        = {1},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.11.002},
  doi          = {10.1016/J.COMGEO.2017.11.002},
  timestamp    = {Wed, 20 Dec 2017 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Sack18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SharirSVZ18,
  author       = {Micha Sharir and
                  Shakhar Smorodinsky and
                  Claudiu Valculescu and
                  Frank de Zeeuw},
  title        = {Distinct distances between points and lines},
  journal      = {Comput. Geom.},
  volume       = {69},
  pages        = {2--15},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.10.008},
  doi          = {10.1016/J.COMGEO.2017.10.008},
  timestamp    = {Sat, 19 Oct 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/SharirSVZ18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SpeckmannV18,
  author       = {Bettina Speckmann and
                  Kevin Verbeek},
  title        = {Homotopic {\unicode{119966}}-oriented routing with few links and thick
                  edges},
  journal      = {Comput. Geom.},
  volume       = {67},
  pages        = {11--28},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.10.005},
  doi          = {10.1016/J.COMGEO.2017.10.005},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/SpeckmannV18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SultanaHRMH18,
  author       = {Shaheena Sultana and
                  Md. Iqbal Hossain and
                  Md. Saidur Rahman and
                  Nazmun Nessa Moon and
                  Tahsina Hashem},
  title        = {On triangle cover contact graphs},
  journal      = {Comput. Geom.},
  volume       = {69},
  pages        = {31--38},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2017.11.001},
  doi          = {10.1016/J.COMGEO.2017.11.001},
  timestamp    = {Tue, 12 Mar 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SultanaHRMH18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Wang18,
  author       = {Haitao Wang},
  title        = {An improved algorithm for diameter-optimally augmenting paths in a
                  metric space},
  journal      = {Comput. Geom.},
  volume       = {75},
  pages        = {11--21},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.06.004},
  doi          = {10.1016/J.COMGEO.2018.06.004},
  timestamp    = {Sun, 18 Nov 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Wang18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/XueLJ18,
  author       = {Jie Xue and
                  Yuan Li and
                  Ravi Janardan},
  title        = {On the separability of stochastic geometric objects, with applications},
  journal      = {Comput. Geom.},
  volume       = {74},
  pages        = {1--20},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.06.001},
  doi          = {10.1016/J.COMGEO.2018.06.001},
  timestamp    = {Fri, 27 Nov 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/XueLJ18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZangenehO18,
  author       = {Reza Zangeneh and
                  Carl Ollivier{-}Gooch},
  title        = {Thread-parallel mesh improvement using face and edge swapping and
                  vertex insertion},
  journal      = {Comput. Geom.},
  volume       = {70-71},
  pages        = {31--48},
  year         = {2018},
  url          = {https://doi.org/10.1016/j.comgeo.2018.01.006},
  doi          = {10.1016/J.COMGEO.2018.01.006},
  timestamp    = {Mon, 29 Oct 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ZangenehO18.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkiyamaM17,
  author       = {Jin Akiyama and
                  Kiyoko Matsunaga},
  title        = {Reversibility and foldability of Conway tiles},
  journal      = {Comput. Geom.},
  volume       = {64},
  pages        = {30--45},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.03.003},
  doi          = {10.1016/J.COMGEO.2017.03.003},
  timestamp    = {Wed, 17 May 2017 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AkiyamaM17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlamKM17,
  author       = {Md. Jawaherul Alam and
                  Stephen G. Kobourov and
                  Debajyoti Mondal},
  title        = {Orthogonal layout with optimal face complexity},
  journal      = {Comput. Geom.},
  volume       = {63},
  pages        = {40--52},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.02.005},
  doi          = {10.1016/J.COMGEO.2017.02.005},
  timestamp    = {Sat, 20 May 2017 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AlamKM17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AnshuGSV17,
  author       = {Anurag Anshu and
                  Rahul Gangopadhyay and
                  Saswata Shannigrahi and
                  Satyanarayana Vusirikala},
  title        = {On the rectilinear crossing number of complete uniform hypergraphs},
  journal      = {Comput. Geom.},
  volume       = {61},
  pages        = {38--47},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.11.001},
  doi          = {10.1016/J.COMGEO.2016.11.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AnshuGSV17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BanikBDM17,
  author       = {Aritra Banik and
                  Bhaswar B. Bhattacharya and
                  Sandip Das and
                  Satyaki Mukherjee},
  title        = {The discrete Voronoi game in R\({}^{\mbox{2}}\)},
  journal      = {Comput. Geom.},
  volume       = {63},
  pages        = {53--62},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.02.003},
  doi          = {10.1016/J.COMGEO.2017.02.003},
  timestamp    = {Sat, 14 Oct 2017 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BanikBDM17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarbaDMH17,
  author       = {Luis Barba and
                  Frank Duque and
                  Ruy Fabila Monroy and
                  Carlos Hidalgo{-}Toscano},
  title        = {Drawing the Horton set in an integer grid of minimum size},
  journal      = {Comput. Geom.},
  volume       = {63},
  pages        = {10--19},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.02.002},
  doi          = {10.1016/J.COMGEO.2017.02.002},
  timestamp    = {Thu, 14 Oct 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BarbaDMH17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BennettY17,
  author       = {Huck Bennett and
                  Chee Yap},
  title        = {Amortized analysis of smooth quadtrees in all dimensions},
  journal      = {Comput. Geom.},
  volume       = {63},
  pages        = {20--39},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.02.001},
  doi          = {10.1016/J.COMGEO.2017.02.001},
  timestamp    = {Sat, 20 May 2017 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BennettY17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazLMS17,
  author       = {Ahmad Biniaz and
                  Paul Liu and
                  Anil Maheshwari and
                  Michiel H. M. Smid},
  title        = {Approximation algorithms for the unit disk cover problem in 2D and
                  3D},
  journal      = {Comput. Geom.},
  volume       = {60},
  pages        = {8--18},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.04.002},
  doi          = {10.1016/J.COMGEO.2016.04.002},
  timestamp    = {Tue, 19 Dec 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiniazLMS17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazMNS17,
  author       = {Ahmad Biniaz and
                  Anil Maheshwari and
                  Subhas C. Nandy and
                  Michiel H. M. Smid},
  title        = {An optimal algorithm for plane matchings in multipartite geometric
                  graphs},
  journal      = {Comput. Geom.},
  volume       = {63},
  pages        = {1--9},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.02.004},
  doi          = {10.1016/J.COMGEO.2017.02.004},
  timestamp    = {Sat, 20 May 2017 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiniazMNS17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoissonnatDGO17,
  author       = {Jean{-}Daniel Boissonnat and
                  Ramsay Dyer and
                  Arijit Ghosh and
                  Steve Y. Oudot},
  title        = {Only distances are required to reconstruct submanifolds},
  journal      = {Comput. Geom.},
  volume       = {66},
  pages        = {32--67},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.08.001},
  doi          = {10.1016/J.COMGEO.2017.08.001},
  timestamp    = {Tue, 26 Sep 2017 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoissonnatDGO17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseV17,
  author       = {Prosenjit Bose and
                  Sander Verdonschot},
  title        = {Flips in edge-labelled pseudo-triangulations},
  journal      = {Comput. Geom.},
  volume       = {60},
  pages        = {45--54},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.08.001},
  doi          = {10.1016/J.COMGEO.2016.08.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseV17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanR17,
  author       = {Timothy M. Chan and
                  Zahed Rahmati},
  title        = {Approximating the minimum closest pair distance and nearest neighbor
                  distances of linearly moving points},
  journal      = {Comput. Geom.},
  volume       = {60},
  pages        = {2--7},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.04.001},
  doi          = {10.1016/J.COMGEO.2016.04.001},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChanR17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanS17,
  author       = {Timothy M. Chan and
                  Dimitrios Skrepetos},
  title        = {Dynamic data structures for approximate Hausdorff distance in the
                  word {RAM}},
  journal      = {Comput. Geom.},
  volume       = {60},
  pages        = {37--44},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.08.002},
  doi          = {10.1016/J.COMGEO.2016.08.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChanS17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChangY17,
  author       = {Yi{-}Jun Chang and
                  Hsu{-}Chun Yen},
  title        = {On orthogonally convex drawings of plane graphs},
  journal      = {Comput. Geom.},
  volume       = {62},
  pages        = {34--51},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.01.003},
  doi          = {10.1016/J.COMGEO.2017.01.003},
  timestamp    = {Mon, 16 Sep 2019 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChangY17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DamianN17,
  author       = {Mirela Damian and
                  Naresh Nelavalli},
  title        = {Improved bounds on the stretch factor of Y\({}_{\mbox{4}}\)},
  journal      = {Comput. Geom.},
  volume       = {62},
  pages        = {14--24},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.12.001},
  doi          = {10.1016/J.COMGEO.2016.12.001},
  timestamp    = {Sat, 20 May 2017 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DamianN17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DuqueMHP17,
  author       = {Frank Duque and
                  Ruy Fabila Monroy and
                  Carlos Hidalgo{-}Toscano and
                  Pablo P{\'{e}}rez{-}Lantero},
  title        = {Drawing the almost convex set in an integer grid of minimum size},
  journal      = {Comput. Geom.},
  volume       = {65},
  pages        = {1--11},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.04.002},
  doi          = {10.1016/J.COMGEO.2017.04.002},
  timestamp    = {Thu, 14 Oct 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DuqueMHP17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherFFMM17,
  author       = {Stephane Durocher and
                  Omrit Filtser and
                  Robert Fraser and
                  Ali D. Mehrabi and
                  Saeed Mehrabi},
  title        = {Guarding orthogonal art galleries with sliding cameras},
  journal      = {Comput. Geom.},
  volume       = {65},
  pages        = {12--26},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.04.001},
  doi          = {10.1016/J.COMGEO.2017.04.001},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DurocherFFMM17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Fulek17,
  author       = {Radoslav Fulek},
  title        = {C-planarity of embedded cyclic c-graphs},
  journal      = {Comput. Geom.},
  volume       = {66},
  pages        = {1--13},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.06.016},
  doi          = {10.1016/J.COMGEO.2017.06.016},
  timestamp    = {Fri, 30 Nov 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Fulek17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FulekMNSSS17,
  author       = {Radoslav Fulek and
                  Hossein Nassajian Mojarrad and
                  M{\'{a}}rton Nasz{\'{o}}di and
                  J{\'{o}}zsef Solymosi and
                  Sebastian U. Stich and
                  May Szedl{\'{a}}k},
  title        = {On the existence of ordinary triangles},
  journal      = {Comput. Geom.},
  volume       = {66},
  pages        = {28--31},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.07.002},
  doi          = {10.1016/J.COMGEO.2017.07.002},
  timestamp    = {Fri, 30 Nov 2018 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FulekMNSSS17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HatamiZ17,
  author       = {Behnam Hatami and
                  Hamid Zarrabi{-}Zadeh},
  title        = {A streaming algorithm for 2-center with outliers in high dimensions},
  journal      = {Comput. Geom.},
  volume       = {60},
  pages        = {26--36},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.07.002},
  doi          = {10.1016/J.COMGEO.2016.07.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HatamiZ17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HeldK17,
  author       = {Stephan Held and
                  Nicolas K{\"{a}}mmerling},
  title        = {Two-level rectilinear Steiner trees},
  journal      = {Comput. Geom.},
  volume       = {61},
  pages        = {48--59},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.11.002},
  doi          = {10.1016/J.COMGEO.2016.11.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HeldK17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HolmsenKV17,
  author       = {Andreas F. Holmsen and
                  Jan Kyncl and
                  Claudiu Valculescu},
  title        = {Near equipartitions of colored point sets},
  journal      = {Comput. Geom.},
  volume       = {65},
  pages        = {35--42},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.05.001},
  doi          = {10.1016/J.COMGEO.2017.05.001},
  timestamp    = {Sat, 16 Sep 2017 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/HolmsenKV17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KeilMPV17,
  author       = {J. Mark Keil and
                  Joseph S. B. Mitchell and
                  Dinabandhu Pradhan and
                  Martin Vatshelle},
  title        = {An algorithm for the maximum weight independent set problem on outerstring
                  graphs},
  journal      = {Comput. Geom.},
  volume       = {60},
  pages        = {19--25},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.05.001},
  doi          = {10.1016/J.COMGEO.2016.05.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KeilMPV17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LubiwSV17,
  author       = {Anna Lubiw and
                  Jack Snoeyink and
                  Hamideh Vosoughpour},
  title        = {Visibility graphs, dismantlability, and the cops and robbers game},
  journal      = {Comput. Geom.},
  volume       = {66},
  pages        = {14--27},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.07.001},
  doi          = {10.1016/J.COMGEO.2017.07.001},
  timestamp    = {Tue, 26 Sep 2017 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/LubiwSV17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/OrickSC17,
  author       = {Gerald L. Orick and
                  Kenneth Stephenson and
                  Charles R. Collins},
  title        = {A linearized circle packing algorithm},
  journal      = {Comput. Geom.},
  volume       = {64},
  pages        = {13--29},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.03.002},
  doi          = {10.1016/J.COMGEO.2017.03.002},
  timestamp    = {Wed, 17 May 2017 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/OrickSC17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Rappaport17,
  author       = {David Rappaport},
  title        = {Guest Editor's foreword},
  journal      = {Comput. Geom.},
  volume       = {60},
  pages        = {1},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.08.005},
  doi          = {10.1016/J.COMGEO.2016.08.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Rappaport17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RathodMN17,
  author       = {Abhishek Rathod and
                  Talha Bin Masood and
                  Vijay Natarajan},
  title        = {Approximation algorithms for Max Morse Matching},
  journal      = {Comput. Geom.},
  volume       = {61},
  pages        = {1--23},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.10.002},
  doi          = {10.1016/J.COMGEO.2016.10.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/RathodMN17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RazSS17,
  author       = {Orit E. Raz and
                  Micha Sharir and
                  Ilya D. Shkredov},
  title        = {On the number of unit-area triangles spanned by convex grids in the
                  plane},
  journal      = {Comput. Geom.},
  volume       = {62},
  pages        = {25--33},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.12.002},
  doi          = {10.1016/J.COMGEO.2016.12.002},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/RazSS17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ruiz-Vargas17,
  author       = {Andres J. Ruiz{-}Vargas},
  title        = {Many disjoint edges in topological graphs},
  journal      = {Comput. Geom.},
  volume       = {62},
  pages        = {1--13},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.11.003},
  doi          = {10.1016/J.COMGEO.2016.11.003},
  timestamp    = {Sat, 20 May 2017 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Ruiz-Vargas17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SavicS17,
  author       = {Marko Savic and
                  Milos Stojakovic},
  title        = {Faster bottleneck non-crossing matchings of points in convex position},
  journal      = {Comput. Geom.},
  volume       = {65},
  pages        = {27--34},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.05.002},
  doi          = {10.1016/J.COMGEO.2017.05.002},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/SavicS17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SheikhiMBM17,
  author       = {Farnaz Sheikhi and
                  Ali Mohades and
                  Mark de Berg and
                  Ali D. Mehrabi},
  title        = {Separability of imprecise points},
  journal      = {Comput. Geom.},
  volume       = {61},
  pages        = {24--37},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2016.10.001},
  doi          = {10.1016/J.COMGEO.2016.10.001},
  timestamp    = {Mon, 03 Jan 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SheikhiMBM17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/XuHSU17,
  author       = {Dawei Xu and
                  Takashi Horiyama and
                  Toshihiro Shirakawa and
                  Ryuhei Uehara},
  title        = {Common developments of three incongruent boxes of area 30},
  journal      = {Comput. Geom.},
  volume       = {64},
  pages        = {1--12},
  year         = {2017},
  url          = {https://doi.org/10.1016/j.comgeo.2017.03.001},
  doi          = {10.1016/J.COMGEO.2017.03.001},
  timestamp    = {Tue, 29 Dec 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/XuHSU17.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AdamaszekS16,
  author       = {Michal Adamaszek and
                  Juraj Stacho},
  title        = {Complexity of simplicial homology and independence complexes of chordal
                  graphs},
  journal      = {Comput. Geom.},
  volume       = {57},
  pages        = {8--18},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.05.003},
  doi          = {10.1016/J.COMGEO.2016.05.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AdamaszekS16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovBERS16,
  author       = {Boris Aronov and
                  Mark de Berg and
                  David Eppstein and
                  Marcel Roeloffzen and
                  Bettina Speckmann},
  title        = {Distance-sensitive planar point location},
  journal      = {Comput. Geom.},
  volume       = {54},
  pages        = {17--31},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.02.001},
  doi          = {10.1016/J.COMGEO.2016.02.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AronovBERS16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bae16,
  author       = {Sang Won Bae},
  title        = {An almost optimal algorithm for Voronoi diagrams of non-disjoint line
                  segments},
  journal      = {Comput. Geom.},
  volume       = {52},
  pages        = {34--43},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.11.002},
  doi          = {10.1016/J.COMGEO.2015.11.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Bae16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BanikCMS16,
  author       = {Aritra Banik and
                  Jean{-}Lou De Carufel and
                  Anil Maheshwari and
                  Michiel H. M. Smid},
  title        = {Discrete Voronoi games and {\unicode{1013}}-nets, in two and three
                  dimensions},
  journal      = {Comput. Geom.},
  volume       = {55},
  pages        = {41--58},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.02.002},
  doi          = {10.1016/J.COMGEO.2016.02.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BanikCMS16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregHKPT16,
  author       = {Sergey Bereg and
                  Seok{-}Hee Hong and
                  Naoki Katoh and
                  Sheung{-}Hung Poon and
                  Shin{-}ichi Tanigawa},
  title        = {On the edge crossing properties of Euclidean minimum weight Laman
                  graphs},
  journal      = {Comput. Geom.},
  volume       = {51},
  pages        = {15--24},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.10.002},
  doi          = {10.1016/J.COMGEO.2015.10.002},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BeregHKPT16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazBMS16,
  author       = {Ahmad Biniaz and
                  Prosenjit Bose and
                  Anil Maheshwari and
                  Michiel H. M. Smid},
  title        = {Plane geodesic spanning trees, Hamiltonian cycles, and perfect matchings
                  in a simple polygon},
  journal      = {Comput. Geom.},
  volume       = {57},
  pages        = {27--39},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.05.004},
  doi          = {10.1016/J.COMGEO.2016.05.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiniazBMS16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BlasiusLR16,
  author       = {Thomas Bl{\"{a}}sius and
                  Sebastian Lehmann and
                  Ignaz Rutter},
  title        = {Orthogonal graph drawing with inflexible edges},
  journal      = {Comput. Geom.},
  volume       = {55},
  pages        = {26--40},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.03.001},
  doi          = {10.1016/J.COMGEO.2016.03.001},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BlasiusLR16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BohlerLPZ16,
  author       = {Cecilia Bohler and
                  Chih{-}Hung Liu and
                  Evanthia Papadopoulou and
                  Maksym Zavershynskyi},
  title        = {A randomized divide and conquer algorithm for higher-order abstract
                  Voronoi diagrams},
  journal      = {Comput. Geom.},
  volume       = {59},
  pages        = {26--38},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.08.004},
  doi          = {10.1016/J.COMGEO.2016.08.004},
  timestamp    = {Tue, 14 Sep 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BohlerLPZ16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCSS16,
  author       = {Prosenjit Bose and
                  Jean{-}Lou De Carufel and
                  Alina Shaikhet and
                  Michiel H. M. Smid},
  title        = {Probing convex polygons with a wedge},
  journal      = {Comput. Geom.},
  volume       = {58},
  pages        = {34--59},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.06.001},
  doi          = {10.1016/J.COMGEO.2016.06.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseCSS16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchetCOS16,
  author       = {Micka{\"{e}}l Buchet and
                  Fr{\'{e}}d{\'{e}}ric Chazal and
                  Steve Y. Oudot and
                  Donald R. Sheehy},
  title        = {Efficient and robust persistent homology for measures},
  journal      = {Comput. Geom.},
  volume       = {58},
  pages        = {70--96},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.07.001},
  doi          = {10.1016/J.COMGEO.2016.07.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BuchetCOS16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BusGMR16,
  author       = {Norbert Bus and
                  Shashwat Garg and
                  Nabil H. Mustafa and
                  Saurabh Ray},
  title        = {Tighter estimates for {\unicode{1013}}-nets for disks},
  journal      = {Comput. Geom.},
  volume       = {53},
  pages        = {27--35},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.12.002},
  doi          = {10.1016/J.COMGEO.2015.12.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BusGMR16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloCKS16,
  author       = {Sergio Cabello and
                  Otfried Cheong and
                  Christian Knauer and
                  Lena Schlipf},
  title        = {Finding largest rectangles in convex polygons},
  journal      = {Comput. Geom.},
  volume       = {51},
  pages        = {67--74},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.08.001},
  doi          = {10.1016/J.COMGEO.2015.08.001},
  timestamp    = {Sun, 25 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CabelloCKS16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Capitelli16,
  author       = {Nicolas Ariel Capitelli},
  title        = {The non-pure version of the simplex and the boundary of the simplex},
  journal      = {Comput. Geom.},
  volume       = {57},
  pages        = {19--26},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.05.002},
  doi          = {10.1016/J.COMGEO.2016.05.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Capitelli16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChattopadhyayCD16,
  author       = {Amit Chattopadhyay and
                  Hamish A. Carr and
                  David J. Duke and
                  Zhao Geng and
                  Osamu Saeki},
  title        = {Multivariate topology simplification},
  journal      = {Comput. Geom.},
  volume       = {58},
  pages        = {1--24},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.05.006},
  doi          = {10.1016/J.COMGEO.2016.05.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChattopadhyayCD16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChavezCL16,
  author       = {Edgar Ch{\'{a}}vez and
                  Ana C. Ch{\'{a}}vez{-}C{\'{a}}liz and
                  Jorge L. L{\'{o}}pez{-}L{\'{o}}pez},
  title        = {Affine invariants of generalized polygons and matching under affine
                  transformations},
  journal      = {Comput. Geom.},
  volume       = {58},
  pages        = {60--69},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.06.003},
  doi          = {10.1016/J.COMGEO.2016.06.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChavezCL16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DaiKL16,
  author       = {Bang{-}Sin Dai and
                  Mong{-}Jen Kao and
                  D. T. Lee},
  title        = {Optimal time-convex hull for a straight-line highway in L\({}_{\mbox{p}}\)-metrics},
  journal      = {Comput. Geom.},
  volume       = {53},
  pages        = {1--20},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.10.007},
  doi          = {10.1016/J.COMGEO.2015.10.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DaiKL16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Diaz-BanezHPSUV16,
  author       = {Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
                  Marco A. Heredia and
                  Canek Pel{\'{a}}ez and
                  Joan Antoni Sellar{\`{e}}s and
                  Jorge Urrutia and
                  Inmaculada Ventura},
  title        = {Convex blocking and partial orders on the plane},
  journal      = {Comput. Geom.},
  volume       = {51},
  pages        = {55--66},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.08.003},
  doi          = {10.1016/J.COMGEO.2015.08.003},
  timestamp    = {Thu, 14 Oct 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Diaz-BanezHPSUV16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DobrevHMMPNOS16,
  author       = {Stefan Dobrev and
                  Mohsen Eftekhari Hesari and
                  Fraser MacQuarie and
                  J{\'{a}}n Manuch and
                  Oscar Morales{-}Ponce and
                  Lata Narayanan and
                  Jaroslav Opatrny and
                  Ladislav Stacho},
  title        = {Connectivity with directional antennas in the symmetric communication
                  model},
  journal      = {Comput. Geom.},
  volume       = {55},
  pages        = {1--25},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.03.002},
  doi          = {10.1016/J.COMGEO.2016.03.002},
  timestamp    = {Mon, 03 May 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DobrevHMMPNOS16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherGM16,
  author       = {Stephane Durocher and
                  Ellen Gethner and
                  Debajyoti Mondal},
  title        = {Thickness and colorability of geometric graphs},
  journal      = {Comput. Geom.},
  volume       = {56},
  pages        = {1--18},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.03.003},
  doi          = {10.1016/J.COMGEO.2016.03.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DurocherGM16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EvansLMW16,
  author       = {William S. Evans and
                  Giuseppe Liotta and
                  Henk Meijer and
                  Stephen K. Wismath},
  title        = {Alternating paths and cycles of minimum length},
  journal      = {Comput. Geom.},
  volume       = {58},
  pages        = {124--135},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.07.005},
  doi          = {10.1016/J.COMGEO.2016.07.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/EvansLMW16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EvrendilekGH16,
  author       = {Cem Evrendilek and
                  Burkay Gen{\c{c}} and
                  Brahim Hnich},
  title        = {Covering points with minimum/maximum area orthogonally convex polygons},
  journal      = {Comput. Geom.},
  volume       = {54},
  pages        = {32--44},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.02.003},
  doi          = {10.1016/J.COMGEO.2016.02.003},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/EvrendilekGH16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FarshiP16,
  author       = {Mohammad Farshi and
                  Abolfazl Poureidi},
  title        = {A lower bound for computing geometric spanners},
  journal      = {Comput. Geom.},
  volume       = {53},
  pages        = {21--26},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.12.004},
  doi          = {10.1016/J.COMGEO.2015.12.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FarshiP16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FisikopoulosP16,
  author       = {Vissarion Fisikopoulos and
                  Luis Mariano Pe{\~{n}}aranda},
  title        = {Faster geometric algorithms via dynamic determinant computation},
  journal      = {Comput. Geom.},
  volume       = {54},
  pages        = {1--16},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.12.001},
  doi          = {10.1016/J.COMGEO.2015.12.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FisikopoulosP16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Garcia-MarcoK16,
  author       = {Ignacio Garc{\'{\i}}a{-}Marco and
                  Kolja Knauer},
  title        = {Drawing graphs with vertices and edges in convex position},
  journal      = {Comput. Geom.},
  volume       = {58},
  pages        = {25--33},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.06.002},
  doi          = {10.1016/J.COMGEO.2016.06.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Garcia-MarcoK16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GyoriM16,
  author       = {Ervin Gy{\"{o}}ri and
                  Tam{\'{a}}s R{\'{o}}bert Mezei},
  title        = {Partitioning orthogonal polygons into {\(\leq\)} 8-vertex pieces,
                  with application to an art gallery theorem},
  journal      = {Comput. Geom.},
  volume       = {59},
  pages        = {13--25},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.07.003},
  doi          = {10.1016/J.COMGEO.2016.07.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GyoriM16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HaCGY16,
  author       = {Jae{-}Soon Ha and
                  Otfried Cheong and
                  Xavier Goaoc and
                  Jungwoo Yang},
  title        = {Geometric permutations of non-overlapping unit balls revisited},
  journal      = {Comput. Geom.},
  volume       = {53},
  pages        = {36--50},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.12.003},
  doi          = {10.1016/J.COMGEO.2015.12.003},
  timestamp    = {Sun, 25 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/HaCGY16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HemmerKH16,
  author       = {Michael Hemmer and
                  Michal Kleinbort and
                  Dan Halperin},
  title        = {Optimal randomized incremental construction for guaranteed logarithmic
                  planar point location},
  journal      = {Comput. Geom.},
  volume       = {58},
  pages        = {110--123},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.07.006},
  doi          = {10.1016/J.COMGEO.2016.07.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HemmerKH16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HenzeJ16,
  author       = {Matthias Henze and
                  Rafel Jaume},
  title        = {Bottleneck partial-matching Voronoi diagrams and applications},
  journal      = {Comput. Geom.},
  volume       = {51},
  pages        = {40--54},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.10.001},
  doi          = {10.1016/J.COMGEO.2015.10.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HenzeJ16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/IgamberdievS16,
  author       = {Alexander Igamberdiev and
                  Andr{\'{e}} Schulz},
  title        = {A duality transform for constructing small grid embeddings of 3d polytopes},
  journal      = {Comput. Geom.},
  volume       = {56},
  pages        = {19--36},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.03.004},
  doi          = {10.1016/J.COMGEO.2016.03.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/IgamberdievS16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ItoNOOUUU16,
  author       = {Takehiro Ito and
                  Shin{-}Ichi Nakano and
                  Yoshio Okamoto and
                  Yota Otachi and
                  Ryuhei Uehara and
                  Takeaki Uno and
                  Yushi Uno},
  title        = {A polynomial-time approximation scheme for the geometric unique coverage
                  problem on unit squares},
  journal      = {Comput. Geom.},
  volume       = {51},
  pages        = {25--39},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.10.004},
  doi          = {10.1016/J.COMGEO.2015.10.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ItoNOOUUU16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KamousiLMW16,
  author       = {Pegah Kamousi and
                  Sylvain Lazard and
                  Anil Maheshwari and
                  Stefanie Wuhrer},
  title        = {Analysis of farthest point sampling for approximating geodesics in
                  a graph},
  journal      = {Comput. Geom.},
  volume       = {57},
  pages        = {1--7},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.05.005},
  doi          = {10.1016/J.COMGEO.2016.05.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KamousiLMW16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ParkBAA16,
  author       = {Dongwoo Park and
                  Sang Won Bae and
                  Helmut Alt and
                  Hee{-}Kap Ahn},
  title        = {Bundling three convex polygons to minimize area or perimeter},
  journal      = {Comput. Geom.},
  volume       = {51},
  pages        = {1--14},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.10.003},
  doi          = {10.1016/J.COMGEO.2015.10.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ParkBAA16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PupyrevNBH16,
  author       = {Sergey Pupyrev and
                  Lev Nachmanson and
                  Sergey Bereg and
                  Alexander E. Holroyd},
  title        = {Edge routing with ordered bundles},
  journal      = {Comput. Geom.},
  volume       = {52},
  pages        = {18--33},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.10.005},
  doi          = {10.1016/J.COMGEO.2015.10.005},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/PupyrevNBH16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/TokekarI16,
  author       = {Pratap Tokekar and
                  Volkan Isler},
  title        = {Polygon guarding with orientation},
  journal      = {Comput. Geom.},
  volume       = {58},
  pages        = {97--109},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.07.004},
  doi          = {10.1016/J.COMGEO.2016.07.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/TokekarI16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/VerbeekS16,
  author       = {Kevin Verbeek and
                  Subhash Suri},
  title        = {Metric embedding, hyperbolic space, and social networks},
  journal      = {Comput. Geom.},
  volume       = {59},
  pages        = {1--12},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2016.08.003},
  doi          = {10.1016/J.COMGEO.2016.08.003},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/VerbeekS16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/YankelevskyB16,
  author       = {Yael Yankelevsky and
                  Alfred M. Bruckstein},
  title        = {On optimal disc covers and a new characterization of the Steiner center},
  journal      = {Comput. Geom.},
  volume       = {52},
  pages        = {1--8},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.10.006},
  doi          = {10.1016/J.COMGEO.2015.10.006},
  timestamp    = {Sat, 09 Apr 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/YankelevskyB16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZhangK16,
  author       = {Huaming Zhang and
                  Xiang{-}Zhi Kong},
  title        = {On k-greedy routing algorithms},
  journal      = {Comput. Geom.},
  volume       = {52},
  pages        = {9--17},
  year         = {2016},
  url          = {https://doi.org/10.1016/j.comgeo.2015.10.008},
  doi          = {10.1016/J.COMGEO.2015.10.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ZhangK16.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Abu-AffashBCMS15,
  author       = {A. Karim Abu{-}Affash and
                  Ahmad Biniaz and
                  Paz Carmi and
                  Anil Maheshwari and
                  Michiel H. M. Smid},
  title        = {Approximating the bottleneck plane perfect matching of a point set},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {9},
  pages        = {718--731},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.06.005},
  doi          = {10.1016/J.COMGEO.2015.06.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Abu-AffashBCMS15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerBBBKR15,
  author       = {Oswin Aichholzer and
                  Sang Won Bae and
                  Luis Barba and
                  Prosenjit Bose and
                  Matias Korman and
                  Andr{\'{e}} van Renssen and
                  Perouz Taslakian and
                  Sander Verdonschot},
  title        = {Reprint of: Theta-3 is connected},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {5},
  pages        = {407--414},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.01.002},
  doi          = {10.1016/J.COMGEO.2015.01.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerBBBKR15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMGHHH15,
  author       = {Oswin Aichholzer and
                  Ruy Fabila Monroy and
                  Hern{\'{a}}n Gonz{\'{a}}lez{-}Aguilar and
                  Thomas Hackl and
                  Marco A. Heredia and
                  Clemens Huemer and
                  Jorge Urrutia and
                  Pavel Valtr and
                  Birgit Vogtenhuber},
  title        = {On k-gons and k-holes in point sets},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {7},
  pages        = {528--537},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.12.007},
  doi          = {10.1016/J.COMGEO.2014.12.007},
  timestamp    = {Tue, 27 Dec 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerMGHHH15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlonF15,
  author       = {Noga Alon and
                  Ohad N. Feldheim},
  title        = {Drawing outerplanar graphs using three edge lengths},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {3},
  pages        = {260--267},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.10.006},
  doi          = {10.1016/J.COMGEO.2014.10.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AlonF15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisBLS15,
  author       = {Greg Aloupis and
                  Luis Barba and
                  Stefan Langerman and
                  Diane L. Souvaine},
  title        = {Bichromatic compatible matchings},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {8},
  pages        = {622--633},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.08.009},
  doi          = {10.1016/J.COMGEO.2014.08.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AloupisBLS15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlvarezBRS15,
  author       = {Victor Alvarez and
                  Karl Bringmann and
                  Saurabh Ray and
                  Raimund Seidel},
  title        = {Counting triangulations and other crossing-free structures approximately},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {5},
  pages        = {386--397},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.12.006},
  doi          = {10.1016/J.COMGEO.2014.12.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AlvarezBRS15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AngeliniBLDGMPT15,
  author       = {Patrizio Angelini and
                  Carla Binucci and
                  Giordano Da Lozzo and
                  Walter Didimo and
                  Luca Grilli and
                  Fabrizio Montecchiani and
                  Maurizio Patrignani and
                  Ioannis G. Tollis},
  title        = {Algorithms and bounds for drawing non-planar graphs with crossing-free
                  subgraphs},
  journal      = {Comput. Geom.},
  volume       = {50},
  pages        = {34--48},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.07.002},
  doi          = {10.1016/J.COMGEO.2015.07.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AngeliniBLDGMPT15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AngeliniLBFPR15,
  author       = {Patrizio Angelini and
                  Giordano Da Lozzo and
                  Giuseppe Di Battista and
                  Fabrizio Frati and
                  Maurizio Patrignani and
                  Vincenzo Roselli},
  title        = {Relaxing the constraints of clustered planarity},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {2},
  pages        = {42--75},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.08.001},
  doi          = {10.1016/J.COMGEO.2014.08.001},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AngeliniLBFPR15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArkinAMM15,
  author       = {Esther M. Arkin and
                  Antonio Fern{\'{a}}ndez Anta and
                  Joseph S. B. Mitchell and
                  Miguel A. Mosteiro},
  title        = {Probabilistic bounds on the length of a longest edge in Delaunay graphs
                  of random points in d-dimensions},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {2},
  pages        = {134--146},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.08.008},
  doi          = {10.1016/J.COMGEO.2014.08.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ArkinAMM15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArkinDHKMPPSS15,
  author       = {Esther M. Arkin and
                  Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
                  Ferran Hurtado and
                  Piyush Kumar and
                  Joseph S. B. Mitchell and
                  Bel{\'{e}}n Palop and
                  Pablo P{\'{e}}rez{-}Lantero and
                  Maria Saumell and
                  Rodrigo I. Silveira},
  title        = {Bichromatic 2-center of pairs of points},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {2},
  pages        = {94--107},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.08.004},
  doi          = {10.1016/J.COMGEO.2014.08.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ArkinDHKMPPSS15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AttaliBDGL15,
  author       = {Dominique Attali and
                  Ulrich Bauer and
                  Olivier Devillers and
                  Marc Glisse and
                  Andr{\'{e}} Lieutier},
  title        = {Homological reconstruction and simplification in R\({}^{\mbox{3}}\)},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {8},
  pages        = {606--621},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.08.010},
  doi          = {10.1016/J.COMGEO.2014.08.010},
  timestamp    = {Wed, 07 Dec 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AttaliBDGL15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeKOW15,
  author       = {Sang Won Bae and
                  Matias Korman and
                  Yoshio Okamoto and
                  Haitao Wang},
  title        = {Computing the {L1} geodesic diameter and center of a simple polygon
                  in linear time},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {6},
  pages        = {495--505},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.02.005},
  doi          = {10.1016/J.COMGEO.2015.02.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaeKOW15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaranyFMMOP15,
  author       = {Imre B{\'{a}}r{\'{a}}ny and
                  Ferenc Fodor and
                  {\'{A}}lvaro Mart{\'{\i}}nez{-}P{\'{e}}rez and
                  Luis Montejano and
                  Deborah Oliveros and
                  Attila P{\'{o}}r},
  title        = {A fractional Helly theorem for boxes},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {3},
  pages        = {221--224},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.09.007},
  doi          = {10.1016/J.COMGEO.2014.09.007},
  timestamp    = {Fri, 29 Jul 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaranyFMMOP15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregDMPRSUV15,
  author       = {Sergey Bereg and
                  Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
                  Ruy Fabila Monroy and
                  Pablo P{\'{e}}rez{-}Lantero and
                  Adriana Ram{\'{\i}}rez{-}Vigueras and
                  Toshinori Sakai and
                  Jorge Urrutia and
                  Inmaculada Ventura},
  title        = {On balanced 4-holes in bichromatic point sets},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {3},
  pages        = {169--179},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.09.004},
  doi          = {10.1016/J.COMGEO.2014.09.004},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BeregDMPRSUV15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BhatiaWNPB15,
  author       = {Harsh Bhatia and
                  Bei Wang and
                  Gregory Norgard and
                  Valerio Pascucci and
                  Peer{-}Timo Bremer},
  title        = {Local, smooth, and consistent Jacobi set simplification},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {4},
  pages        = {311--332},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.10.009},
  doi          = {10.1016/J.COMGEO.2014.10.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BhatiaWNPB15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlHHKP15,
  author       = {Therese Biedl and
                  Martin Held and
                  Stefan Huber and
                  Dominik Kaaser and
                  Peter Palfrader},
  title        = {Weighted straight skeletons in the plane},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {2},
  pages        = {120--133},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.08.006},
  doi          = {10.1016/J.COMGEO.2014.08.006},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiedlHHKP15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlHHKP15a,
  author       = {Therese Biedl and
                  Martin Held and
                  Stefan Huber and
                  Dominik Kaaser and
                  Peter Palfrader},
  title        = {Reprint of: Weighted straight skeletons in the plane},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {5},
  pages        = {429--442},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.01.004},
  doi          = {10.1016/J.COMGEO.2015.01.004},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiedlHHKP15a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazMS15,
  author       = {Ahmad Biniaz and
                  Anil Maheshwari and
                  Michiel H. M. Smid},
  title        = {On full Steiner trees in unit disk graphs},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {6},
  pages        = {453--458},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.02.004},
  doi          = {10.1016/J.COMGEO.2015.02.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiniazMS15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazMS15a,
  author       = {Ahmad Biniaz and
                  Anil Maheshwari and
                  Michiel H. M. Smid},
  title        = {Higher-order triangular-distance Delaunay graphs: Graph-theoretical
                  properties},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {9},
  pages        = {646--660},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.07.003},
  doi          = {10.1016/J.COMGEO.2015.07.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiniazMS15a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BlasiusR15,
  author       = {Thomas Bl{\"{a}}sius and
                  Ignaz Rutter},
  title        = {Disconnectivity and relative positions in simultaneous embeddings},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {6},
  pages        = {459--478},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.02.002},
  doi          = {10.1016/J.COMGEO.2015.02.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BlasiusR15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BohlerCKLPZ15,
  author       = {Cecilia Bohler and
                  Panagiotis Cheilaris and
                  Rolf Klein and
                  Chih{-}Hung Liu and
                  Evanthia Papadopoulou and
                  Maksym Zavershynskyi},
  title        = {On the complexity of higher order abstract Voronoi diagrams},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {8},
  pages        = {539--551},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.04.008},
  doi          = {10.1016/J.COMGEO.2015.04.008},
  timestamp    = {Tue, 14 Sep 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BohlerCKLPZ15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BonichonGHP15,
  author       = {Nicolas Bonichon and
                  Cyril Gavoille and
                  Nicolas Hanusse and
                  Ljubomir Perkovic},
  title        = {Tight stretch factors for L\({}_{\mbox{1}}\)- and L\({}_{\mbox{{\(\infty\)}}}\)-Delaunay
                  triangulations},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {3},
  pages        = {237--250},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.10.005},
  doi          = {10.1016/J.COMGEO.2014.10.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BonichonGHP15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BorradaileE15,
  author       = {Glencora Borradaile and
                  David Eppstein},
  title        = {Near-linear-time deterministic plane Steiner spanners for well-spaced
                  point sets},
  journal      = {Comput. Geom.},
  volume       = {49},
  pages        = {8--16},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.04.005},
  doi          = {10.1016/J.COMGEO.2015.04.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BorradaileE15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseMRV15,
  author       = {Prosenjit Bose and
                  Pat Morin and
                  Andr{\'{e}} van Renssen and
                  Sander Verdonschot},
  title        = {The {\texttheta}\({}_{\mbox{5}}\)-graph is a spanner},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {2},
  pages        = {108--119},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.08.005},
  doi          = {10.1016/J.COMGEO.2014.08.005},
  timestamp    = {Sun, 25 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseMRV15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BozokiLR15,
  author       = {S{\'{a}}ndor Boz{\'{o}}ki and
                  Tsung{-}Lin Lee and
                  Lajos R{\'{o}}nyai},
  title        = {Seven mutually touching infinite cylinders},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {2},
  pages        = {87--93},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.08.007},
  doi          = {10.1016/J.COMGEO.2014.08.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BozokiLR15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrassVX15,
  author       = {Peter Brass and
                  Ivo Vigan and
                  Ning Xu},
  title        = {Shortest path planning for a tethered robot},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {9},
  pages        = {732--742},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.06.004},
  doi          = {10.1016/J.COMGEO.2015.06.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BrassVX15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloJ15,
  author       = {Sergio Cabello and
                  Miha Jejcic},
  title        = {Shortest paths in intersection graphs of unit disks},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {4},
  pages        = {360--367},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.12.003},
  doi          = {10.1016/J.COMGEO.2014.12.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CabelloJ15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CaoET15,
  author       = {Thanh{-}Tung Cao and
                  Herbert Edelsbrunner and
                  Tiow Seng Tan},
  title        = {Triangulations from topologically correct digital Voronoi diagrams},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {7},
  pages        = {507--519},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.04.001},
  doi          = {10.1016/J.COMGEO.2015.04.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CaoET15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiFK15,
  author       = {Paz Carmi and
                  Eran Friedman and
                  Matthew J. Katz},
  title        = {Spiderman graph: Visibility in urban regions},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {3},
  pages        = {251--259},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.10.004},
  doi          = {10.1016/J.COMGEO.2014.10.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CarmiFK15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanH15,
  author       = {Timothy M. Chan and
                  Nan Hu},
  title        = {Geometric red-blue set cover for unit squares and related problems},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {5},
  pages        = {380--385},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.12.005},
  doi          = {10.1016/J.COMGEO.2014.12.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChanH15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanK15,
  author       = {Timothy M. Chan and
                  Rolf Klein},
  title        = {Guest Editor's foreword},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {8},
  pages        = {552--553},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.09.003},
  doi          = {10.1016/J.COMGEO.2014.09.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChanK15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenM15,
  author       = {Dan Chen and
                  Pat Morin},
  title        = {Reprint of: Approximating majority depth},
  journal      = {Comput. Geom.},
  volume       = {49},
  pages        = {2--7},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2013.11.005},
  doi          = {10.1016/J.COMGEO.2013.11.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChenM15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenW15,
  author       = {Danny Z. Chen and
                  Haitao Wang},
  title        = {Visibility and ray shooting queries in polygonal domains},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {2},
  pages        = {31--41},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.08.003},
  doi          = {10.1016/J.COMGEO.2014.08.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChenW15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenW15a,
  author       = {Danny Ziyi Chen and
                  Haitao Wang},
  title        = {Weak visibility queries of line segments in simple polygons},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {6},
  pages        = {443--452},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.02.001},
  doi          = {10.1016/J.COMGEO.2015.02.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChenW15a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CookDSW15,
  author       = {Atlas F. Cook IV and
                  Anne Driemel and
                  Jessica Sherette and
                  Carola Wenk},
  title        = {Computing the Fr{\'{e}}chet distance between folded polygons},
  journal      = {Comput. Geom.},
  volume       = {50},
  pages        = {1--16},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.08.002},
  doi          = {10.1016/J.COMGEO.2015.08.002},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CookDSW15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CrepaldiRS15,
  author       = {Bruno E. Crepaldi and
                  Pedro J. de Rezende and
                  Cid C. de Souza},
  title        = {Solving the natural wireless localization problem to optimality efficiently},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {5},
  pages        = {370--379},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.12.004},
  doi          = {10.1016/J.COMGEO.2014.12.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CrepaldiRS15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeyFW15,
  author       = {Tamal K. Dey and
                  Fengtao Fan and
                  Yusu Wang},
  title        = {Graph induced complex on point data},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {8},
  pages        = {575--588},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.04.003},
  doi          = {10.1016/J.COMGEO.2015.04.003},
  timestamp    = {Mon, 02 Jan 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DeyFW15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Diaz-BanezKPPSS15,
  author       = {Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
                  Matias Korman and
                  Pablo P{\'{e}}rez{-}Lantero and
                  Alexander Pilz and
                  Carlos Seara and
                  Rodrigo I. Silveira},
  title        = {New results on stabbing segments with a polygon},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {1},
  pages        = {14--29},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.06.002},
  doi          = {10.1016/J.COMGEO.2014.06.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Diaz-BanezKPPSS15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuJ15,
  author       = {Adrian Dumitrescu and
                  Minghui Jiang},
  title        = {On the approximability of covering points by lines and related problems},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {9},
  pages        = {703--717},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.06.006},
  doi          = {10.1016/J.COMGEO.2015.06.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DumitrescuJ15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FriedlerM15,
  author       = {Sorelle A. Friedler and
                  David M. Mount},
  title        = {A sensor-based framework for kinetic data compression},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {3},
  pages        = {147--168},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.09.002},
  doi          = {10.1016/J.COMGEO.2014.09.002},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/FriedlerM15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FunkeMMW15,
  author       = {Stefan Funke and
                  Theocharis Malamatos and
                  Domagoj Matijevic and
                  Nicola Wolpert},
  title        = {Conic nearest neighbor queries and approximate Voronoi diagrams},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {2},
  pages        = {76--86},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.08.002},
  doi          = {10.1016/J.COMGEO.2014.08.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FunkeMMW15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonS15,
  author       = {Joachim Gudmundsson and
                  Michiel H. M. Smid},
  title        = {Fast algorithms for approximate Fr{\'{e}}chet matching queries
                  in geometric trees},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {6},
  pages        = {479--494},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.02.003},
  doi          = {10.1016/J.COMGEO.2015.02.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GudmundssonS15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Hosono15,
  author       = {Kiyoshi Hosono},
  title        = {On the minimum number of mutually disjoint holes in planar point sets},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {9},
  pages        = {661--672},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.07.001},
  doi          = {10.1016/J.COMGEO.2015.07.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Hosono15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimA15,
  author       = {Sang{-}Sub Kim and
                  Hee{-}Kap Ahn},
  title        = {An improved data stream algorithm for clustering},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {9},
  pages        = {635--645},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.06.003},
  doi          = {10.1016/J.COMGEO.2015.06.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KimA15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KleinS15,
  author       = {Kyle Klein and
                  Subhash Suri},
  title        = {Capture bounds for visibility-based pursuit evasion},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {3},
  pages        = {205--220},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.10.002},
  doi          = {10.1016/J.COMGEO.2014.10.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KleinS15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KynclPRT15,
  author       = {Jan Kyncl and
                  J{\'{a}}nos Pach and
                  Rados Radoicic and
                  G{\'{e}}za T{\'{o}}th},
  title        = {Saturated simple and k-simple topological graphs},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {4},
  pages        = {295--310},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.10.008},
  doi          = {10.1016/J.COMGEO.2014.10.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KynclPRT15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Lopez-Ortiz15,
  author       = {Alejandro L{\'{o}}pez{-}Ortiz},
  title        = {Guest editorial: Special issue on the 25th Canadian Conference on
                  Computational Geometry {(CCCG)}},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {5},
  pages        = {369},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.09.001},
  doi          = {10.1016/J.COMGEO.2014.09.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Lopez-Ortiz15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LubiwP15,
  author       = {Anna Lubiw and
                  Vinayak Pathak},
  title        = {Flip distance between two triangulations of a point set is NP-complete},
  journal      = {Comput. Geom.},
  volume       = {49},
  pages        = {17--23},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.11.001},
  doi          = {10.1016/J.COMGEO.2014.11.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/LubiwP15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MoricP15,
  author       = {Filip Moric and
                  J{\'{a}}nos Pach},
  title        = {Remarks on Schur's conjecture},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {7},
  pages        = {520--527},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.10.007},
  doi          = {10.1016/J.COMGEO.2014.10.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MoricP15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PanahiS15,
  author       = {Fatemeh Panahi and
                  A. Frank van der Stappen},
  title        = {Reprint of: Bounding the locus of the center of mass for a part with
                  shape variation},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {5},
  pages        = {398--406},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.01.001},
  doi          = {10.1016/J.COMGEO.2015.01.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/PanahiS15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RahmatiAKWZ15,
  author       = {Zahed Rahmati and
                  Mohammad Ali Abam and
                  Valerie King and
                  Sue Whitesides and
                  Alireza Zarei},
  title        = {A simple, faster method for kinetic proximity problems},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {4},
  pages        = {342--359},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.12.002},
  doi          = {10.1016/J.COMGEO.2014.12.002},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/RahmatiAKWZ15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ras15,
  author       = {Charl J. Ras},
  title        = {Survivable minimum bottleneck networks},
  journal      = {Comput. Geom.},
  volume       = {50},
  pages        = {17--23},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.06.002},
  doi          = {10.1016/J.COMGEO.2015.06.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Ras15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Raz15,
  author       = {Orit E. Raz},
  title        = {On the zone of the boundary of a convex body},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {4},
  pages        = {333--341},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.12.001},
  doi          = {10.1016/J.COMGEO.2014.12.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Raz15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RusuF15,
  author       = {Adrian Rusu and
                  Andrew J. Fabian},
  title        = {A straight-line order-preserving binary tree drawing algorithm with
                  linear area and arbitrary aspect ratio},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {3},
  pages        = {268--294},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.10.001},
  doi          = {10.1016/J.COMGEO.2014.10.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/RusuF15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SavicS15,
  author       = {Marko Savic and
                  Milos Stojakovic},
  title        = {Linear time algorithm for optimal feed-link placement},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {3},
  pages        = {189--204},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.09.006},
  doi          = {10.1016/J.COMGEO.2014.09.006},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/SavicS15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SchmidtV15,
  author       = {Jens M. Schmidt and
                  Pavel Valtr},
  title        = {Cubic plane graphs on a given point set},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {1},
  pages        = {1--13},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.06.001},
  doi          = {10.1016/J.COMGEO.2014.06.001},
  timestamp    = {Tue, 27 Dec 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SchmidtV15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SharmaBVRT15,
  author       = {Gokarna Sharma and
                  Costas Busch and
                  Ramachandran Vaidyanathan and
                  Suresh Rai and
                  Jerry L. Trahan},
  title        = {Efficient transformations for Klee's measure problem in the streaming
                  model},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {9},
  pages        = {688--702},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.06.007},
  doi          = {10.1016/J.COMGEO.2015.06.007},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/SharmaBVRT15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SheikhiMBD15,
  author       = {Farnaz Sheikhi and
                  Ali Mohades and
                  Mark de Berg and
                  Mansoor Davoodi},
  title        = {Separating bichromatic point sets by L-shapes},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {9},
  pages        = {673--687},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.06.008},
  doi          = {10.1016/J.COMGEO.2015.06.008},
  timestamp    = {Thu, 14 Oct 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/SheikhiMBD15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ShewchukB15,
  author       = {Jonathan Richard Shewchuk and
                  Brielin C. Brown},
  title        = {Fast segment insertion and incremental construction of constrained
                  Delaunay triangulations},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {8},
  pages        = {554--574},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.04.006},
  doi          = {10.1016/J.COMGEO.2015.04.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ShewchukB15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SukW15,
  author       = {Andrew Suk and
                  Bartosz Walczak},
  title        = {New bounds on the maximum number of edges in k-quasi-planar graphs},
  journal      = {Comput. Geom.},
  volume       = {50},
  pages        = {24--33},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.06.001},
  doi          = {10.1016/J.COMGEO.2015.06.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SukW15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Sukilovic15,
  author       = {Tijana Sukilovic},
  title        = {Curvature based shape detection},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {3},
  pages        = {180--188},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.09.005},
  doi          = {10.1016/J.COMGEO.2014.09.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Sukilovic15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Traub15,
  author       = {Cynthia M. Traub},
  title        = {Steiner reducing sets of minimum weight triangulations: Structure
                  and topology},
  journal      = {Comput. Geom.},
  volume       = {49},
  pages        = {24--36},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.04.004},
  doi          = {10.1016/J.COMGEO.2015.04.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Traub15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Viglietta15,
  author       = {Giovanni Viglietta},
  title        = {Reprint of: Face-guarding polyhedra},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {5},
  pages        = {415--428},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.01.003},
  doi          = {10.1016/J.COMGEO.2015.01.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Viglietta15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WangCY15,
  author       = {Cong Wang and
                  Yi{-}Jen Chiang and
                  Chee{-}Keng Yap},
  title        = {On soft predicates in subdivision motion planning},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {8},
  pages        = {589--605},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2015.04.002},
  doi          = {10.1016/J.COMGEO.2015.04.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/WangCY15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Zivaljevic15,
  author       = {Rade T. Zivaljevic},
  title        = {Illumination complexes, {\(\Delta\)}-zonotopes, and the polyhedral
                  curtain theorem},
  journal      = {Comput. Geom.},
  volume       = {48},
  number       = {3},
  pages        = {225--236},
  year         = {2015},
  url          = {https://doi.org/10.1016/j.comgeo.2014.10.003},
  doi          = {10.1016/J.COMGEO.2014.10.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Zivaljevic15.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/0006X14,
  author       = {Lei Xu and
                  Jinhui Xu},
  title        = {Approximating minimum bending energy path in a simple corridor},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {349--366},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.09.001},
  doi          = {10.1016/J.COMGEO.2013.09.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/0006X14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbamDDEG14,
  author       = {Mohammad Ali Abam and
                  Shervin Daneshpajouh and
                  Lasse Deleuran and
                  Shayan Ehsani and
                  Mohammad Ghodsi},
  title        = {Computing homotopic line simplification},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {7},
  pages        = {728--739},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.02.002},
  doi          = {10.1016/J.COMGEO.2014.02.002},
  timestamp    = {Sat, 16 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AbamDDEG14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Abu-AffashCKT14,
  author       = {A. Karim Abu{-}Affash and
                  Paz Carmi and
                  Matthew J. Katz and
                  Yohai Trabelsi},
  title        = {Bottleneck non-crossing matching in the plane},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {447--457},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.10.005},
  doi          = {10.1016/J.COMGEO.2013.10.005},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Abu-AffashCKT14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AckermanFPS14,
  author       = {Eyal Ackerman and
                  Jacob Fox and
                  J{\'{a}}nos Pach and
                  Andrew Suk},
  title        = {On grids in topological graphs},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {7},
  pages        = {710--723},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.02.003},
  doi          = {10.1016/J.COMGEO.2014.02.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AckermanFPS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnCKY14,
  author       = {Hee{-}Kap Ahn and
                  Siu{-}Wing Cheng and
                  Hyuk Jun Kweon and
                  Juyoung Yon},
  title        = {Overlap of convex polytopes under rigid motion},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {1},
  pages        = {15--24},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.08.001},
  doi          = {10.1016/J.COMGEO.2013.08.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnCKY14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerAHHPRUVV14,
  author       = {Oswin Aichholzer and
                  Franz Aurenhammer and
                  Thomas Hackl and
                  Ferran Hurtado and
                  Alexander Pilz and
                  Pedro Ramos and
                  Jorge Urrutia and
                  Pavel Valtr and
                  Birgit Vogtenhuber},
  title        = {On k-convex point sets},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {8},
  pages        = {809--832},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.04.004},
  doi          = {10.1016/J.COMGEO.2014.04.004},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerAHHPRUVV14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerBBBKRTV14,
  author       = {Oswin Aichholzer and
                  Sang Won Bae and
                  Luis Barba and
                  Prosenjit Bose and
                  Matias Korman and
                  Andr{\'{e}} van Renssen and
                  Perouz Taslakian and
                  Sander Verdonschot},
  title        = {Theta-3 is connected},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {9},
  pages        = {910--917},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.05.001},
  doi          = {10.1016/J.COMGEO.2014.05.001},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerBBBKRTV14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMGHHHUV14,
  author       = {Oswin Aichholzer and
                  Ruy Fabila Monroy and
                  Hern{\'{a}}n Gonz{\'{a}}lez{-}Aguilar and
                  Thomas Hackl and
                  Marco A. Heredia and
                  Clemens Huemer and
                  Jorge Urrutia and
                  Birgit Vogtenhuber},
  title        = {4-Holes in point sets},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {6},
  pages        = {644--650},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.12.004},
  doi          = {10.1016/J.COMGEO.2013.12.004},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerMGHHHUV14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMHHPV14,
  author       = {Oswin Aichholzer and
                  Ruy Fabila Monroy and
                  Thomas Hackl and
                  Clemens Huemer and
                  Alexander Pilz and
                  Birgit Vogtenhuber},
  title        = {Lower bounds for the number of small convex k-holes},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {5},
  pages        = {605--613},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.12.002},
  doi          = {10.1016/J.COMGEO.2013.12.002},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerMHHPV14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMP14,
  author       = {Oswin Aichholzer and
                  Tillmann Miltzow and
                  Alexander Pilz},
  title        = {Reprint of: Extreme point and halving edge search in abstract order
                  types},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {518--526},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.11.002},
  doi          = {10.1016/J.COMGEO.2013.11.002},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerMP14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisB14,
  author       = {Greg Aloupis and
                  David Bremner},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {111},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.08.004},
  doi          = {10.1016/J.COMGEO.2013.08.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AloupisB14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisBDGLS14,
  author       = {Greg Aloupis and
                  Prosenjit Bose and
                  Vida Dujmovic and
                  Chris Gray and
                  Stefan Langerman and
                  Bettina Speckmann},
  title        = {Triangulating and guarding realistic polygons},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {296--306},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.03.005},
  doi          = {10.1016/J.COMGEO.2013.03.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AloupisBDGLS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisCCHLO14,
  author       = {Greg Aloupis and
                  Jean Cardinal and
                  S{\'{e}}bastien Collette and
                  Ferran Hurtado and
                  Stefan Langerman and
                  Joseph O'Rourke},
  title        = {Draining a polygon - or - rolling a ball out of a polygon},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {316--328},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2009.08.002},
  doi          = {10.1016/J.COMGEO.2009.08.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AloupisCCHLO14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AngeliniBCFKS14,
  author       = {Patrizio Angelini and
                  Till Bruckdorfer and
                  Marco Chiesa and
                  Fabrizio Frati and
                  Michael Kaufmann and
                  Claudio Squarcella},
  title        = {On the area requirements of Euclidean minimum spanning trees},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {200--213},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2012.10.011},
  doi          = {10.1016/J.COMGEO.2012.10.011},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AngeliniBCFKS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArkinDKMPSY14,
  author       = {Esther M. Arkin and
                  Claudia Dieckmann and
                  Christian Knauer and
                  Joseph S. B. Mitchell and
                  Valentin Polishchuk and
                  Lena Schlipf and
                  Shang Yang},
  title        = {Convex transversals},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {224--239},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2012.10.009},
  doi          = {10.1016/J.COMGEO.2012.10.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ArkinDKMPSY14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AsanoBBKMRS14,
  author       = {Tetsuo Asano and
                  Kevin Buchin and
                  Maike Buchin and
                  Matias Korman and
                  Wolfgang Mulzer and
                  G{\"{u}}nter Rote and
                  Andr{\'{e}} Schulz},
  title        = {Reprint of: Memory-constrained algorithms for simple polygons},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {469--479},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.11.004},
  doi          = {10.1016/J.COMGEO.2013.11.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AsanoBBKMRS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AshokAG14,
  author       = {Pradeesha Ashok and
                  Umair Azmi and
                  Sathish Govindarajan},
  title        = {Small strong epsilon nets},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {9},
  pages        = {899--909},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.05.002},
  doi          = {10.1016/J.COMGEO.2014.05.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AshokAG14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bae14,
  author       = {Sang Won Bae},
  title        = {Tight bound and improved algorithm for farthest-color Voronoi diagrams
                  of line segments},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {8},
  pages        = {779--788},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.04.005},
  doi          = {10.1016/J.COMGEO.2014.04.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Bae14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Balko14,
  author       = {Martin Balko},
  title        = {Reprint of: Grid representations and the chromatic number},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {480--492},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.11.006},
  doi          = {10.1016/J.COMGEO.2013.11.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Balko14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BanikBD14,
  author       = {Aritra Banik and
                  Bhaswar B. Bhattacharya and
                  Sandip Das},
  title        = {Minimum enclosing circle of a set of fixed points and a mobile point},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {9},
  pages        = {891--898},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.04.006},
  doi          = {10.1016/J.COMGEO.2014.04.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BanikBD14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaranyR14,
  author       = {Imre B{\'{a}}r{\'{a}}ny and
                  Edgardo Rold{\'{a}}n{-}Pensado},
  title        = {Longest convex lattice chains},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {367--376},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.09.002},
  doi          = {10.1016/J.COMGEO.2013.09.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaranyR14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarbaKLS14,
  author       = {Luis Barba and
                  Matias Korman and
                  Stefan Langerman and
                  Rodrigo I. Silveira},
  title        = {Computing a visibility polygon using few variables},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {9},
  pages        = {918--926},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.04.001},
  doi          = {10.1016/J.COMGEO.2014.04.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BarbaKLS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarequetG14,
  author       = {Gill Barequet and
                  Alex Goryachev},
  title        = {Offset polygon and annulus placement problems},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {407--434},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.10.003},
  doi          = {10.1016/J.COMGEO.2013.10.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BarequetG14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergSW14,
  author       = {Mark de Berg and
                  Bettina Speckmann and
                  Vincent van der Weele},
  title        = {Treemaps with bounded aspect ratio},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {6},
  pages        = {683--693},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.12.008},
  doi          = {10.1016/J.COMGEO.2013.12.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BergSW14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BhattacharyaS14,
  author       = {Binay K. Bhattacharya and
                  Qiaosheng Shi},
  title        = {Improved algorithms to network p-center location problems},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {307--315},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2009.07.003},
  doi          = {10.1016/J.COMGEO.2009.07.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BhattacharyaS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlV14,
  author       = {Therese Biedl and
                  Lesvia Elena Ruiz Vel{\'{a}}zquez},
  title        = {Orthogonal cartograms with at most 12 corners per face},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {282--294},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.08.005},
  doi          = {10.1016/J.COMGEO.2013.08.005},
  timestamp    = {Thu, 11 Aug 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiedlV14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazMS14,
  author       = {Ahmad Biniaz and
                  Anil Maheshwari and
                  Michiel H. M. Smid},
  title        = {An optimal algorithm for the Euclidean bottleneck full Steiner tree
                  problem},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {377--380},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.10.001},
  doi          = {10.1016/J.COMGEO.2013.10.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiniazMS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BokowskiP14,
  author       = {J{\"{u}}rgen Bokowski and
                  Vincent Pilaud},
  title        = {Enumerating topological (n\({}_{\mbox{k}}\))-configurations},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {175--186},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2012.10.002},
  doi          = {10.1016/J.COMGEO.2012.10.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BokowskiP14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseC14,
  author       = {Prosenjit Bose and
                  Jean{-}Lou De Carufel},
  title        = {Minimum-area enclosing triangle with a fixed angle},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {1},
  pages        = {90--109},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.07.002},
  doi          = {10.1016/J.COMGEO.2013.07.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseC14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseJRSV14,
  author       = {Prosenjit Bose and
                  Dana Jansens and
                  Andr{\'{e}} van Renssen and
                  Maria Saumell and
                  Sander Verdonschot},
  title        = {Making triangulations 4-connected using flips},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {187--197},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2012.10.012},
  doi          = {10.1016/J.COMGEO.2012.10.012},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseJRSV14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BotanaA14,
  author       = {Francisco Botana and
                  Miguel A. Ab{\'{a}}nades},
  title        = {Automatic deduction in (dynamic) geometry: Loci computation},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {1},
  pages        = {75--89},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.07.001},
  doi          = {10.1016/J.COMGEO.2013.07.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BotanaA14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bourrieres14,
  author       = {Jean{-}Paul Bourri{\`{e}}res},
  title        = {The Minkowski sum of simplices in 3-dimensional space: An analytical
                  description},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {8},
  pages        = {856--867},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.04.002},
  doi          = {10.1016/J.COMGEO.2014.04.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Bourrieres14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Brandenburg14,
  author       = {Franz{-}Josef Brandenburg},
  title        = {Upward planar drawings on the standing and the rolling cylinders},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {1},
  pages        = {25--41},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.08.003},
  doi          = {10.1016/J.COMGEO.2013.08.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Brandenburg14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CalinescuK14,
  author       = {Gruia C{\u{a}}linescu and
                  Howard J. Karloff},
  title        = {Sequential dependency computation via geometric data structures},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {141--148},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.08.009},
  doi          = {10.1016/J.COMGEO.2013.08.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CalinescuK14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarufelGMOS14,
  author       = {Jean{-}Lou De Carufel and
                  Carsten Grimm and
                  Anil Maheshwari and
                  Megan Owen and
                  Michiel H. M. Smid},
  title        = {A note on the unsolvability of the weighted region shortest path problem},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {7},
  pages        = {724--727},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.02.004},
  doi          = {10.1016/J.COMGEO.2014.02.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CarufelGMOS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarufelGMSS14,
  author       = {Jean{-}Lou De Carufel and
                  Amin Gheibi and
                  Anil Maheshwari and
                  J{\"{o}}rg{-}R{\"{u}}diger Sack and
                  Christian Scheffer},
  title        = {Similarity of polygonal curves in the presence of outliers},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {5},
  pages        = {625--641},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.01.002},
  doi          = {10.1016/J.COMGEO.2014.01.002},
  timestamp    = {Thu, 14 Oct 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CarufelGMSS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanG14,
  author       = {Timothy M. Chan and
                  Elyot Grant},
  title        = {Exact algorithms and APX-hardness results for geometric packing and
                  covering problems},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {112--124},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2012.04.001},
  doi          = {10.1016/J.COMGEO.2012.04.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChanG14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanP14,
  author       = {Timothy M. Chan and
                  Vinayak Pathak},
  title        = {Streaming and dynamic algorithms for minimum enclosing balls in high
                  dimensions},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {240--247},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.05.007},
  doi          = {10.1016/J.COMGEO.2013.05.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChanP14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DehlingerD14,
  author       = {Christophe Dehlinger and
                  Jean{-}Fran{\c{c}}ois Dufourd},
  title        = {Formal specification and proofs for the topology and classification
                  of combinatorial surfaces},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {9},
  pages        = {869--890},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.04.007},
  doi          = {10.1016/J.COMGEO.2014.04.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DehlingerD14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DehneI14,
  author       = {Frank Dehne and
                  John Iacono},
  title        = {Foreword},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {199},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.05.006},
  doi          = {10.1016/J.COMGEO.2013.05.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DehneI14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DellingGNPR14,
  author       = {Daniel Delling and
                  Andreas Gemsa and
                  Martin N{\"{o}}llenburg and
                  Thomas Pajor and
                  Ignaz Rutter},
  title        = {On d-regular schematization of embedded paths},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {381--406},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.10.002},
  doi          = {10.1016/J.COMGEO.2013.10.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DellingGNPR14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineDILNO14,
  author       = {Erik D. Demaine and
                  Martin L. Demaine and
                  Jin{-}ichi Itoh and
                  Anna Lubiw and
                  Chie Nara and
                  Joseph O'Rourke},
  title        = {Reprint of: Refold rigidity of convex polyhedra},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {507--517},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.11.001},
  doi          = {10.1016/J.COMGEO.2013.11.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DemaineDILNO14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DidimoL14,
  author       = {Walter Didimo and
                  Giuseppe Liotta},
  title        = {Special Issue on the 28th European Workshop on Computational Geometry,
                  Guest Editors' Foreword},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {459},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.03.003},
  doi          = {10.1016/J.COMGEO.2013.03.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DidimoL14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuMZ14,
  author       = {Adrian Dumitrescu and
                  Joseph S. B. Mitchell and
                  Pawel Zylinski},
  title        = {Watchman routes for lines and line segments},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {4},
  pages        = {527--538},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.11.008},
  doi          = {10.1016/J.COMGEO.2013.11.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DumitrescuMZ14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FarzanGN14,
  author       = {Arash Farzan and
                  Travis Gagie and
                  Gonzalo Navarro},
  title        = {Entropy-bounded representation of point grids},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {1},
  pages        = {1--14},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.08.002},
  doi          = {10.1016/J.COMGEO.2013.08.002},
  timestamp    = {Wed, 28 Feb 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FarzanGN14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FelsnerKV14,
  author       = {Stefan Felsner and
                  Michael Kaufmann and
                  Pavel Valtr},
  title        = {Bend-optimal orthogonal graph drawing in the general position model},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {460--468},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.03.002},
  doi          = {10.1016/J.COMGEO.2013.03.002},
  timestamp    = {Tue, 27 Dec 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FelsnerKV14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FoteinosCC14,
  author       = {Panagiotis A. Foteinos and
                  Andrey N. Chernikov and
                  Nikos Chrisochoides},
  title        = {Guaranteed quality tetrahedral Delaunay meshing for medical images},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {4},
  pages        = {539--562},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.11.009},
  doi          = {10.1016/J.COMGEO.2013.11.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FoteinosCC14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GeissKPR14,
  author       = {Darius Gei{\ss} and
                  Rolf Klein and
                  Rainer Penninger and
                  G{\"{u}}nter Rote},
  title        = {Reprint of: Optimally solving a transportation problem using Voronoi
                  diagrams},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {499--506},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.11.003},
  doi          = {10.1016/J.COMGEO.2013.11.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GeissKPR14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GhodsiMBSZ14,
  author       = {Mohammad Ghodsi and
                  Anil Maheshwari and
                  Mostafa Nouri Baygi and
                  J{\"{o}}rg{-}R{\"{u}}diger Sack and
                  Hamid Zarrabi{-}Zadeh},
  title        = {{\(\alpha\)}-Visibility},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {435--446},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.10.004},
  doi          = {10.1016/J.COMGEO.2013.10.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GhodsiMBSZ14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GilbersK14,
  author       = {Alexander Gilbers and
                  Rolf Klein},
  title        = {A new upper bound for the VC-dimension of visibility regions},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {1},
  pages        = {61--74},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.08.012},
  doi          = {10.1016/J.COMGEO.2013.08.012},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GilbersK14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GuptaJKS14,
  author       = {Prosenjit Gupta and
                  Ravi Janardan and
                  Yokesh Kumar and
                  Michiel H. M. Smid},
  title        = {Data structures for range-aggregate extent queries},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {329--347},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2009.08.001},
  doi          = {10.1016/J.COMGEO.2009.08.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GuptaJKS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HarrenJPS14,
  author       = {Rolf Harren and
                  Klaus Jansen and
                  Lars Pr{\"{a}}del and
                  Rob van Stee},
  title        = {A {(5/3} + {\(\epsilon\)})-approximation for strip packing},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {248--267},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.08.008},
  doi          = {10.1016/J.COMGEO.2013.08.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HarrenJPS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HeM14,
  author       = {Meng He and
                  J. Ian Munro},
  title        = {Space efficient data structures for dynamic orthogonal range counting},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {268--281},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.08.007},
  doi          = {10.1016/J.COMGEO.2013.08.007},
  timestamp    = {Sun, 12 Nov 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HeM14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HoffmannW14,
  author       = {Michael Hoffmann and
                  Emo Welzl},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {6},
  pages        = {643},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.12.003},
  doi          = {10.1016/J.COMGEO.2013.12.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HoffmannW14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Jiang0G14,
  author       = {Xiaoye Jiang and
                  Jian Sun and
                  Leonidas J. Guibas},
  title        = {A Fourier-theoretic approach for inferring symmetries},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {164--174},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2012.10.001},
  doi          = {10.1016/J.COMGEO.2012.10.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Jiang0G14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KamousiCS14,
  author       = {Pegah Kamousi and
                  Timothy M. Chan and
                  Subhash Suri},
  title        = {Closest pair and the post office problem for stochastic points},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {214--223},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2012.10.010},
  doi          = {10.1016/J.COMGEO.2012.10.010},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KamousiCS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KeszeghP14,
  author       = {Bal{\'{a}}zs Keszegh and
                  D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi},
  title        = {Octants are cover-decomposable into many coverings},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {5},
  pages        = {585--588},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.12.001},
  doi          = {10.1016/J.COMGEO.2013.12.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KeszeghP14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KnauerMW14,
  author       = {Kolja B. Knauer and
                  Piotr Micek and
                  Bartosz Walczak},
  title        = {Outerplanar graph drawings with few slopes},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {5},
  pages        = {614--624},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.01.003},
  doi          = {10.1016/J.COMGEO.2014.01.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KnauerMW14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Mchedlidze14,
  author       = {Tamara Mchedlidze},
  title        = {Reprint of: Upward planar embedding of an n-vertex oriented path on
                  O(n\({}^{\mbox{2}}\)) points},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {3},
  pages        = {493--498},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.11.007},
  doi          = {10.1016/J.COMGEO.2013.11.007},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Mchedlidze14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MitchellPS14,
  author       = {Joseph S. B. Mitchell and
                  Valentin Polishchuk and
                  Mikko Sysikaski},
  title        = {Minimum-link paths revisited},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {6},
  pages        = {651--667},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.12.005},
  doi          = {10.1016/J.COMGEO.2013.12.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MitchellPS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Morin14,
  author       = {Pat Morin},
  title        = {Guest Editor's Introduction},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {295},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.03.006},
  doi          = {10.1016/J.COMGEO.2013.03.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Morin14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MustafaTW14,
  author       = {Nabil H. Mustafa and
                  Hans Raj Tiwary and
                  Daniel Werner},
  title        = {A proof of the Oja depth conjecture in the plane},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {6},
  pages        = {668--674},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.12.006},
  doi          = {10.1016/J.COMGEO.2013.12.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MustafaTW14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/NivaschPT14,
  author       = {Gabriel Nivasch and
                  J{\'{a}}nos Pach and
                  G{\'{a}}bor Tardos},
  title        = {The visible perimeter of an arrangement of disks},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {1},
  pages        = {42--51},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.08.006},
  doi          = {10.1016/J.COMGEO.2013.08.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/NivaschPT14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ORourkeV14,
  author       = {Joseph O'Rourke and
                  Costin V{\^{\i}}lcu},
  title        = {Development of curves on polyhedra via conical existence},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {149--163},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.08.010},
  doi          = {10.1016/J.COMGEO.2013.08.010},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ORourkeV14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/OlaverriHHT14,
  author       = {Alfredo Garc{\'{\i}}a Olaverri and
                  Clemens Huemer and
                  Ferran Hurtado and
                  Javier Tejel},
  title        = {Compatible spanning trees},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {5},
  pages        = {563--584},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.12.009},
  doi          = {10.1016/J.COMGEO.2013.12.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/OlaverriHHT14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PanahiS14,
  author       = {Fatemeh Panahi and
                  A. Frank van der Stappen},
  title        = {Bounding the locus of the center of mass for a part with shape variation},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {8},
  pages        = {847--855},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.04.008},
  doi          = {10.1016/J.COMGEO.2014.04.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/PanahiS14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Pilz14,
  author       = {Alexander Pilz},
  title        = {Flip distance between triangulations of a planar point set is APX-hard},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {5},
  pages        = {589--604},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.01.001},
  doi          = {10.1016/J.COMGEO.2014.01.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Pilz14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SchefferV14,
  author       = {Christian Scheffer and
                  Jan Vahrenhold},
  title        = {Approximating geodesic distances on 2-manifolds in R\({}^{\mbox{3}}\)},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {2},
  pages        = {125--140},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2012.05.001},
  doi          = {10.1016/J.COMGEO.2012.05.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SchefferV14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SchefferV14a,
  author       = {Christian Scheffer and
                  Jan Vahrenhold},
  title        = {Approximating geodesic distances on 2-manifolds in R\({}^{\mbox{3}}\):
                  The weighted case},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {8},
  pages        = {789--808},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.04.003},
  doi          = {10.1016/J.COMGEO.2014.04.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SchefferV14a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ShawiGL14,
  author       = {Radwa El Shawi and
                  Joachim Gudmundsson and
                  Christos Levcopoulos},
  title        = {Quickest path queries on transportation network},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {7},
  pages        = {695--709},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.01.004},
  doi          = {10.1016/J.COMGEO.2014.01.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ShawiGL14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Shewchuk14,
  author       = {Jonathan Richard Shewchuk},
  title        = {Reprint of: Delaunay refinement algorithms for triangular mesh generation},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {7},
  pages        = {741--778},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.02.005},
  doi          = {10.1016/J.COMGEO.2014.02.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Shewchuk14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Sugihara14,
  author       = {Kokichi Sugihara},
  title        = {Design of solids for antigravity motion illusion},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {6},
  pages        = {675--682},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.12.007},
  doi          = {10.1016/J.COMGEO.2013.12.007},
  timestamp    = {Tue, 04 Feb 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Sugihara14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Viglietta14,
  author       = {Giovanni Viglietta},
  title        = {Face-guarding polyhedra},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {8},
  pages        = {833--846},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2014.04.009},
  doi          = {10.1016/J.COMGEO.2014.04.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Viglietta14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WalzerAU14,
  author       = {Stefan Walzer and
                  Maria Axenovich and
                  Torsten Ueckerdt},
  title        = {Packing polyominoes clumsily},
  journal      = {Comput. Geom.},
  volume       = {47},
  number       = {1},
  pages        = {52--60},
  year         = {2014},
  url          = {https://doi.org/10.1016/j.comgeo.2013.08.011},
  doi          = {10.1016/J.COMGEO.2013.08.011},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/WalzerAU14.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbamCFS13,
  author       = {Mohammad Ali Abam and
                  Paz Carmi and
                  Mohammad Farshi and
                  Michiel H. M. Smid},
  title        = {On the power of the semi-separated pair decomposition},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {631--639},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.02.003},
  doi          = {10.1016/J.COMGEO.2013.02.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AbamCFS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AcarCHT13,
  author       = {Umut A. Acar and
                  Andrew Cotter and
                  Beno{\^{\i}}t Hudson and
                  Duru T{\"{u}}rkoglu},
  title        = {Dynamic well-spaced point sets},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {756--773},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.11.007},
  doi          = {10.1016/J.COMGEO.2012.11.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AcarCHT13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AckermanGP13,
  author       = {Eyal Ackerman and
                  Tsachik Gelander and
                  Rom Pinchasi},
  title        = {Ice-creams and wedge graphs},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {213--218},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.07.003},
  doi          = {10.1016/J.COMGEO.2012.07.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AckermanGP13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AckermanPSS13,
  author       = {Eyal Ackerman and
                  Rom Pinchasi and
                  Ludmila Scharf and
                  Marc Scherfenberg},
  title        = {On inducing polygons and related problems},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {7},
  pages        = {861--878},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2011.06.003},
  doi          = {10.1016/J.COMGEO.2011.06.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AckermanPSS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Adamatzky13,
  author       = {Andrew Adamatzky},
  title        = {On growing connected {\(\beta\)}-skeletons},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {805--816},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.11.009},
  doi          = {10.1016/J.COMGEO.2012.11.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Adamatzky13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AgarwalAG0Y13,
  author       = {Pankaj K. Agarwal and
                  Lars Arge and
                  Sathish Govindarajan and
                  Jun Yang and
                  Ke Yi},
  title        = {Efficient external memory structures for range-aggregate queries},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {358--370},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.10.003},
  doi          = {10.1016/J.COMGEO.2012.10.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AgarwalAG0Y13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AgarwalAS13,
  author       = {Pankaj K. Agarwal and
                  Rinat Ben Avraham and
                  Micha Sharir},
  title        = {The 2-center problem in three dimensions},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {734--746},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.11.005},
  doi          = {10.1016/J.COMGEO.2012.11.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AgarwalAS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhipasaogluT13,
  author       = {Selin Damla Ahipasaoglu and
                  Michael J. Todd},
  title        = {A modified Frank-Wolfe algorithm for computing minimum-area enclosing
                  ellipsoidal cylinders: Theory and algorithms},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {5},
  pages        = {494--519},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2011.11.004},
  doi          = {10.1016/J.COMGEO.2011.11.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhipasaogluT13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBKLSV13,
  author       = {Hee{-}Kap Ahn and
                  Sang Won Bae and
                  Christian Knauer and
                  Mira Lee and
                  Chan{-}Su Shin and
                  Antoine Vigneron},
  title        = {Realistic roofs over a rectilinear polygon},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {9},
  pages        = {1042--1055},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.06.002},
  doi          = {10.1016/J.COMGEO.2013.06.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnBKLSV13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnCR13,
  author       = {Hee{-}Kap Ahn and
                  Siu{-}Wing Cheng and
                  Iris Reinbacher},
  title        = {Maximum overlap of convex polytopes under translation},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {5},
  pages        = {552--565},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2011.11.003},
  doi          = {10.1016/J.COMGEO.2011.11.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnCR13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnKKSSV13,
  author       = {Hee{-}Kap Ahn and
                  Sang{-}Sub Kim and
                  Christian Knauer and
                  Lena Schlipf and
                  Chan{-}Su Shin and
                  Antoine Vigneron},
  title        = {Covering and piercing disks with two centers},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {253--262},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.09.002},
  doi          = {10.1016/J.COMGEO.2012.09.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnKKSSV13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerHHHPSSV13,
  author       = {Oswin Aichholzer and
                  Thomas Hackl and
                  Michael Hoffmann and
                  Clemens Huemer and
                  Attila P{\'{o}}r and
                  Francisco Santos and
                  Bettina Speckmann and
                  Birgit Vogtenhuber},
  title        = {Maximizing maximal angles for plane straight-line graphs},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {1},
  pages        = {17--28},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.03.002},
  doi          = {10.1016/J.COMGEO.2012.03.002},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerHHHPSSV13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMHKPRV13,
  author       = {Oswin Aichholzer and
                  Ruy Fabila Monroy and
                  Thomas Hackl and
                  Marc J. van Kreveld and
                  Alexander Pilz and
                  Pedro Ramos and
                  Birgit Vogtenhuber},
  title        = {Blocking Delaunay triangulations},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {2},
  pages        = {154--159},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.02.005},
  doi          = {10.1016/J.COMGEO.2012.02.005},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerMHKPRV13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMP13,
  author       = {Oswin Aichholzer and
                  Tillmann Miltzow and
                  Alexander Pilz},
  title        = {Extreme point and halving edge search in abstract order types},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {8},
  pages        = {970--978},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.05.001},
  doi          = {10.1016/J.COMGEO.2013.05.001},
  timestamp    = {Tue, 04 Feb 2020 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerMP13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisBDDFIW13,
  author       = {Greg Aloupis and
                  Nadia M. Benbernou and
                  Mirela Damian and
                  Erik D. Demaine and
                  Robin Y. Flatland and
                  John Iacono and
                  Stefanie Wuhrer},
  title        = {Efficient reconfiguration of lattice-based modular robots},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {8},
  pages        = {917--928},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.03.004},
  doi          = {10.1016/J.COMGEO.2013.03.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AloupisBDDFIW13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisCCDDDMHHLSST13,
  author       = {Greg Aloupis and
                  Jean Cardinal and
                  S{\'{e}}bastien Collette and
                  Erik D. Demaine and
                  Martin L. Demaine and
                  Muriel Dulieu and
                  Ruy Fabila Monroy and
                  Vi Hart and
                  Ferran Hurtado and
                  Stefan Langerman and
                  Maria Saumell and
                  Carlos Seara and
                  Perouz Taslakian},
  title        = {Non-crossing matchings of points with geometric objects},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {1},
  pages        = {78--92},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.04.005},
  doi          = {10.1016/J.COMGEO.2012.04.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AloupisCCDDDMHHLSST13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisDFKORW13,
  author       = {Greg Aloupis and
                  Mirela Damian and
                  Robin Y. Flatland and
                  Matias Korman and
                  {\"{O}}zg{\"{u}}r {\"{O}}zkan and
                  David Rappaport and
                  Stefanie Wuhrer},
  title        = {Establishing strong connectivity using optimal radius half-disk antennas},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {328--339},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.09.008},
  doi          = {10.1016/J.COMGEO.2012.09.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AloupisDFKORW13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArnaudonN13,
  author       = {Marc Arnaudon and
                  Frank Nielsen},
  title        = {On approximating the Riemannian 1-center},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {1},
  pages        = {93--104},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.04.007},
  doi          = {10.1016/J.COMGEO.2012.04.007},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ArnaudonN13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovD13,
  author       = {Boris Aronov and
                  Muriel Dulieu},
  title        = {How to cover a point set with a V-shape of minimum width},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {298--309},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.09.006},
  doi          = {10.1016/J.COMGEO.2012.09.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AronovD13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovDH13,
  author       = {Boris Aronov and
                  Muriel Dulieu and
                  Ferran Hurtado},
  title        = {Witness Gabriel graphs},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {7},
  pages        = {894--908},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2011.06.004},
  doi          = {10.1016/J.COMGEO.2011.06.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AronovDH13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AsanoBBKMRS13,
  author       = {Tetsuo Asano and
                  Kevin Buchin and
                  Maike Buchin and
                  Matias Korman and
                  Wolfgang Mulzer and
                  G{\"{u}}nter Rote and
                  Andr{\'{e}} Schulz},
  title        = {Memory-constrained algorithms for simple polygons},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {8},
  pages        = {959--969},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.04.005},
  doi          = {10.1016/J.COMGEO.2013.04.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AsanoBBKMRS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AschnerKM13,
  author       = {Rom Aschner and
                  Matthew J. Katz and
                  Gila Morgenstern},
  title        = {Symmetric connectivity with directional antennas},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {9},
  pages        = {1017--1026},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.06.003},
  doi          = {10.1016/J.COMGEO.2013.06.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AschnerKM13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AttaliLS13,
  author       = {Dominique Attali and
                  Andr{\'{e}} Lieutier and
                  David Salinas},
  title        = {Vietoris-Rips complexes also provide topologically correct reconstructions
                  of sampled shapes},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {4},
  pages        = {448--465},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.02.009},
  doi          = {10.1016/J.COMGEO.2012.02.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AttaliLS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AugustineDMNRS13,
  author       = {John Augustine and
                  Sandip Das and
                  Anil Maheshwari and
                  Subhas C. Nandy and
                  Sasanka Roy and
                  Swami Sarvattomananda},
  title        = {Localized geometric query problems},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {340--357},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.09.009},
  doi          = {10.1016/J.COMGEO.2012.09.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AugustineDMNRS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AvisMM13,
  author       = {David Avis and
                  Hiroyuki Miyata and
                  Sonoko Moriyama},
  title        = {Families of polytopal digraphs that do not satisfy the shelling property},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {382--393},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.10.005},
  doi          = {10.1016/J.COMGEO.2012.10.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AvisMM13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Balko13,
  author       = {Martin Balko},
  title        = {Grid representations and the chromatic number},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {8},
  pages        = {990--1002},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.05.003},
  doi          = {10.1016/J.COMGEO.2013.05.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Balko13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaloghGS13,
  author       = {J{\'{o}}zsef Balogh and
                  Hern{\'{a}}n Gonz{\'{a}}lez{-}Aguilar and
                  Gelasio Salazar},
  title        = {Large convex holes in random point sets},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {725--733},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.11.004},
  doi          = {10.1016/J.COMGEO.2012.11.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaloghGS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bar-YehudaR13,
  author       = {Reuven Bar{-}Yehuda and
                  Dror Rawitz},
  title        = {A note on multicovering with disks},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {394--399},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.10.006},
  doi          = {10.1016/J.COMGEO.2012.10.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Bar-YehudaR13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaranyS13,
  author       = {Imre B{\'{a}}r{\'{a}}ny and
                  William L. Steiger},
  title        = {On the variance of random polygons},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {2},
  pages        = {173--180},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.003},
  doi          = {10.1016/J.COMGEO.2012.01.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaranyS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarequetBCDDILSSTW13,
  author       = {Gill Barequet and
                  Nadia M. Benbernou and
                  David Charlton and
                  Erik D. Demaine and
                  Martin L. Demaine and
                  Mashhood Ishaque and
                  Anna Lubiw and
                  Andr{\'{e}} Schulz and
                  Diane L. Souvaine and
                  Godfried T. Toussaint and
                  Andrew Winslow},
  title        = {Bounded-degree polyhedronization of point sets},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {2},
  pages        = {148--153},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.02.008},
  doi          = {10.1016/J.COMGEO.2012.02.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BarequetBCDDILSSTW13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaygiG13,
  author       = {Mostafa Nouri Baygi and
                  Mohammad Ghodsi},
  title        = {Space/query-time tradeoff for computing the visibility polygon},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {371--381},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.10.004},
  doi          = {10.1016/J.COMGEO.2012.10.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaygiG13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ben-NerSS13,
  author       = {Moria Ben{-}Ner and
                  Andr{\'{e}} Schulz and
                  Adam Sheffer},
  title        = {On numbers of pseudo-triangulations},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {688--699},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.11.002},
  doi          = {10.1016/J.COMGEO.2012.11.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Ben-NerSS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregDLPSU13,
  author       = {Sergey Bereg and
                  Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
                  Dolores Lara and
                  Pablo P{\'{e}}rez{-}Lantero and
                  Carlos Seara and
                  Jorge Urrutia},
  title        = {On the coarseness of bicolored point sets},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {1},
  pages        = {65--77},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.04.003},
  doi          = {10.1016/J.COMGEO.2012.04.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BeregDLPSU13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergCG13,
  author       = {Mark de Berg and
                  Atlas F. Cook IV and
                  Joachim Gudmundsson},
  title        = {Fast Fr{\'{e}}chet queries},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {747--755},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.11.006},
  doi          = {10.1016/J.COMGEO.2012.11.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BergCG13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlV13,
  author       = {Therese Biedl and
                  Lesvia Elena Ruiz Vel{\'{a}}zquez},
  title        = {Drawing planar 3-trees with given face areas},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {276--285},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.09.004},
  doi          = {10.1016/J.COMGEO.2012.09.004},
  timestamp    = {Thu, 11 Aug 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiedlV13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BokowskiS13,
  author       = {J{\"{u}}rgen Bokowski and
                  Lars Schewe},
  title        = {On the finite set of missing geometric configurations (\emph{n}\({}_{\mbox{4}}\))},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {5},
  pages        = {532--540},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2011.11.001},
  doi          = {10.1016/J.COMGEO.2011.11.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BokowskiS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCCCKL13,
  author       = {Prosenjit Bose and
                  Paz Carmi and
                  Lilach Chaitman{-}Yerushalmi and
                  S{\'{e}}bastien Collette and
                  Matthew J. Katz and
                  Stefan Langerman},
  title        = {Stable Roommates Spanner},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {2},
  pages        = {120--130},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.07.001},
  doi          = {10.1016/J.COMGEO.2012.07.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseCCCKL13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCHKLSS13,
  author       = {Prosenjit Bose and
                  S{\'{e}}bastien Collette and
                  Ferran Hurtado and
                  Matias Korman and
                  Stefan Langerman and
                  Vera Sacrist{\'{a}}n and
                  Maria Saumell},
  title        = {Some properties of k-Delaunay and k-Gabriel graphs},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {2},
  pages        = {131--139},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.04.006},
  doi          = {10.1016/J.COMGEO.2012.04.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseCHKLSS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseDDHM13,
  author       = {Prosenjit Bose and
                  Karim Dou{\"{\i}}eb and
                  Vida Dujmovic and
                  John Howat and
                  Pat Morin},
  title        = {Fast local searches and updates in bounded universes},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {2},
  pages        = {181--189},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.002},
  doi          = {10.1016/J.COMGEO.2012.01.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseDDHM13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseS13,
  author       = {Prosenjit Bose and
                  Michiel H. M. Smid},
  title        = {On plane geometric spanners: {A} survey and open problems},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {7},
  pages        = {818--830},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.04.002},
  doi          = {10.1016/J.COMGEO.2013.04.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrandtsDHK13,
  author       = {Jan Brandts and
                  Sander Dijkhuis and
                  Vincent de Haan and
                  Michal Kr{\'{\i}}zek},
  title        = {There are only two nonobtuse binary triangulations of the unit n-cube},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {286--297},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.09.005},
  doi          = {10.1016/J.COMGEO.2012.09.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BrandtsDHK13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BremnerDIM13,
  author       = {David Bremner and
                  Antoine Deza and
                  Hiroshi Imai and
                  Sonoko Moriyama},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {5},
  pages        = {493},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.009},
  doi          = {10.1016/J.COMGEO.2012.01.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BremnerDIM13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloDP13,
  author       = {Sergio Cabello and
                  Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
                  Pablo P{\'{e}}rez{-}Lantero},
  title        = {Covering a bichromatic point set with two disjoint monochromatic disks},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {203--212},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.06.002},
  doi          = {10.1016/J.COMGEO.2012.06.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CabelloDP13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CanoTU13,
  author       = {Javier Cano and
                  Csaba D. T{\'{o}}th and
                  Jorge Urrutia},
  title        = {A tight bound for point guards in piecewise convex art galleries},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {8},
  pages        = {945--958},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.04.004},
  doi          = {10.1016/J.COMGEO.2013.04.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CanoTU13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CardinalK13,
  author       = {Jean Cardinal and
                  Matias Korman},
  title        = {Coloring planar homothets and three-dimensional hypergraphs},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {9},
  pages        = {1027--1035},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.06.004},
  doi          = {10.1016/J.COMGEO.2013.06.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CardinalK13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenDILM13,
  author       = {Dan Chen and
                  Olivier Devillers and
                  John Iacono and
                  Stefan Langerman and
                  Pat Morin},
  title        = {Oja centers and centers of gravity},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {2},
  pages        = {140--147},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.04.004},
  doi          = {10.1016/J.COMGEO.2012.04.004},
  timestamp    = {Sun, 25 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChenDILM13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenK13,
  author       = {Chao Chen and
                  Michael Kerber},
  title        = {An output-sensitive algorithm for persistent homology},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {4},
  pages        = {435--447},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.02.010},
  doi          = {10.1016/J.COMGEO.2012.02.010},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChenK13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenM13,
  author       = {Dan Chen and
                  Pat Morin},
  title        = {Approximating majority depth},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {9},
  pages        = {1059--1064},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.06.005},
  doi          = {10.1016/J.COMGEO.2013.06.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChenM13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenMW13,
  author       = {Dan Chen and
                  Pat Morin and
                  Uli Wagner},
  title        = {Absolute approximation of Tukey depth: Theory and experiments},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {5},
  pages        = {566--573},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.03.001},
  doi          = {10.1016/J.COMGEO.2012.03.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChenMW13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChengL13,
  author       = {Siu{-}Wing Cheng and
                  Chi{-}Kit Lam},
  title        = {Shape matching under rigid motion},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {591--603},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.01.002},
  doi          = {10.1016/J.COMGEO.2013.01.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChengL13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChepoiF13,
  author       = {Victor Chepoi and
                  Stefan Felsner},
  title        = {Approximating hitting sets of axis-parallel rectangles intersecting
                  a monotone curve},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {9},
  pages        = {1036--1041},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.05.008},
  doi          = {10.1016/J.COMGEO.2013.05.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChepoiF13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChepoiM13,
  author       = {Victor Chepoi and
                  Daniela Maftuleac},
  title        = {Shortest path problem in rectangular complexes of global nonpositive
                  curvature},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {1},
  pages        = {51--64},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.04.002},
  doi          = {10.1016/J.COMGEO.2012.04.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChepoiM13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ColletteL13,
  author       = {S{\'{e}}bastien Collette and
                  Stefan Langerman},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {7},
  pages        = {817},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.04.001},
  doi          = {10.1016/J.COMGEO.2013.04.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ColletteL13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeMNS13,
  author       = {Minati De and
                  Anil Maheshwari and
                  Subhas C. Nandy and
                  Michiel H. M. Smid},
  title        = {An in-place min-max priority search tree},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {310--327},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.09.007},
  doi          = {10.1016/J.COMGEO.2012.09.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DeMNS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineDILNO13,
  author       = {Erik D. Demaine and
                  Martin L. Demaine and
                  Jin{-}ichi Itoh and
                  Anna Lubiw and
                  Chie Nara and
                  Joseph O'Rourke},
  title        = {Refold rigidity of convex polyhedra},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {8},
  pages        = {979--989},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.05.002},
  doi          = {10.1016/J.COMGEO.2013.05.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DemaineDILNO13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DoradoPT13,
  author       = {Rub{\'{e}}n Dorado and
                  B. Pivec and
                  Eloisa Torres{-}Jim{\'{e}}nez},
  title        = {Advancing front circle packing to approximate conformal strips},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {1},
  pages        = {105--118},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.05.002},
  doi          = {10.1016/J.COMGEO.2012.05.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DoradoPT13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DujmovicELLLRW13,
  author       = {Vida Dujmovic and
                  William S. Evans and
                  Sylvain Lazard and
                  William J. Lenhart and
                  Giuseppe Liotta and
                  David Rappaport and
                  Stephen K. Wismath},
  title        = {On point-sets that support planar graphs},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {1},
  pages        = {29--50},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.03.003},
  doi          = {10.1016/J.COMGEO.2012.03.003},
  timestamp    = {Tue, 20 Sep 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DujmovicELLLRW13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuJ13,
  author       = {Adrian Dumitrescu and
                  Minghui Jiang},
  title        = {On reconfiguration of disks in the plane and related problems},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {191--202},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.06.001},
  doi          = {10.1016/J.COMGEO.2012.06.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DumitrescuJ13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherM13,
  author       = {Stephane Durocher and
                  Jason Morrison},
  title        = {Foreword},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {2},
  pages        = {119},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.07.002},
  doi          = {10.1016/J.COMGEO.2012.07.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DurocherM13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EvansGKLMS13,
  author       = {William S. Evans and
                  Emden R. Gansner and
                  Michael Kaufmann and
                  Giuseppe Liotta and
                  Henk Meijer and
                  Andreas Spillner},
  title        = {Approximate proximity drawings},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {604--614},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.01.001},
  doi          = {10.1016/J.COMGEO.2013.01.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/EvansGKLMS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EzraM13,
  author       = {Esther Ezra and
                  Wolfgang Mulzer},
  title        = {Convex hull of points lying on lines in time after preprocessing},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {4},
  pages        = {417--434},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.03.004},
  doi          = {10.1016/J.COMGEO.2012.03.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/EzraM13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GeissKPR13,
  author       = {Darius Gei{\ss} and
                  Rolf Klein and
                  Rainer Penninger and
                  G{\"{u}}nter Rote},
  title        = {Optimally solving a transportation problem using Voronoi diagrams},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {8},
  pages        = {1009--1016},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.05.005},
  doi          = {10.1016/J.COMGEO.2013.05.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GeissKPR13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GerbnerT13,
  author       = {D{\'{a}}niel Gerbner and
                  G{\'{e}}za T{\'{o}}th},
  title        = {Separating families of convex sets},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {9},
  pages        = {1056--1058},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.06.001},
  doi          = {10.1016/J.COMGEO.2013.06.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GerbnerT13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiacomoDLM13,
  author       = {Emilio Di Giacomo and
                  Walter Didimo and
                  Giuseppe Liotta and
                  Fabrizio Montecchiani},
  title        = {Area requirement of graph drawings with few crossings per edge},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {8},
  pages        = {909--916},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.03.001},
  doi          = {10.1016/J.COMGEO.2013.03.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GiacomoDLM13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiacomoFFGK13,
  author       = {Emilio Di Giacomo and
                  Fabrizio Frati and
                  Radoslav Fulek and
                  Luca Grilli and
                  Marcus Krug},
  title        = {Orthogeodesic point-set embedding of trees},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {8},
  pages        = {929--944},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.04.003},
  doi          = {10.1016/J.COMGEO.2013.04.003},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GiacomoFFGK13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiannopoulosKRW13,
  author       = {Panos Giannopoulos and
                  Christian Knauer and
                  G{\"{u}}nter Rote and
                  Daniel Werner},
  title        = {Fixed-parameter tractability and lower bounds for stabbing problems},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {7},
  pages        = {839--860},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2011.06.005},
  doi          = {10.1016/J.COMGEO.2011.06.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GiannopoulosKRW13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GuibasMM13,
  author       = {Leonidas J. Guibas and
                  Nikola Milosavljevic and
                  Arik Motskin},
  title        = {Connected dominating sets on dynamic geometric graphs},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {2},
  pages        = {160--172},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.004},
  doi          = {10.1016/J.COMGEO.2012.01.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GuibasMM13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HerrmannJP13,
  author       = {Sven Herrmann and
                  Michael Joswig and
                  Marc E. Pfetsch},
  title        = {Computing the bounded subcomplex of an unbounded polyhedron},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {5},
  pages        = {541--551},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2011.11.002},
  doi          = {10.1016/J.COMGEO.2011.11.002},
  timestamp    = {Mon, 28 Aug 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/HerrmannJP13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Hershberger13,
  author       = {John Hershberger},
  title        = {Stable snap rounding},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {4},
  pages        = {403--416},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.02.011},
  doi          = {10.1016/J.COMGEO.2012.02.011},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Hershberger13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HurtadoK13,
  author       = {Ferran Hurtado and
                  Marc J. van Kreveld},
  title        = {Guest Editors' foreword},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {4},
  pages        = {401},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.10.007},
  doi          = {10.1016/J.COMGEO.2012.10.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HurtadoK13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/JelinekKR13,
  author       = {V{\'{\i}}t Jel{\'{\i}}nek and
                  Jan Kratochv{\'{\i}}l and
                  Ignaz Rutter},
  title        = {A Kuratowski-type theorem for planarity of partially embedded graphs},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {4},
  pages        = {466--492},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.07.005},
  doi          = {10.1016/J.COMGEO.2012.07.005},
  timestamp    = {Sun, 25 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/JelinekKR13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KaravelasST13,
  author       = {Menelaos I. Karavelas and
                  Raimund Seidel and
                  Eleni Tzanaki},
  title        = {Convex hulls of spheres and convex hulls of disjoint convex polytopes},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {615--630},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.02.001},
  doi          = {10.1016/J.COMGEO.2013.02.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KaravelasST13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KaufmannMS13,
  author       = {Michael Kaufmann and
                  Tamara Mchedlidze and
                  Antonios Symvonis},
  title        = {On upward point set embeddability},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {774--804},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.11.008},
  doi          = {10.1016/J.COMGEO.2012.11.008},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KaufmannMS13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimC13,
  author       = {Hyo{-}Sil Kim and
                  Otfried Cheong},
  title        = {The cost of bounded curvature},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {648--672},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.10.008},
  doi          = {10.1016/J.COMGEO.2012.10.008},
  timestamp    = {Sun, 25 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KimC13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/King13,
  author       = {James King},
  title        = {Fast vertex guarding for polygons with and without holes},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {219--231},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.07.004},
  doi          = {10.1016/J.COMGEO.2012.07.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/King13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KulkarniZ13,
  author       = {Omkar Kulkarni and
                  Huaming Zhang},
  title        = {An optimal greedy routing algorithm for triangulated polygons},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {640--647},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.02.002},
  doi          = {10.1016/J.COMGEO.2013.02.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KulkarniZ13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LaarhovenA13,
  author       = {Jon W. Van Laarhoven and
                  Kurt M. Anstreicher},
  title        = {Geometric conditions for Euclidean Steiner trees in {\(\mathfrak{R}\)}\({}^{\mbox{\emph{d}}}\)},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {5},
  pages        = {520--531},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2011.11.007},
  doi          = {10.1016/J.COMGEO.2011.11.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/LaarhovenA13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LoeraDKMPW13,
  author       = {Jes{\'{u}}s A. De Loera and
                  Brandon E. Dutra and
                  Matthias K{\"{o}}ppe and
                  S. Moreinis and
                  G. Pinto and
                  J. Wu},
  title        = {Software for exact integration of polynomials over polyhedra},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {232--252},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.09.001},
  doi          = {10.1016/J.COMGEO.2012.09.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/LoeraDKMPW13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MaierP13,
  author       = {Georg Maier and
                  Georg Pisinger},
  title        = {Approximation of a closed polygon with a minimum number of circular
                  arcs and line segments},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {3},
  pages        = {263--275},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.09.003},
  doi          = {10.1016/J.COMGEO.2012.09.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MaierP13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Mchedlidze13,
  author       = {Tamara Mchedlidze},
  title        = {Upward planar embedding of an n-vertex oriented path on O(n\({}^{\mbox{2}}\))
                  points},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {8},
  pages        = {1003--1008},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2013.05.004},
  doi          = {10.1016/J.COMGEO.2013.05.004},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Mchedlidze13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RazenW13,
  author       = {Andreas Razen and
                  Emo Welzl},
  title        = {On the number of crossing-free partitions},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {7},
  pages        = {879--893},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2011.07.001},
  doi          = {10.1016/J.COMGEO.2011.07.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/RazenW13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Rivera-CampoU13,
  author       = {Eduardo Rivera{-}Campo and
                  Virginia Urrutia{-}Galicia},
  title        = {A sufficient condition for the existence of plane spanning trees on
                  geometric graphs},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {1},
  pages        = {1--6},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.02.006},
  doi          = {10.1016/J.COMGEO.2012.02.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Rivera-CampoU13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SchulzT13,
  author       = {Andr{\'{e}} Schulz and
                  Csaba D. T{\'{o}}th},
  title        = {The union of colorful simplices spanned by a colored point set},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {5},
  pages        = {574--590},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.006},
  doi          = {10.1016/J.COMGEO.2012.01.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SchulzT13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Sunic13,
  author       = {Zoran Sunic},
  title        = {Normal art galleries: Wall in - all in},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {1},
  pages        = {7--16},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.02.007},
  doi          = {10.1016/J.COMGEO.2012.02.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Sunic13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/VanderZeeHGZR13,
  author       = {Evan VanderZee and
                  Anil N. Hirani and
                  Damrong Guoy and
                  Vadim Zharnitsky and
                  Edgar A. Ramos},
  title        = {Geometric and combinatorial properties of well-centered triangulations
                  in three and higher dimensions},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {700--724},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.11.003},
  doi          = {10.1016/J.COMGEO.2012.11.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/VanderZeeHGZR13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WuDBB13,
  author       = {Xiaodong Wu and
                  Xin Dou and
                  John E. Bayouth and
                  John M. Buatti},
  title        = {An almost linear time algorithm for field splitting in radiation therapy},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {6},
  pages        = {673--687},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.11.001},
  doi          = {10.1016/J.COMGEO.2012.11.001},
  timestamp    = {Mon, 01 Mar 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/WuDBB13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Wulff-Nilsen13,
  author       = {Christian Wulff{-}Nilsen},
  title        = {Constant time distance queries in planar unweighted graphs with subquadratic
                  preprocessing time},
  journal      = {Comput. Geom.},
  volume       = {46},
  number       = {7},
  pages        = {831--838},
  year         = {2013},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.016},
  doi          = {10.1016/J.COMGEO.2012.01.016},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Wulff-Nilsen13.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbamH12,
  author       = {Mohammad Ali Abam and
                  Sariel Har{-}Peled},
  title        = {New constructions of SSPDs and their applications},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {5-6},
  pages        = {200--214},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.12.003},
  doi          = {10.1016/J.COMGEO.2011.12.003},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AbamH12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Abu-AffashACK12,
  author       = {A. Karim Abu{-}Affash and
                  Rom Aschner and
                  Paz Carmi and
                  Matthew J. Katz},
  title        = {The {MST} of symmetric disk graphs is light},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {1-2},
  pages        = {54--61},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.08.002},
  doi          = {10.1016/J.COMGEO.2011.08.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Abu-AffashACK12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnCMV12,
  author       = {Hee{-}Kap Ahn and
                  Otfried Cheong and
                  Jir{\'{\i}} Matousek and
                  Antoine Vigneron},
  title        = {Reachability by paths of bounded curvature in a convex polygon},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {1-2},
  pages        = {21--32},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.07.003},
  doi          = {10.1016/J.COMGEO.2011.07.003},
  timestamp    = {Sun, 25 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnCMV12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerADHRU12,
  author       = {Oswin Aichholzer and
                  Franz Aurenhammer and
                  Erik D. Demaine and
                  Ferran Hurtado and
                  Pedro Ramos and
                  Jorge Urrutia},
  title        = {On k-convex polygons},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {3},
  pages        = {73--87},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.09.001},
  doi          = {10.1016/J.COMGEO.2011.09.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerADHRU12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerRSV12,
  author       = {Oswin Aichholzer and
                  G{\"{u}}nter Rote and
                  Andr{\'{e}} Schulz and
                  Birgit Vogtenhuber},
  title        = {Pointed drawings of planar graphs},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {9},
  pages        = {482--494},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2010.08.001},
  doi          = {10.1016/J.COMGEO.2010.08.001},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerRSV12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlonsoMS12,
  author       = {Javier Alonso and
                  Horst Martini and
                  Margarita Spirova},
  title        = {Minimal enclosing discs, circumcircles, and circumcenters in normed
                  planes (Part {I)}},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {5-6},
  pages        = {258--274},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.007},
  doi          = {10.1016/J.COMGEO.2012.01.007},
  timestamp    = {Thu, 28 Mar 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AlonsoMS12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlonsoMS12a,
  author       = {Javier Alonso and
                  Horst Martini and
                  Margarita Spirova},
  title        = {Minimal enclosing discs, circumcircles, and circumcenters in normed
                  planes (Part {II)}},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {7},
  pages        = {350--369},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.02.003},
  doi          = {10.1016/J.COMGEO.2012.02.003},
  timestamp    = {Thu, 28 Mar 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AlonsoMS12a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArikushiFKMT12,
  author       = {Karin Arikushi and
                  Radoslav Fulek and
                  Bal{\'{a}}zs Keszegh and
                  Filip Moric and
                  Csaba D. T{\'{o}}th},
  title        = {Graphs that admit right angle crossing drawings},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {4},
  pages        = {169--177},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.11.008},
  doi          = {10.1016/J.COMGEO.2011.11.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ArikushiFKMT12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeO12,
  author       = {Sang Won Bae and
                  Yoshio Okamoto},
  title        = {Querying two boundary points for shortest paths in a polygonal domain},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {7},
  pages        = {284--293},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.012},
  doi          = {10.1016/J.COMGEO.2012.01.012},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaeO12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaranyMT12,
  author       = {Imre B{\'{a}}r{\'{a}}ny and
                  Hiroshi Maehara and
                  Norihide Tokushige},
  title        = {Tetrahedra passing through a triangular hole, and tetrahedra fixed
                  by a planar frame},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {1-2},
  pages        = {14--20},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.07.004},
  doi          = {10.1016/J.COMGEO.2011.07.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaranyMT12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeckersB12,
  author       = {Benoit Beckers and
                  Pierre Beckers},
  title        = {A general rule for disk and hemisphere partition into equal-area cells},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {7},
  pages        = {275--283},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.011},
  doi          = {10.1016/J.COMGEO.2012.01.011},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BeckersB12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregCDPSV12,
  author       = {Sergey Bereg and
                  Sergio Cabello and
                  Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
                  Pablo P{\'{e}}rez{-}Lantero and
                  Carlos Seara and
                  Inmaculada Ventura},
  title        = {The class cover problem with boxes},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {7},
  pages        = {294--304},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.014},
  doi          = {10.1016/J.COMGEO.2012.01.014},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BeregCDPSV12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergG12,
  author       = {Mark de Berg and
                  Dirk H. P. Gerrits},
  title        = {Approximation algorithms for free-label maximization},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {4},
  pages        = {153--168},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.10.004},
  doi          = {10.1016/J.COMGEO.2011.10.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BergG12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BitnerD12,
  author       = {Steven Bitner and
                  Ovidiu Daescu},
  title        = {Minimum-sum dipolar spanning tree in R\({}^{\mbox{3}}\)},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {9},
  pages        = {476--481},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2010.09.011},
  doi          = {10.1016/J.COMGEO.2010.09.011},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BitnerD12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseC12,
  author       = {Prosenjit Bose and
                  Paz Carmi},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {9},
  pages        = {475},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.010},
  doi          = {10.1016/J.COMGEO.2012.01.010},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseC12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bringmann12,
  author       = {Karl Bringmann},
  title        = {An improved algorithm for Klee's measure problem on fat boxes},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {5-6},
  pages        = {225--233},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.12.001},
  doi          = {10.1016/J.COMGEO.2011.12.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Bringmann12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrunDM12,
  author       = {Christophe Brun and
                  Jean{-}Fran{\c{c}}ois Dufourd and
                  Nicolas Magaud},
  title        = {Designing and proving correct a convex hull algorithm with hypermaps
                  in Coq},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {8},
  pages        = {436--457},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2010.06.006},
  doi          = {10.1016/J.COMGEO.2010.06.006},
  timestamp    = {Thu, 14 Oct 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BrunDM12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloVL12,
  author       = {Sergio Cabello and
                  {\'{E}}ric Colin de Verdi{\`{e}}re and
                  Francis Lazarus},
  title        = {Algorithms for the edge-width of an embedded graph},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {5-6},
  pages        = {215--224},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.12.002},
  doi          = {10.1016/J.COMGEO.2011.12.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CabelloVL12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CazalsC12,
  author       = {Fr{\'{e}}d{\'{e}}ric Cazals and
                  David Cohen{-}Steiner},
  title        = {Reconstructing 3D compact sets},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {1-2},
  pages        = {1--13},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.07.005},
  doi          = {10.1016/J.COMGEO.2011.07.005},
  timestamp    = {Mon, 05 Feb 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CazalsC12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenDDM12,
  author       = {Dan Chen and
                  Luc Devroye and
                  Vida Dujmovic and
                  Pat Morin},
  title        = {Memoryless routing in convex subdivisions: Random walks are optimal},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {4},
  pages        = {178--185},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.12.005},
  doi          = {10.1016/J.COMGEO.2011.12.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChenDDM12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenHT12,
  author       = {Wei{-}Mei Chen and
                  Hsien{-}Kuei Hwang and
                  Tsung{-}Hsi Tsai},
  title        = {Maxima-finding algorithms for multidimensional samples: {A} two-phase
                  approach},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {1-2},
  pages        = {33--53},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.08.001},
  doi          = {10.1016/J.COMGEO.2011.08.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChenHT12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenW12,
  author       = {Danny Z. Chen and
                  Haitao Wang},
  title        = {An improved algorithm for reconstructing a simple polygon from its
                  visibility angles},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {5-6},
  pages        = {254--257},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.005},
  doi          = {10.1016/J.COMGEO.2012.01.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChenW12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChiangHR12,
  author       = {Ching{-}Shoei Chiang and
                  Christoph M. Hoffmann and
                  Paul Rosen},
  title        = {A generalized Malfatti problem},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {8},
  pages        = {425--435},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2010.06.005},
  doi          = {10.1016/J.COMGEO.2010.06.005},
  timestamp    = {Tue, 15 Jun 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChiangHR12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Davis12,
  author       = {Ernest Davis},
  title        = {Preserving geometric properties in reconstructing regions from internal
                  and nearby points},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {5-6},
  pages        = {234--253},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.001},
  doi          = {10.1016/J.COMGEO.2012.01.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Davis12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DulaL12,
  author       = {Jos{\'{e}} H. Dul{\'{a}} and
                  Francisco J. L{\'{o}}pez},
  title        = {Competing output-sensitive frame algorithms},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {4},
  pages        = {186--197},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.12.006},
  doi          = {10.1016/J.COMGEO.2011.12.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DulaL12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Dumitrescu12,
  author       = {Adrian Dumitrescu},
  title        = {Going around in circles},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {7},
  pages        = {370--381},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.02.004},
  doi          = {10.1016/J.COMGEO.2012.02.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Dumitrescu12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuT12,
  author       = {Adrian Dumitrescu and
                  Csaba D. T{\'{o}}th},
  title        = {Watchman tours for polygons with holes},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {7},
  pages        = {326--333},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.02.001},
  doi          = {10.1016/J.COMGEO.2012.02.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DumitrescuT12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Frati12,
  author       = {Fabrizio Frati},
  title        = {Straight-line drawings of outerplanar graphs in O(dn log n) area},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {9},
  pages        = {524--533},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2010.03.007},
  doi          = {10.1016/J.COMGEO.2010.03.007},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Frati12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GajentaanO12,
  author       = {Anka Gajentaan and
                  Mark H. Overmars},
  title        = {On a class of O(n\({}^{\mbox{2}}\)) problems in computational geometry},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {4},
  pages        = {140--152},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.11.006},
  doi          = {10.1016/J.COMGEO.2011.11.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GajentaanO12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GaoJM12,
  author       = {Xiao{-}Shan Gao and
                  Robert Joan{-}Arinyo and
                  Dominique Michelucci},
  title        = {Special issue on geometric constraints and reasoning},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {8},
  pages        = {383--384},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.008},
  doi          = {10.1016/J.COMGEO.2012.01.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GaoJM12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiesenMP12,
  author       = {Joachim Giesen and
                  Balint Miklos and
                  Mark Pauly},
  title        = {The medial axis of the union of inner Voronoi balls in the plane},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {9},
  pages        = {515--523},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2010.03.006},
  doi          = {10.1016/J.COMGEO.2010.03.006},
  timestamp    = {Mon, 05 Feb 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GiesenMP12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GrayKLS12,
  author       = {Chris Gray and
                  Frank Kammer and
                  Maarten L{\"{o}}ffler and
                  Rodrigo I. Silveira},
  title        = {Removing local extrema from imprecise terrains},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {7},
  pages        = {334--349},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.02.002},
  doi          = {10.1016/J.COMGEO.2012.02.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GrayKLS12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HallerJSSW12,
  author       = {Kirk Haller and
                  Audrey Lee{-}St. John and
                  Meera Sitharam and
                  Ileana Streinu and
                  Neil White},
  title        = {Body-and-cad geometric constraint systems},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {8},
  pages        = {385--405},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2010.06.003},
  doi          = {10.1016/J.COMGEO.2010.06.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HallerJSSW12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HararyT12,
  author       = {Gur Harary and
                  Ayellet Tal},
  title        = {3D Euler spirals for 3D curve completion},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {3},
  pages        = {115--126},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.10.001},
  doi          = {10.1016/J.COMGEO.2011.10.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HararyT12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HechtKT12,
  author       = {Fr{\'{e}}d{\'{e}}ric Hecht and
                  Rapha{\"{e}}l Kuate and
                  Timothy Tautges},
  title        = {Local transformations of hexahedral meshes of lower valence},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {1-2},
  pages        = {62--71},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.07.002},
  doi          = {10.1016/J.COMGEO.2011.07.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HechtKT12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KatzLM12,
  author       = {Matthew J. Katz and
                  Nissan Lev{-}Tov and
                  Gila Morgenstern},
  title        = {Conflict-Free Coloring of points on a line with respect to a set of
                  intervals},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {9},
  pages        = {508--514},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.013},
  doi          = {10.1016/J.COMGEO.2012.01.013},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KatzLM12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Keszegh12,
  author       = {Bal{\'{a}}zs Keszegh},
  title        = {Coloring half-planes and bottomless rectangles},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {9},
  pages        = {495--507},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.09.004},
  doi          = {10.1016/J.COMGEO.2011.09.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Keszegh12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimMPYZ12,
  author       = {Joondong Kim and
                  Joseph S. B. Mitchell and
                  Valentin Polishchuk and
                  Shang Yang and
                  Jingyu Zou},
  title        = {Routing multi-class traffic flows in the plane},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {3},
  pages        = {99--114},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.09.003},
  doi          = {10.1016/J.COMGEO.2011.09.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KimMPYZ12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Kirkpatrick12,
  author       = {David G. Kirkpatrick},
  title        = {Guest editor's foreword},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {5-6},
  pages        = {199},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.12.004},
  doi          = {10.1016/J.COMGEO.2011.12.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Kirkpatrick12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MagaudNS12,
  author       = {Nicolas Magaud and
                  Julien Narboux and
                  Pascal Schreck},
  title        = {A case study in formalizing projective geometry in Coq: Desargues
                  theorem},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {8},
  pages        = {406--424},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2010.06.004},
  doi          = {10.1016/J.COMGEO.2010.06.004},
  timestamp    = {Mon, 26 Jun 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/MagaudNS12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MehlhornS12,
  author       = {Kurt Mehlhorn and
                  J{\"{o}}rg{-}R{\"{u}}diger Sack},
  title        = {CGTA-Awards 2011},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {4},
  pages        = {139},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.11.005},
  doi          = {10.1016/J.COMGEO.2011.11.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MehlhornS12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MukhopadhyayG12,
  author       = {Asish Mukhopadhyay and
                  Eugene Greene},
  title        = {The ordinary line problem revisited},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {3},
  pages        = {127--130},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.10.003},
  doi          = {10.1016/J.COMGEO.2011.10.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MukhopadhyayG12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/NishatMR12,
  author       = {Rahnuma Islam Nishat and
                  Debajyoti Mondal and
                  Md. Saidur Rahman},
  title        = {Point-set embeddings of plane 3-trees},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {3},
  pages        = {88--98},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.09.002},
  doi          = {10.1016/J.COMGEO.2011.09.002},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/NishatMR12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PachST12,
  author       = {J{\'{a}}nos Pach and
                  Andrew Suk and
                  Miroslav Treml},
  title        = {Tangencies between families of disjoint regions in the plane},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {3},
  pages        = {131--138},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2011.10.002},
  doi          = {10.1016/J.COMGEO.2011.10.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/PachST12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/YanXD12,
  author       = {Chenyu Yan and
                  Yang Xiang and
                  Feodor F. Dragan},
  title        = {Compact and low delay routing labeling scheme for Unit Disk Graphs},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {7},
  pages        = {305--325},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2012.01.015},
  doi          = {10.1016/J.COMGEO.2012.01.015},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/YanXD12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Zhang12,
  author       = {Gui{-}Fang Zhang},
  title        = {Classification of direct kinematics to planar generalized Stewart
                  platforms},
  journal      = {Comput. Geom.},
  volume       = {45},
  number       = {8},
  pages        = {458--473},
  year         = {2012},
  url          = {https://doi.org/10.1016/j.comgeo.2010.06.007},
  doi          = {10.1016/J.COMGEO.2010.06.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Zhang12.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbregoMFFHSS11,
  author       = {Bernardo M. {\'{A}}brego and
                  Ruy Fabila Monroy and
                  Silvia Fern{\'{a}}ndez{-}Merchant and
                  David Flores{-}Pe{\~{n}}aloza and
                  Ferran Hurtado and
                  Vera Sacrist{\'{a}}n and
                  Maria Saumell},
  title        = {On crossing numbers of geometric proximity graphs},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {4},
  pages        = {216--233},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.11.003},
  doi          = {10.1016/J.COMGEO.2010.11.003},
  timestamp    = {Mon, 26 Jun 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AbregoMFFHSS11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBDDKKRS11,
  author       = {Hee{-}Kap Ahn and
                  Sang Won Bae and
                  Erik D. Demaine and
                  Martin L. Demaine and
                  Sang{-}Sub Kim and
                  Matias Korman and
                  Iris Reinbacher and
                  Wanbin Son},
  title        = {Covering points by disjoint boxes with outliers},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {3},
  pages        = {178--190},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.10.002},
  doi          = {10.1016/J.COMGEO.2010.10.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnBDDKKRS11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlonsoR11,
  author       = {Laurent Alonso and
                  Edward M. Reingold},
  title        = {Improved bounds for cops-and-robber pursuit},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {8},
  pages        = {365--369},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.03.001},
  doi          = {10.1016/J.COMGEO.2011.03.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AlonsoR11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArkinBMP11,
  author       = {Esther M. Arkin and
                  Michael A. Bender and
                  Joseph S. B. Mitchell and
                  Valentin Polishchuk},
  title        = {The snowblower problem},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {8},
  pages        = {370--384},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.03.003},
  doi          = {10.1016/J.COMGEO.2011.03.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ArkinBMP11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovDH11,
  author       = {Boris Aronov and
                  Muriel Dulieu and
                  Ferran Hurtado},
  title        = {Witness (Delaunay) graphs},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {6-7},
  pages        = {329--344},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.01.001},
  doi          = {10.1016/J.COMGEO.2011.01.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AronovDH11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bar-YehudaHR11,
  author       = {Reuven Bar{-}Yehuda and
                  Danny Hermelin and
                  Dror Rawitz},
  title        = {Minimum vertex cover in rectangle graphs},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {6-7},
  pages        = {356--364},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.03.002},
  doi          = {10.1016/J.COMGEO.2011.03.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Bar-YehudaHR11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlG11,
  author       = {Therese Biedl and
                  Burkay Gen{\c{c}}},
  title        = {Reconstructing orthogonal polyhedra from putative vertex sets},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {8},
  pages        = {409--417},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.04.002},
  doi          = {10.1016/J.COMGEO.2011.04.002},
  timestamp    = {Thu, 11 Aug 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiedlG11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlHL11,
  author       = {Therese Biedl and
                  Masud Hasan and
                  Alejandro L{\'{o}}pez{-}Ortiz},
  title        = {Efficient view point selection for silhouettes of convex polyhedra},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {8},
  pages        = {399--408},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.04.001},
  doi          = {10.1016/J.COMGEO.2011.04.001},
  timestamp    = {Thu, 11 Aug 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiedlHL11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCCSX11,
  author       = {Prosenjit Bose and
                  Paz Carmi and
                  Mathieu Couture and
                  Michiel H. M. Smid and
                  Daming Xu},
  title        = {On a family of strong geometric spanners that admit local routing
                  strategies},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {6-7},
  pages        = {319--328},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.01.002},
  doi          = {10.1016/J.COMGEO.2011.01.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseCCSX11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCD11,
  author       = {Prosenjit Bose and
                  Otfried Cheong and
                  Vida Dujmovic},
  title        = {A note on the perimeter of fat objects},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {1},
  pages        = {1--8},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.06.002},
  doi          = {10.1016/J.COMGEO.2010.06.002},
  timestamp    = {Sun, 25 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseCD11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseDLSV11,
  author       = {Prosenjit Bose and
                  Luc Devroye and
                  Maarten L{\"{o}}ffler and
                  Jack Snoeyink and
                  Vishal Verma},
  title        = {Almost all Delaunay triangulations have stretch factor greater than
                  pi/2},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {2},
  pages        = {121--127},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.09.009},
  doi          = {10.1016/J.COMGEO.2010.09.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseDLSV11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseMSW11,
  author       = {Prosenjit Bose and
                  Anil Maheshwari and
                  Chang Shu and
                  Stefanie Wuhrer},
  title        = {A survey of geodesic paths on 3D surfaces},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {9},
  pages        = {486--498},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.05.006},
  doi          = {10.1016/J.COMGEO.2011.05.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseMSW11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BriseG11,
  author       = {Yves Brise and
                  Bernd G{\"{a}}rtner},
  title        = {Clarkson's algorithm for violator spaces},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {2},
  pages        = {70--81},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.09.003},
  doi          = {10.1016/J.COMGEO.2010.09.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BriseG11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinBKL11,
  author       = {Kevin Buchin and
                  Maike Buchin and
                  Marc J. van Kreveld and
                  Jun Luo},
  title        = {Finding long and similar parts of trajectories},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {9},
  pages        = {465--476},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.05.004},
  doi          = {10.1016/J.COMGEO.2011.05.004},
  timestamp    = {Tue, 16 Aug 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BuchinBKL11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiKLR11,
  author       = {Paz Carmi and
                  Matthew J. Katz and
                  Zvi Lotker and
                  Adi Ros{\'{e}}n},
  title        = {Connectivity guarantees for wireless networks with directional antennas},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {9},
  pages        = {477--485},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.05.003},
  doi          = {10.1016/J.COMGEO.2011.05.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CarmiKLR11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CheongEGGHLLN11,
  author       = {Otfried Cheong and
                  Hazel Everett and
                  Marc Glisse and
                  Joachim Gudmundsson and
                  Samuel Hornus and
                  Sylvain Lazard and
                  Mira Lee and
                  Hyeon{-}Suk Na},
  title        = {Farthest-polygon Voronoi diagrams},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {4},
  pages        = {234--247},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.11.004},
  doi          = {10.1016/J.COMGEO.2010.11.004},
  timestamp    = {Sun, 25 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CheongEGGHLLN11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ClaverolGGMS11,
  author       = {Merc{\`{e}} Claverol and
                  Delia Garijo and
                  Clara I. Grima and
                  Alberto M{\'{a}}rquez and
                  Carlos Seara},
  title        = {Stabbers of line segments in the plane},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {5},
  pages        = {303--318},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.12.004},
  doi          = {10.1016/J.COMGEO.2010.12.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ClaverolGGMS11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CookW11,
  author       = {Atlas F. Cook and
                  Carola Wenk},
  title        = {Link distance and shortest path problems in the plane},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {8},
  pages        = {442--455},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.04.004},
  doi          = {10.1016/J.COMGEO.2011.04.004},
  timestamp    = {Sun, 12 Nov 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CookW11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CordascoCF11,
  author       = {Gennaro Cordasco and
                  Rosario De Chiara and
                  Andrew Fish},
  title        = {Efficient on-line algorithms for Euler diagram region computation},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {1},
  pages        = {52--68},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.07.003},
  doi          = {10.1016/J.COMGEO.2010.07.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CordascoCF11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CuiKX11,
  author       = {Shiliang Cui and
                  Iyad A. Kanj and
                  Ge Xia},
  title        = {On the stretch factor of Delaunay triangulations of points in convex
                  position},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {2},
  pages        = {104--109},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.09.007},
  doi          = {10.1016/J.COMGEO.2010.09.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CuiKX11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineFRSSZ11,
  author       = {Erik D. Demaine and
                  S{\'{a}}ndor P. Fekete and
                  G{\"{u}}nter Rote and
                  Nils Schweer and
                  Daria Schymura and
                  Mariano Zelke},
  title        = {Integer point sets minimizing average pairwise L\({}_{\mbox{1}}\)
                  distance: What is the optimal shape of a town?},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {2},
  pages        = {82--94},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.09.004},
  doi          = {10.1016/J.COMGEO.2010.09.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DemaineFRSSZ11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Devillers11,
  author       = {Olivier Devillers},
  title        = {Vertex removal in two-dimensional Delaunay triangulation: Speed-up
                  by low degrees optimization},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {3},
  pages        = {169--177},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.10.001},
  doi          = {10.1016/J.COMGEO.2010.10.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Devillers11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DevillersT11,
  author       = {Olivier Devillers and
                  Monique Teillaud},
  title        = {Perturbations for Delaunay and weighted Delaunay 3D triangulations},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {3},
  pages        = {160--168},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.09.010},
  doi          = {10.1016/J.COMGEO.2010.09.010},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DevillersT11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Diaz-BanezLMSV11,
  author       = {Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
                  Mario Alberto L{\'{o}}pez and
                  Merc{\`{e}} Mora and
                  Carlos Seara and
                  Inmaculada Ventura},
  title        = {Fitting a two-joint orthogonal chain to a point set},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {3},
  pages        = {135--147},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.07.005},
  doi          = {10.1016/J.COMGEO.2010.07.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Diaz-BanezLMSV11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DisserMW11,
  author       = {Yann Disser and
                  Mat{\'{u}}s Mihal{\'{a}}k and
                  Peter Widmayer},
  title        = {A polygon is determined by its angles},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {8},
  pages        = {418--426},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.04.003},
  doi          = {10.1016/J.COMGEO.2011.04.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DisserMW11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Duncan11,
  author       = {Christian A. Duncan},
  title        = {On graph thickness, geometric thickness, and separator theorems},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {2},
  pages        = {95--99},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.09.005},
  doi          = {10.1016/J.COMGEO.2010.09.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Duncan11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherJLN11,
  author       = {Stephane Durocher and
                  Krishnam Raju Jampani and
                  Anna Lubiw and
                  Lata Narayanan},
  title        = {Modelling gateway placement in wireless networks: Geometric k-centres
                  of unit disc graphs},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {5},
  pages        = {286--302},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.12.003},
  doi          = {10.1016/J.COMGEO.2010.12.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DurocherJLN11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ElbassioniT11,
  author       = {Khaled M. Elbassioni and
                  Hans Raj Tiwary},
  title        = {On a cone covering problem},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {3},
  pages        = {129--134},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.07.004},
  doi          = {10.1016/J.COMGEO.2010.07.004},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ElbassioniT11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Evans11,
  author       = {William Evans},
  title        = {Guest Editor's foreword},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {2},
  pages        = {69},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.09.002},
  doi          = {10.1016/J.COMGEO.2010.09.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Evans11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FowlerJKS11,
  author       = {J. Joseph Fowler and
                  Michael J{\"{u}}nger and
                  Stephen G. Kobourov and
                  Michael Schulz},
  title        = {Characterizations of restricted pairs of planar graphs allowing simultaneous
                  embedding with fixed edges},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {8},
  pages        = {385--398},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.02.002},
  doi          = {10.1016/J.COMGEO.2011.02.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FowlerJKS11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FratiK11,
  author       = {Fabrizio Frati and
                  Michael Kaufmann},
  title        = {Polynomial area bounds for {MST} embeddings of trees},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {9},
  pages        = {529--543},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.05.005},
  doi          = {10.1016/J.COMGEO.2011.05.005},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/FratiK11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FulekP11,
  author       = {Radoslav Fulek and
                  J{\'{a}}nos Pach},
  title        = {A computational approach to Conway's thrackle conjecture},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {6-7},
  pages        = {345--355},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.02.001},
  doi          = {10.1016/J.COMGEO.2011.02.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FulekP11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GencEH11,
  author       = {Burkay Gen{\c{c}} and
                  Cem Evrendilek and
                  Brahim Hnich},
  title        = {Covering points with orthogonally convex polygons},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {5},
  pages        = {249--264},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.12.001},
  doi          = {10.1016/J.COMGEO.2010.12.001},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GencEH11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Hougardy11,
  author       = {Stefan Hougardy},
  title        = {On packing squares into a rectangle},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {8},
  pages        = {456--463},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.05.001},
  doi          = {10.1016/J.COMGEO.2011.05.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Hougardy11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Jiang11,
  author       = {Minghui Jiang},
  title        = {An inequality on the edge lengths of triangular meshes},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {2},
  pages        = {100--103},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.09.006},
  doi          = {10.1016/J.COMGEO.2010.09.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Jiang11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KaplanRS11,
  author       = {Haim Kaplan and
                  Natan Rubin and
                  Micha Sharir},
  title        = {A kinetic triangulation scheme for moving points in the plane},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {4},
  pages        = {191--205},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.11.001},
  doi          = {10.1016/J.COMGEO.2010.11.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KaplanRS11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Karavelas11,
  author       = {Menelaos I. Karavelas},
  title        = {Guarding curvilinear art galleries with edge or mobile guards via
                  2-dominance of triangulation graphs},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {1},
  pages        = {20--51},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.07.002},
  doi          = {10.1016/J.COMGEO.2010.07.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Karavelas11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KashyapKS11,
  author       = {Abhishek Kashyap and
                  Samir Khuller and
                  Mark A. Shayman},
  title        = {Relay placement for fault tolerance in wireless networks in higher
                  dimensions},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {4},
  pages        = {206--215},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.11.002},
  doi          = {10.1016/J.COMGEO.2010.11.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KashyapKS11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Kreveld11,
  author       = {Marc J. van Kreveld},
  title        = {Bold graph drawings},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {9},
  pages        = {499--506},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.06.002},
  doi          = {10.1016/J.COMGEO.2011.06.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Kreveld11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MaheshwariSSZ11,
  author       = {Anil Maheshwari and
                  J{\"{o}}rg{-}R{\"{u}}diger Sack and
                  Kaveh Shahbaz and
                  Hamid Zarrabi{-}Zadeh},
  title        = {Fr{\'{e}}chet distance with speed limits},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {2},
  pages        = {110--120},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.09.008},
  doi          = {10.1016/J.COMGEO.2010.09.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MaheshwariSSZ11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MartinW11,
  author       = {Shawn Martin and
                  Jean{-}Paul Watson},
  title        = {Non-manifold surface reconstruction from high-dimensional point cloud
                  data},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {8},
  pages        = {427--441},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.05.002},
  doi          = {10.1016/J.COMGEO.2011.05.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MartinW11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MehlhornOS11,
  author       = {Kurt Mehlhorn and
                  Ralf Osbild and
                  Michael Sagraloff},
  title        = {A general approach to the analysis of controlled perturbation algorithms},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {9},
  pages        = {507--528},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2011.06.001},
  doi          = {10.1016/J.COMGEO.2011.06.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MehlhornOS11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Packer11,
  author       = {Eli Packer},
  title        = {Controlled Perturbation of sets of line segments in {\(\mathbb{R}\)}\({}^{\mbox{2}}\)
                  with smart processing order},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {5},
  pages        = {265--285},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.12.002},
  doi          = {10.1016/J.COMGEO.2010.12.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Packer11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SadasivamZ11,
  author       = {Sadish Sadasivam and
                  Huaming Zhang},
  title        = {Closed rectangle-of-influence drawings for irreducible triangulations},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {1},
  pages        = {9--19},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.07.001},
  doi          = {10.1016/J.COMGEO.2010.07.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SadasivamZ11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/YuHW11,
  author       = {Chih{-}Chiang Yu and
                  Wing{-}Kai Hon and
                  Biing{-}Feng Wang},
  title        = {Improved data structures for the orthogonal range successor problem},
  journal      = {Comput. Geom.},
  volume       = {44},
  number       = {3},
  pages        = {148--159},
  year         = {2011},
  url          = {https://doi.org/10.1016/j.comgeo.2010.09.001},
  doi          = {10.1016/J.COMGEO.2010.09.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/YuHW11.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbamBG10,
  author       = {Mohammad Ali Abam and
                  Mark de Berg and
                  Joachim Gudmundsson},
  title        = {A simple and efficient kinetic spanner},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {3},
  pages        = {251--256},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.01.008},
  doi          = {10.1016/J.COMGEO.2009.01.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AbamBG10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AfshaniHZ10,
  author       = {Peyman Afshani and
                  Chris H. Hamilton and
                  Norbert Zeh},
  title        = {A general approach for cache-oblivious range reporting and approximate
                  range counting},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {8},
  pages        = {700--712},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.04.003},
  doi          = {10.1016/J.COMGEO.2010.04.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AfshaniHZ10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBKNS10,
  author       = {Hee{-}Kap Ahn and
                  Peter Brass and
                  Christian Knauer and
                  Hyeon{-}Suk Na and
                  Chan{-}Su Shin},
  title        = {Covering a simple polygon by monotone directions},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {5},
  pages        = {514--523},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.11.002},
  doi          = {10.1016/J.COMGEO.2009.11.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnBKNS10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerAAHJPR10,
  author       = {Oswin Aichholzer and
                  Wolfgang Aigner and
                  Franz Aurenhammer and
                  Thomas Hackl and
                  Bert J{\"{u}}ttler and
                  Elisabeth Pilgerstorfer and
                  Margot Rabl},
  title        = {Divide-and-conquer for Voronoi diagrams revisited},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {8},
  pages        = {688--699},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.04.004},
  doi          = {10.1016/J.COMGEO.2010.04.004},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerAAHJPR10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlonsoR10,
  author       = {Laurent Alonso and
                  Edward M. Reingold},
  title        = {Bounds for cops and robber pursuit},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {9},
  pages        = {749--766},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.02.002},
  doi          = {10.1016/J.COMGEO.2010.02.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AlonsoR10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisCCHLOP10,
  author       = {Greg Aloupis and
                  Jean Cardinal and
                  S{\'{e}}bastien Collette and
                  Ferran Hurtado and
                  Stefan Langerman and
                  Joseph O'Rourke and
                  Bel{\'{e}}n Palop},
  title        = {Highway hull revisited},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {115--130},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.06.001},
  doi          = {10.1016/J.COMGEO.2009.06.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AloupisCCHLOP10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AltSS10,
  author       = {Helmut Alt and
                  Ludmila Scharf and
                  Daria Schymura},
  title        = {Probabilistic matching of planar regions},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {99--114},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.04.006},
  doi          = {10.1016/J.COMGEO.2009.04.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AltSS10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlvarezS10,
  author       = {Victor Alvarez and
                  Raimund Seidel},
  title        = {Approximating the minimum weight spanning tree of a set of points
                  in the Hausdorff metric},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {94--98},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.04.005},
  doi          = {10.1016/J.COMGEO.2009.04.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AlvarezS10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArkinMP10,
  author       = {Esther M. Arkin and
                  Joseph S. B. Mitchell and
                  Valentin Polishchuk},
  title        = {Maximum thick paths in static and dynamic environments},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {3},
  pages        = {279--294},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.02.007},
  doi          = {10.1016/J.COMGEO.2009.02.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ArkinMP10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BagnaraHZ10,
  author       = {Roberto Bagnara and
                  Patricia M. Hill and
                  Enea Zaffanella},
  title        = {Exact join detection for convex polyhedra and other numerical abstractions},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {5},
  pages        = {453--473},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.09.002},
  doi          = {10.1016/J.COMGEO.2009.09.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BagnaraHZ10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BasitMRR10,
  author       = {Abdul Basit and
                  Nabil H. Mustafa and
                  Saurabh Ray and
                  Sarfraz Raza},
  title        = {Centerpoints and Tverberg's technique},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {6-7},
  pages        = {593--600},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.03.002},
  doi          = {10.1016/J.COMGEO.2010.03.002},
  timestamp    = {Wed, 07 Dec 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BasitMRR10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BatistaMPS10,
  author       = {Vicente H. F. Batista and
                  David L. Millman and
                  Sylvain Pion and
                  Johannes Singler},
  title        = {Parallel geometric algorithms for multi-core computers},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {8},
  pages        = {663--677},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.04.008},
  doi          = {10.1016/J.COMGEO.2010.04.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BatistaMPS10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeenNPW10,
  author       = {Ken Been and
                  Martin N{\"{o}}llenburg and
                  Sheung{-}Hung Poon and
                  Alexander Wolff},
  title        = {Optimizing active ranges for consistent dynamic map labeling},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {3},
  pages        = {312--328},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.03.006},
  doi          = {10.1016/J.COMGEO.2009.03.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BeenNPW10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ben-DanPZ10,
  author       = {Itay Ben{-}Dan and
                  Rom Pinchasi and
                  Ran Ziv},
  title        = {On a problem about quadrant-depth},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {6-7},
  pages        = {587--592},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.02.001},
  doi          = {10.1016/J.COMGEO.2010.02.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Ben-DanPZ10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BerberichKS10,
  author       = {Eric Berberich and
                  Michael Kerber and
                  Michael Sagraloff},
  title        = {An efficient algorithm for the stratification and triangulation of
                  an algebraic surface},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {3},
  pages        = {257--278},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.01.009},
  doi          = {10.1016/J.COMGEO.2009.01.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BerberichKS10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergCHLT10,
  author       = {Mark de Berg and
                  Otfried Cheong and
                  Herman J. Haverkort and
                  Jung Gun Lim and
                  Laura Toma},
  title        = {The complexity of flow on fat terrains and its i/o-efficient computation},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {4},
  pages        = {331--356},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2008.12.008},
  doi          = {10.1016/J.COMGEO.2008.12.008},
  timestamp    = {Sun, 25 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BergCHLT10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergG10,
  author       = {Mark de Berg and
                  Chris Gray},
  title        = {Decompositions and boundary coverings of non-convex fat polyhedra},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {73--83},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.04.003},
  doi          = {10.1016/J.COMGEO.2009.04.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BergG10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergG10a,
  author       = {Mark de Berg and
                  Chris Gray},
  title        = {Computing the visibility map of fat objects},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {4},
  pages        = {410--418},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2008.12.010},
  doi          = {10.1016/J.COMGEO.2008.12.010},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BergG10a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergHTT10,
  author       = {Mark de Berg and
                  Herman J. Haverkort and
                  Shripad Thite and
                  Laura Toma},
  title        = {Star-quadtrees and guard-quadtrees: I/O-efficient indexes for fat
                  triangulations and low-density planar subdivisions},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {5},
  pages        = {493--513},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.11.001},
  doi          = {10.1016/J.COMGEO.2009.11.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BergHTT10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BinucciGDEFKL10,
  author       = {Carla Binucci and
                  Emilio Di Giacomo and
                  Walter Didimo and
                  Alejandro Estrella{-}Balderrama and
                  Fabrizio Frati and
                  Stephen G. Kobourov and
                  Giuseppe Liotta},
  title        = {Upward straight-line embeddings of directed graphs into point sets},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {219--232},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.07.002},
  doi          = {10.1016/J.COMGEO.2009.07.002},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BinucciGDEFKL10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BorradaileLS10,
  author       = {Glencora Borradaile and
                  James R. Lee and
                  Anastasios Sidiropoulos},
  title        = {Randomly removing g handles at once},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {8},
  pages        = {655--662},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.04.007},
  doi          = {10.1016/J.COMGEO.2010.04.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BorradaileLS10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BringmannF10,
  author       = {Karl Bringmann and
                  Tobias Friedrich},
  title        = {Approximating the volume of unions and intersections of high-dimensional
                  geometric objects},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {6-7},
  pages        = {601--610},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.03.004},
  doi          = {10.1016/J.COMGEO.2010.03.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BringmannF10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarrSP10,
  author       = {Hamish A. Carr and
                  Jack Snoeyink and
                  Michiel van de Panne},
  title        = {Flexible isosurfaces: Simplifying and displaying scalar topology using
                  the contour tree},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {1},
  pages        = {42--58},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2006.05.009},
  doi          = {10.1016/J.COMGEO.2006.05.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CarrSP10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CaryRSV10,
  author       = {Matthew Cary and
                  Atri Rudra and
                  Ashish Sabharwal and
                  Erik Vee},
  title        = {Floodlight illumination of infinite wedges},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {1},
  pages        = {23--34},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2007.01.004},
  doi          = {10.1016/J.COMGEO.2007.01.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CaryRSV10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ceyhan10,
  author       = {Elvan Ceyhan},
  title        = {Extension of one-dimensional proximity regions to higher dimensions},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {9},
  pages        = {721--748},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.05.002},
  doi          = {10.1016/J.COMGEO.2010.05.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Ceyhan10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChambersVELLT10,
  author       = {Erin W. Chambers and
                  {\'{E}}ric Colin de Verdi{\`{e}}re and
                  Jeff Erickson and
                  Sylvain Lazard and
                  Francis Lazarus and
                  Shripad Thite},
  title        = {Homotopic Fr{\'{e}}chet distance between curves or, walking your
                  dog in the woods in polynomial time},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {3},
  pages        = {295--311},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.02.008},
  doi          = {10.1016/J.COMGEO.2009.02.008},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChambersVELLT10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Chan10,
  author       = {Timothy M. Chan},
  title        = {A (slightly) faster algorithm for Klee's measure problem},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {3},
  pages        = {243--250},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.01.007},
  doi          = {10.1016/J.COMGEO.2009.01.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Chan10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanC10,
  author       = {Timothy M. Chan and
                  Eric Y. Chen},
  title        = {Optimal in-place and cache-oblivious algorithms for 3-d convex hulls
                  and 2-d segment intersection},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {8},
  pages        = {636--646},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.04.005},
  doi          = {10.1016/J.COMGEO.2010.04.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChanC10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenF10,
  author       = {Chao Chen and
                  Daniel Freedman},
  title        = {Measuring and computing natural generators for homology groups},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {169--181},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.06.004},
  doi          = {10.1016/J.COMGEO.2009.06.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChenF10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChernovSR10,
  author       = {Nikolai I. Chernov and
                  Yu. G. Stoyan and
                  Tatiana E. Romanova},
  title        = {Mathematical model and efficient algorithms for object packing problem},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {5},
  pages        = {535--553},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.12.003},
  doi          = {10.1016/J.COMGEO.2009.12.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChernovSR10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DasDN10,
  author       = {Gautam K. Das and
                  Sandip Das and
                  Subhas C. Nandy},
  title        = {Homogeneous 2-hop broadcast in 2D},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {182--190},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.06.005},
  doi          = {10.1016/J.COMGEO.2009.06.005},
  timestamp    = {Wed, 31 Mar 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DasDN10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FeketeS10,
  author       = {S{\'{a}}ndor P. Fekete and
                  Christiane Schmidt},
  title        = {Polygon exploration with time-discrete vision},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {148--168},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.06.003},
  doi          = {10.1016/J.COMGEO.2009.06.003},
  timestamp    = {Wed, 07 Dec 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FeketeS10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FonsecaM10,
  author       = {Guilherme Dias da Fonseca and
                  David M. Mount},
  title        = {Approximate range searching: The absolute model},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {4},
  pages        = {434--444},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2008.09.009},
  doi          = {10.1016/J.COMGEO.2008.09.009},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/FonsecaM10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FriedlerM10,
  author       = {Sorelle A. Friedler and
                  David M. Mount},
  title        = {Approximation algorithm for the kinetic robust K-center problem},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {6-7},
  pages        = {572--586},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.01.001},
  doi          = {10.1016/J.COMGEO.2010.01.001},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/FriedlerM10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GrilliHLMW10,
  author       = {Luca Grilli and
                  Seok{-}Hee Hong and
                  Giuseppe Liotta and
                  Henk Meijer and
                  Stephen K. Wismath},
  title        = {Matched drawability of graph pairs and of graph triples},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {6-7},
  pages        = {611--634},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.03.005},
  doi          = {10.1016/J.COMGEO.2010.03.005},
  timestamp    = {Thu, 27 Apr 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GrilliHLMW10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HasheminezhadHMT10,
  author       = {Mahdieh Hasheminezhad and
                  S. Mehdi Hashemi and
                  Brendan D. McKay and
                  Maryam Tahmasbi},
  title        = {Rectangular-radial drawings of cubic plane graphs},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {9},
  pages        = {767--780},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.06.001},
  doi          = {10.1016/J.COMGEO.2010.06.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HasheminezhadHMT10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HaverkortW10,
  author       = {Herman J. Haverkort and
                  Freek van Walderveen},
  title        = {Locality and bounding-box quality of two-dimensional space-filling
                  curves},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {131--147},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.06.002},
  doi          = {10.1016/J.COMGEO.2009.06.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HaverkortW10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HoffmannST10,
  author       = {Michael Hoffmann and
                  Bettina Speckmann and
                  Csaba D. T{\'{o}}th},
  title        = {Pointed binary encompassing trees: Simple and optimal},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {1},
  pages        = {35--41},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2006.12.005},
  doi          = {10.1016/J.COMGEO.2006.12.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HoffmannST10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HongN10,
  author       = {Seok{-}Hee Hong and
                  Hiroshi Nagamochi},
  title        = {An algorithm for constructing star-shaped drawings of plane graphs},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {191--206},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.06.008},
  doi          = {10.1016/J.COMGEO.2009.06.008},
  timestamp    = {Thu, 27 Apr 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/HongN10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Iacono10,
  author       = {John Iacono},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {1},
  pages        = {1},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.03.003},
  doi          = {10.1016/J.COMGEO.2009.03.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Iacono10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ImaiKMRT10,
  author       = {Keiko Imai and
                  Akitoshi Kawamura and
                  Jir{\'{\i}} Matousek and
                  Daniel Reem and
                  Takeshi Tokuyama},
  title        = {Distance k-sectors exist},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {9},
  pages        = {713--720},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.05.001},
  doi          = {10.1016/J.COMGEO.2010.05.001},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ImaiKMRT10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/JimenezSF10,
  author       = {Juan Jos{\'{e}} Jim{\'{e}}nez{-}Delgado and
                  Rafael Jes{\'{u}}s Segura and
                  Francisco R. Feito},
  title        = {A robust segment/triangle intersection algorithm for interference
                  tests. Efficiency study},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {5},
  pages        = {474--492},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.10.001},
  doi          = {10.1016/J.COMGEO.2009.10.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/JimenezSF10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KreveldLS10,
  author       = {Marc J. van Kreveld and
                  Maarten L{\"{o}}ffler and
                  Rodrigo I. Silveira},
  title        = {Optimization for first order Delaunay triangulations},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {4},
  pages        = {377--394},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.01.010},
  doi          = {10.1016/J.COMGEO.2009.01.010},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KreveldLS10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Lazard10,
  author       = {Sylvain Lazard},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {67},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.06.006},
  doi          = {10.1016/J.COMGEO.2009.06.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Lazard10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LofflerK10,
  author       = {Maarten L{\"{o}}ffler and
                  Marc J. van Kreveld},
  title        = {Largest bounding box, smallest diameter, and related problems on imprecise
                  points},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {4},
  pages        = {419--433},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.03.007},
  doi          = {10.1016/J.COMGEO.2009.03.007},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/LofflerK10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LofflerS10,
  author       = {Maarten L{\"{o}}ffler and
                  Jack Snoeyink},
  title        = {Delaunay triangulation of imprecise points in linear time after preprocessing},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {3},
  pages        = {234--242},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2008.12.007},
  doi          = {10.1016/J.COMGEO.2008.12.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/LofflerS10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MatijevicO10,
  author       = {Domagoj Matijevic and
                  Ralf Osbild},
  title        = {Finding the Theta-guarded region},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {207--218},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.07.001},
  doi          = {10.1016/J.COMGEO.2009.07.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MatijevicO10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MehlhornS10,
  author       = {Kurt Mehlhorn and
                  J{\"{o}}rg{-}R{\"{u}}diger Sack},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {6-7},
  pages        = {555},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.03.001},
  doi          = {10.1016/J.COMGEO.2010.03.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MehlhornS10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MillerS10,
  author       = {Gary L. Miller and
                  Donald R. Sheehy},
  title        = {Approximate centerpoints with proofs},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {8},
  pages        = {647--654},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.04.006},
  doi          = {10.1016/J.COMGEO.2010.04.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MillerS10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Muller-HannemannT10,
  author       = {Matthias M{\"{u}}ller{-}Hannemann and
                  Siamak Tazari},
  title        = {A near linear time approximation scheme for Steiner tree among obstacles
                  in the plane},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {4},
  pages        = {395--409},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.01.011},
  doi          = {10.1016/J.COMGEO.2009.01.011},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Muller-HannemannT10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MustafaR10,
  author       = {Nabil H. Mustafa and
                  Saurabh Ray},
  title        = {Reprint of: Weak epsilon-nets have basis of size O(1/epsilonlog(1/epsilon))
                  in any dimension},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {6-7},
  pages        = {565--571},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2007.02.007},
  doi          = {10.1016/J.COMGEO.2007.02.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MustafaR10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PaninaS10,
  author       = {Gaiane Panina and
                  Ileana Streinu},
  title        = {Flattening single-vertex origami: The non-expansive case},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {8},
  pages        = {678--687},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.04.002},
  doi          = {10.1016/J.COMGEO.2010.04.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/PaninaS10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RemySW10,
  author       = {Jan Remy and
                  Reto Sp{\"{o}}hel and
                  Andreas Wei{\ss}l},
  title        = {On Euclidean vehicle routing with allocation},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {4},
  pages        = {357--376},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2008.12.009},
  doi          = {10.1016/J.COMGEO.2008.12.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/RemySW10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Seidel10,
  author       = {Raimund Seidel},
  title        = {Reprint of: {A} simple and fast incremental randomized algorithm for
                  computing trapezoidal decompositions and for triangulating polygons},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {6-7},
  pages        = {556--564},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.03.003},
  doi          = {10.1016/J.COMGEO.2010.03.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Seidel10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SteffensT10,
  author       = {Reinhard Steffens and
                  Thorsten Theobald},
  title        = {Mixed volume techniques for embeddings of Laman graphs},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {84--93},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.04.004},
  doi          = {10.1016/J.COMGEO.2009.04.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SteffensT10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Teillaud10,
  author       = {Monique Teillaud},
  title        = {Foreword},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {3},
  pages        = {233},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.04.001},
  doi          = {10.1016/J.COMGEO.2009.04.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Teillaud10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Toussaint10,
  author       = {Godfried T. Toussaint},
  title        = {Computational geometric aspects of rhythm, melody, and voice-leading},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {1},
  pages        = {2--22},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2007.01.003},
  doi          = {10.1016/J.COMGEO.2007.01.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Toussaint10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/VanderZeeHZG10,
  author       = {Evan VanderZee and
                  Anil N. Hirani and
                  Vadim Zharnitsky and
                  Damrong Guoy},
  title        = {A dihedral acute triangulation of the cube},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {5},
  pages        = {445--452},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.09.001},
  doi          = {10.1016/J.COMGEO.2009.09.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/VanderZeeHZG10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WenkZ10,
  author       = {Carola Wenk and
                  Afra Zomorodian},
  title        = {Guest Editors' foreword},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {8},
  pages        = {635},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2010.04.001},
  doi          = {10.1016/J.COMGEO.2010.04.001},
  timestamp    = {Sun, 12 Nov 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/WenkZ10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Wulff-Nilsen10,
  author       = {Christian Wulff{-}Nilsen},
  title        = {Computing the dilation of edge-augmented graphs in metric spaces},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {2},
  pages        = {68--72},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.03.008},
  doi          = {10.1016/J.COMGEO.2009.03.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Wulff-Nilsen10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/XuX10,
  author       = {Guang Xu and
                  Jinhui Xu},
  title        = {Efficient approximation algorithms for clustering point-sets},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {1},
  pages        = {59--66},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2007.12.002},
  doi          = {10.1016/J.COMGEO.2007.12.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/XuX10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Zeh10,
  author       = {Norbert Zeh},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {4},
  pages        = {329--330},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.06.007},
  doi          = {10.1016/J.COMGEO.2009.06.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Zeh10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZhangW10,
  author       = {Heping Zhang and
                  Guangfu Wang},
  title        = {Embeddability of open-ended carbon nanotubes in hypercubes},
  journal      = {Comput. Geom.},
  volume       = {43},
  number       = {5},
  pages        = {524--534},
  year         = {2010},
  url          = {https://doi.org/10.1016/j.comgeo.2009.12.001},
  doi          = {10.1016/J.COMGEO.2009.12.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ZhangW10.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbbottBCDDHKLNRSY09,
  author       = {Timothy G. Abbott and
                  Michael A. Burr and
                  Timothy M. Chan and
                  Erik D. Demaine and
                  Martin L. Demaine and
                  John Hugg and
                  Daniel Kane and
                  Stefan Langerman and
                  Jelani Nelson and
                  Eynat Rafalin and
                  Kathryn Seyboth and
                  Vincent Yeung},
  title        = {Dynamic ham-sandwich cuts in the plane},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {419--428},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.09.008},
  doi          = {10.1016/J.COMGEO.2008.09.008},
  timestamp    = {Thu, 04 Apr 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AbbottBCDDHKLNRSY09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AckermanAK09,
  author       = {Eyal Ackerman and
                  Oswin Aichholzer and
                  Bal{\'{a}}zs Keszegh},
  title        = {Improved upper bounds on the reflexivity of point sets},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {3},
  pages        = {241--249},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.05.004},
  doi          = {10.1016/J.COMGEO.2008.05.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AckermanAK09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhmedL09,
  author       = {Mustaq Ahmed and
                  Anna Lubiw},
  title        = {Shortest descending paths through given faces},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {464--470},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2007.10.011},
  doi          = {10.1016/J.COMGEO.2007.10.011},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhmedL09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBNS09,
  author       = {Hee{-}Kap Ahn and
                  Peter Brass and
                  Hyeon{-}Suk Na and
                  Chan{-}Su Shin},
  title        = {On the minimum total length of interval systems expressing all intervals,
                  and range-restricted queries},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {3},
  pages        = {207--213},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.03.004},
  doi          = {10.1016/J.COMGEO.2008.03.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnBNS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerA09,
  author       = {Oswin Aichholzer and
                  Franz Aurenhammer},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {8},
  pages        = {723},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.02.003},
  doi          = {10.1016/J.COMGEO.2009.02.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerA09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerAHS09,
  author       = {Oswin Aichholzer and
                  Franz Aurenhammer and
                  Thomas Hackl and
                  Bettina Speckmann},
  title        = {On minimum weight pseudo-triangulations},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {627--631},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.10.002},
  doi          = {10.1016/J.COMGEO.2008.10.002},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerAHS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerBDGHHKMRSSUW09,
  author       = {Oswin Aichholzer and
                  Sergey Bereg and
                  Adrian Dumitrescu and
                  Alfredo Garc{\'{\i}}a Olaverri and
                  Clemens Huemer and
                  Ferran Hurtado and
                  Mikio Kano and
                  Alberto M{\'{a}}rquez and
                  David Rappaport and
                  Shakhar Smorodinsky and
                  Diane L. Souvaine and
                  Jorge Urrutia and
                  David R. Wood},
  title        = {Compatible geometric matchings},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {617--626},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.12.005},
  doi          = {10.1016/J.COMGEO.2008.12.005},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerBDGHHKMRSSUW09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMFHHU09,
  author       = {Oswin Aichholzer and
                  Ruy Fabila Monroy and
                  David Flores{-}Pe{\~{n}}aloza and
                  Thomas Hackl and
                  Clemens Huemer and
                  Jorge Urrutia},
  title        = {Empty monochromatic triangles},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {9},
  pages        = {934--938},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.04.002},
  doi          = {10.1016/J.COMGEO.2009.04.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerMFHHU09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisCDDFLORAW09,
  author       = {Greg Aloupis and
                  S{\'{e}}bastien Collette and
                  Mirela Damian and
                  Erik D. Demaine and
                  Robin Y. Flatland and
                  Stefan Langerman and
                  Joseph O'Rourke and
                  Suneeta Ramaswami and
                  Vera Sacrist{\'{a}}n Adinolfi and
                  Stefanie Wuhrer},
  title        = {Linear reconfiguration of cube-style modular robots},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {652--663},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.11.003},
  doi          = {10.1016/J.COMGEO.2008.11.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AloupisCDDFLORAW09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArkinFIMMRPRX09,
  author       = {Esther M. Arkin and
                  S{\'{a}}ndor P. Fekete and
                  Kamrul Islam and
                  Henk Meijer and
                  Joseph S. B. Mitchell and
                  Yurai N{\'{u}}{\~{n}}ez Rodr{\'{\i}}guez and
                  Valentin Polishchuk and
                  David Rappaport and
                  Henry Xiao},
  title        = {Not being (super)thin or solid is hard: {A} study of grid Hamiltonicity},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {582--605},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.11.004},
  doi          = {10.1016/J.COMGEO.2008.11.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ArkinFIMMRPRX09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovAHLRSS09,
  author       = {Boris Aronov and
                  Franz Aurenhammer and
                  Ferran Hurtado and
                  Stefan Langerman and
                  David Rappaport and
                  Carlos Seara and
                  Shakhar Smorodinsky},
  title        = {Small weak epsilon-nets},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {455--462},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.02.005},
  doi          = {10.1016/J.COMGEO.2008.02.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AronovAHLRSS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AsanoBCMSSW09,
  author       = {Tetsuo Asano and
                  Prosenjit Bose and
                  Paz Carmi and
                  Anil Maheshwari and
                  Chang Shu and
                  Michiel H. M. Smid and
                  Stefanie Wuhrer},
  title        = {A linear-space algorithm for distance preserving graph embedding},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {4},
  pages        = {289--304},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.06.004},
  doi          = {10.1016/J.COMGEO.2008.06.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AsanoBCMSSW09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeLACC09,
  author       = {Sang Won Bae and
                  Chunseok Lee and
                  Hee{-}Kap Ahn and
                  Sunghee Choi and
                  Kyung{-}Yong Chwa},
  title        = {Computing minimum-area rectilinear convex hull and L-shape},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {9},
  pages        = {903--912},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.02.006},
  doi          = {10.1016/J.COMGEO.2009.02.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BaeLACC09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BenkocziBDS09,
  author       = {Robert Benkoczi and
                  Binay K. Bhattacharya and
                  Sandip Das and
                  Jeff Sember},
  title        = {Single facility collection depots location problem in the plane},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {403--418},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.04.004},
  doi          = {10.1016/J.COMGEO.2008.04.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BenkocziBDS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bereg09,
  author       = {Sergey Bereg},
  title        = {Orthogonal equipartitions},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {4},
  pages        = {305--314},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.09.004},
  doi          = {10.1016/J.COMGEO.2008.09.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Bereg09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregMW09,
  author       = {Sergey Bereg and
                  Nikolaus Mutsanas and
                  Alexander Wolff},
  title        = {Matching points with rectangles and squares},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {2},
  pages        = {93--108},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.05.001},
  doi          = {10.1016/J.COMGEO.2008.05.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BeregMW09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergHS09,
  author       = {Mark de Berg and
                  Herman J. Haverkort and
                  Micha Streppel},
  title        = {Efficient c-oriented range searching with DOP-trees},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {3},
  pages        = {250--267},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.05.002},
  doi          = {10.1016/J.COMGEO.2008.05.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BergHS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlLS09,
  author       = {Therese C. Biedl and
                  Anna Lubiw and
                  Michael J. Spriggs},
  title        = {Morphing polyhedra with parallel faces: Counterexamples},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {395--402},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.09.006},
  doi          = {10.1016/J.COMGEO.2008.09.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BiedlLS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BodlaenderFGPSW09,
  author       = {Hans L. Bodlaender and
                  Corinne Feremans and
                  Alexander Grigoriev and
                  Eelko Penninkx and
                  Ren{\'{e}} Sitters and
                  Thomas Wolle},
  title        = {On the minimum corridor connection problem and other generalized geometric
                  problems},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {9},
  pages        = {939--951},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.05.001},
  doi          = {10.1016/J.COMGEO.2009.05.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BodlaenderFGPSW09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCCMSZ09,
  author       = {Prosenjit Bose and
                  Paz Carmi and
                  Mathieu Couture and
                  Anil Maheshwari and
                  Michiel H. M. Smid and
                  Norbert Zeh},
  title        = {Geometric spanners with small chromatic number},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {2},
  pages        = {134--146},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.04.003},
  doi          = {10.1016/J.COMGEO.2008.04.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseCCMSZ09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseH09,
  author       = {Prosenjit Bose and
                  Ferran Hurtado},
  title        = {Flips in planar graphs},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {1},
  pages        = {60--80},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.04.001},
  doi          = {10.1016/J.COMGEO.2008.04.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseH09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseM09,
  author       = {Prosenjit Bose and
                  Asish Mukhopadhyay},
  title        = {Editorial {CCCG} 2005},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {363},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.12.001},
  doi          = {10.1016/J.COMGEO.2008.12.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseM09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseMSW09,
  author       = {Prosenjit Bose and
                  Pat Morin and
                  Michiel H. M. Smid and
                  Stefanie Wuhrer},
  title        = {Rotationally monotone polygons},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {471--483},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2007.02.004},
  doi          = {10.1016/J.COMGEO.2007.02.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseMSW09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrassKNS09,
  author       = {Peter Brass and
                  Kyue D. Kim and
                  Hyeon{-}Suk Na and
                  Chan{-}Su Shin},
  title        = {Escaping offline searchers and isoperimetric theorems},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {2},
  pages        = {119--126},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.08.001},
  doi          = {10.1016/J.COMGEO.2008.08.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BrassKNS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinRUW09,
  author       = {Kevin Buchin and
                  Andreas Razen and
                  Takeaki Uno and
                  Uli Wagner},
  title        = {Transforming spanning trees: {A} lower bound},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {8},
  pages        = {724--730},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.03.005},
  doi          = {10.1016/J.COMGEO.2008.03.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BuchinRUW09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Buzer09,
  author       = {Lilian Buzer},
  title        = {Optimal simplification of polygonal chains for subpixel-accurate rendering},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {1},
  pages        = {45--59},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.03.002},
  doi          = {10.1016/J.COMGEO.2008.03.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Buzer09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloK09,
  author       = {Sergio Cabello and
                  Christian Knauer},
  title        = {Algorithms for graphs of bounded treewidth via orthogonal range searching},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {9},
  pages        = {815--824},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.02.001},
  doi          = {10.1016/J.COMGEO.2009.02.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CabelloK09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CapposEFK09,
  author       = {Justin Cappos and
                  Alejandro Estrella{-}Balderrama and
                  J. Joseph Fowler and
                  Stephen G. Kobourov},
  title        = {Simultaneous graph embedding with bends and circular arcs},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {2},
  pages        = {173--182},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.05.003},
  doi          = {10.1016/J.COMGEO.2008.05.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CapposEFK09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CardinalCL09,
  author       = {Jean Cardinal and
                  S{\'{e}}bastien Collette and
                  Stefan Langerman},
  title        = {Empty region graphs},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {3},
  pages        = {183--195},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.09.003},
  doi          = {10.1016/J.COMGEO.2008.09.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CardinalCL09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CastroCLT09,
  author       = {Pedro Machado Manh{\~{a}}es de Castro and
                  Fr{\'{e}}d{\'{e}}ric Cazals and
                  S{\'{e}}bastien Loriot and
                  Monique Teillaud},
  title        = {Design of the {CGAL} 3D Spherical Kernel and application to arrangements
                  of circles on a sphere},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {536--550},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.10.003},
  doi          = {10.1016/J.COMGEO.2008.10.003},
  timestamp    = {Mon, 05 Feb 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CastroCLT09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CazalsL09,
  author       = {Fr{\'{e}}d{\'{e}}ric Cazals and
                  S{\'{e}}bastien Loriot},
  title        = {Computing the arrangement of circles on a sphere, with applications
                  in structural biology},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {551--565},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.10.004},
  doi          = {10.1016/J.COMGEO.2008.10.004},
  timestamp    = {Mon, 05 Feb 2024 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CazalsL09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChaudhuriK09,
  author       = {Siddhartha Chaudhuri and
                  Vladlen Koltun},
  title        = {Smoothed analysis of probabilistic roadmaps},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {8},
  pages        = {731--747},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.10.005},
  doi          = {10.1016/J.COMGEO.2008.10.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChaudhuriK09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChazalCL09,
  author       = {Fr{\'{e}}d{\'{e}}ric Chazal and
                  David Cohen{-}Steiner and
                  Andr{\'{e}} Lieutier},
  title        = {Normal cone approximation and offset shape isotopy},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {566--581},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.12.002},
  doi          = {10.1016/J.COMGEO.2008.12.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChazalCL09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenHL09,
  author       = {Chieh{-}Yu Chen and
                  Ya{-}Fei Hung and
                  Hsueh{-}I Lu},
  title        = {Visibility representations of four-connected plane graphs with near
                  optimal heights},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {9},
  pages        = {865--872},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.01.006},
  doi          = {10.1016/J.COMGEO.2009.01.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChenHL09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChengS09,
  author       = {Ho{-}Lun Cheng and
                  Xinwei Shi},
  title        = {Quality mesh generation for molecular skin surfaces using restricted
                  union of balls},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {3},
  pages        = {196--206},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.10.001},
  doi          = {10.1016/J.COMGEO.2008.10.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChengS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineDIL09,
  author       = {Erik D. Demaine and
                  Martin L. Demaine and
                  John Iacono and
                  Stefan Langerman},
  title        = {Wrapping spheres with flat paper},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {8},
  pages        = {748--757},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.10.006},
  doi          = {10.1016/J.COMGEO.2008.10.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DemaineDIL09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineGMRTTWW09,
  author       = {Erik D. Demaine and
                  Francisco Gomez{-}Martin and
                  Henk Meijer and
                  David Rappaport and
                  Perouz Taslakian and
                  Godfried T. Toussaint and
                  Terry Winograd and
                  David R. Wood},
  title        = {The distance geometry of music},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {429--454},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.04.005},
  doi          = {10.1016/J.COMGEO.2008.04.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DemaineGMRTTWW09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemouthDEGLS09,
  author       = {Julien Demouth and
                  Olivier Devillers and
                  Hazel Everett and
                  Marc Glisse and
                  Sylvain Lazard and
                  Raimund Seidel},
  title        = {On the complexity of umbra and penumbra},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {8},
  pages        = {758--771},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.04.007},
  doi          = {10.1016/J.COMGEO.2008.04.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DemouthDEGLS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DimitrovKKR09,
  author       = {Darko Dimitrov and
                  Christian Knauer and
                  Klaus Kriegel and
                  G{\"{u}}nter Rote},
  title        = {Bounds on the quality of the {PCA} bounding boxes},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {8},
  pages        = {772--789},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.02.007},
  doi          = {10.1016/J.COMGEO.2008.02.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DimitrovKKR09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DoraiswamyN09,
  author       = {Harish Doraiswamy and
                  Vijay Natarajan},
  title        = {Efficient algorithms for computing Reeb graphs},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {606--616},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.12.003},
  doi          = {10.1016/J.COMGEO.2008.12.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DoraiswamyN09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherK09,
  author       = {Stephane Durocher and
                  David G. Kirkpatrick},
  title        = {The projection median of a set of points},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {364--375},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.06.006},
  doi          = {10.1016/J.COMGEO.2008.06.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DurocherK09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EgebladNB09,
  author       = {Jens Egeblad and
                  Benny K. Nielsen and
                  Marcus Brazil},
  title        = {Translational packing of arbitrary polytopes},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {4},
  pages        = {269--288},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.06.003},
  doi          = {10.1016/J.COMGEO.2008.06.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/EgebladNB09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EppsteinKMS09,
  author       = {David Eppstein and
                  Marc J. van Kreveld and
                  Elena Mumford and
                  Bettina Speckmann},
  title        = {Edges and switches, tunnels and bridges},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {8},
  pages        = {790--802},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.05.005},
  doi          = {10.1016/J.COMGEO.2008.05.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/EppsteinKMS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Estrella-BalderramaFK09,
  author       = {Alejandro Estrella{-}Balderrama and
                  J. Joseph Fowler and
                  Stephen G. Kobourov},
  title        = {Characterization of unlabeled level planar trees},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {704--721},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.12.006},
  doi          = {10.1016/J.COMGEO.2008.12.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Estrella-BalderramaFK09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EverettLLZ09,
  author       = {Hazel Everett and
                  Sylvain Lazard and
                  William J. Lenhart and
                  Linqiao Zhang},
  title        = {On the degree of standard geometric predicates for line transversals
                  in 3D},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {484--494},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2007.11.002},
  doi          = {10.1016/J.COMGEO.2007.11.002},
  timestamp    = {Tue, 20 Sep 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/EverettLLZ09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Figueroa09,
  author       = {Ana Paulina Figueroa},
  title        = {A note on a theorem of Perles concerning non-crossing paths in convex
                  geometric graphs},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {1},
  pages        = {90--91},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.07.002},
  doi          = {10.1016/J.COMGEO.2008.07.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Figueroa09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FranekM09,
  author       = {Vojtech Franek and
                  Jir{\'{\i}} Matousek},
  title        = {Computing D-convex hulls in the plane},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {1},
  pages        = {81--89},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.03.003},
  doi          = {10.1016/J.COMGEO.2008.03.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FranekM09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GarciaHHTV09,
  author       = {Alfredo Garc{\'{\i}}a Olaverri and
                  Ferran Hurtado and
                  Clemens Huemer and
                  Javier Tejel and
                  Pavel Valtr},
  title        = {On triconnected and cubic plane graphs on given point sets},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {9},
  pages        = {913--922},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.03.005},
  doi          = {10.1016/J.COMGEO.2009.03.005},
  timestamp    = {Tue, 27 Dec 2022 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GarciaHHTV09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiacomoDLMW09,
  author       = {Emilio Di Giacomo and
                  Walter Didimo and
                  Giuseppe Liotta and
                  Henk Meijer and
                  Stephen K. Wismath},
  title        = {Point-set embeddings of trees with given partial drawings},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {664--676},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.01.001},
  doi          = {10.1016/J.COMGEO.2009.01.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GiacomoDLMW09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonKMOW09,
  author       = {Joachim Gudmundsson and
                  Jyrki Katajainen and
                  Damian Merrick and
                  Cahya Ong and
                  Thomas Wolle},
  title        = {Compressing spatio-temporal trajectories},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {9},
  pages        = {825--841},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.02.002},
  doi          = {10.1016/J.COMGEO.2009.02.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GudmundssonKMOW09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonKN09,
  author       = {Joachim Gudmundsson and
                  Marc J. van Kreveld and
                  Giri Narasimhan},
  title        = {Region-restricted clustering for geographic data mining},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {3},
  pages        = {231--240},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.08.003},
  doi          = {10.1016/J.COMGEO.2008.08.003},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GudmundssonKN09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/InkuluK09,
  author       = {Rajasekhar Inkulu and
                  Sanjiv Kapoor},
  title        = {Visibility queries in a polygonal region},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {9},
  pages        = {852--864},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.02.004},
  doi          = {10.1016/J.COMGEO.2009.02.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/InkuluK09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/InkuluK09a,
  author       = {Rajasekhar Inkulu and
                  Sanjiv Kapoor},
  title        = {Planar rectilinear shortest path computation using corridors},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {9},
  pages        = {873--884},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.02.005},
  doi          = {10.1016/J.COMGEO.2009.02.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/InkuluK09a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/JerseK09,
  author       = {Gregor Jerse and
                  Neza Mramor{-}Kosta},
  title        = {Ascending and descending regions of a discrete Morse function},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {639--651},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.11.001},
  doi          = {10.1016/J.COMGEO.2008.11.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/JerseK09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/JordanS09,
  author       = {Tibor Jord{\'{a}}n and
                  Zoltan Szabadka},
  title        = {Operations preserving the global rigidity of graphs and frameworks
                  in the plane},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {511--521},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.09.007},
  doi          = {10.1016/J.COMGEO.2008.09.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/JordanS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KaravelasTT09,
  author       = {Menelaos I. Karavelas and
                  Csaba D. T{\'{o}}th and
                  Elias P. Tsigaridas},
  title        = {Guarding curvilinear art galleries with vertex or point guards},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {522--535},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.11.002},
  doi          = {10.1016/J.COMGEO.2008.11.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KaravelasTT09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KleinKNS09,
  author       = {Rolf Klein and
                  Christian Knauer and
                  Giri Narasimhan and
                  Michiel H. M. Smid},
  title        = {On the dilation spectrum of paths, cycles, and trees},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {9},
  pages        = {923--933},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.03.004},
  doi          = {10.1016/J.COMGEO.2009.03.004},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KleinKNS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KleinLN09,
  author       = {Rolf Klein and
                  Elmar Langetepe and
                  Zahra Nilforoushan},
  title        = {Abstract Voronoi diagrams revisited},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {9},
  pages        = {885--902},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.03.002},
  doi          = {10.1016/J.COMGEO.2009.03.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KleinLN09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Lucier09,
  author       = {Brendan Lucier},
  title        = {Local overlaps in special unfoldings of convex polyhedra},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {495--504},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2007.07.008},
  doi          = {10.1016/J.COMGEO.2007.07.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Lucier09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MartiniW09,
  author       = {Horst Martini and
                  Senlin Wu},
  title        = {Geometric dilation of closed curves in normed planes},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {4},
  pages        = {315--321},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.06.001},
  doi          = {10.1016/J.COMGEO.2008.06.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MartiniW09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MehlhornSZ09,
  author       = {Kurt Mehlhorn and
                  J{\"{o}}rg{-}R{\"{u}}diger Sack and
                  Joseph Zaks},
  title        = {Note on the paper "K-vertex guarding simple polygons" [Computational
                  Geometry 42 {(4)} (May 2009) 352-361]},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {722},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.03.001},
  doi          = {10.1016/J.COMGEO.2009.03.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MehlhornSZ09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MeijerR09,
  author       = {Henk Meijer and
                  David Rappaport},
  title        = {Editorial {CCCG} 2006},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {463},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.12.004},
  doi          = {10.1016/J.COMGEO.2008.12.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MeijerR09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MeijerRR09,
  author       = {Henk Meijer and
                  Yurai N{\'{u}}{\~{n}}ez Rodr{\'{\i}}guez and
                  David Rappaport},
  title        = {Bounds for point recolouring in geometric graphs},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {690--703},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.01.004},
  doi          = {10.1016/J.COMGEO.2009.01.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MeijerRR09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MukkamalaS09,
  author       = {Padmini Mukkamala and
                  Mario Szegedy},
  title        = {Geometric representation of cubic graphs with four directions},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {9},
  pages        = {842--851},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.01.005},
  doi          = {10.1016/J.COMGEO.2009.01.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MukkamalaS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MustafaR09,
  author       = {Nabil H. Mustafa and
                  Saurabh Ray},
  title        = {An optimal extension of the centerpoint theorem},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {505--510},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2007.10.004},
  doi          = {10.1016/J.COMGEO.2007.10.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MustafaR09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Nekrich09,
  author       = {Yakov Nekrich},
  title        = {Orthogonal range searching in linear and almost-linear space},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {4},
  pages        = {342--351},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.09.001},
  doi          = {10.1016/J.COMGEO.2008.09.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Nekrich09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/NguyenBGJS09,
  author       = {Hoa Nguyen and
                  John V. Burkardt and
                  Max D. Gunzburger and
                  Lili Ju and
                  Yuki Saka},
  title        = {Constrained {CVT} meshes and a comparison of triangular mesh generators},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {1},
  pages        = {1--19},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.04.002},
  doi          = {10.1016/J.COMGEO.2008.04.002},
  timestamp    = {Thu, 14 Oct 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/NguyenBGJS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PachT09,
  author       = {J{\'{a}}nos Pach and
                  G{\'{e}}za T{\'{o}}th},
  title        = {Decomposition of multiple coverings into many parts},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {2},
  pages        = {127--133},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.08.002},
  doi          = {10.1016/J.COMGEO.2008.08.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/PachT09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PanagiotakisAT09,
  author       = {Costas Panagiotakis and
                  Konstantin Athanassopoulos and
                  Georgios Tziritas},
  title        = {The equipartition of curves},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {677--689},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.01.003},
  doi          = {10.1016/J.COMGEO.2009.01.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/PanagiotakisAT09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RahmanMN09,
  author       = {Md. Saidur Rahman and
                  Kazuyuki Miura and
                  Takao Nishizeki},
  title        = {Octagonal drawings of plane graphs with prescribed face areas},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {3},
  pages        = {214--230},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.09.002},
  doi          = {10.1016/J.COMGEO.2008.09.002},
  timestamp    = {Tue, 21 Mar 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/RahmanMN09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RamosV09,
  author       = {Pedro A. Ramos and
                  Raquel Via{\~{n}}a},
  title        = {Depth of segments and circles through points enclosing many points:
                  a note},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {4},
  pages        = {338--341},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.07.001},
  doi          = {10.1016/J.COMGEO.2008.07.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/RamosV09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RoyKDN09,
  author       = {Sasanka Roy and
                  Arindam Karmakar and
                  Sandip Das and
                  Subhas C. Nandy},
  title        = {Constrained minimum enclosing circle with center on a query line segment},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {6-7},
  pages        = {632--638},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2009.01.002},
  doi          = {10.1016/J.COMGEO.2009.01.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/RoyKDN09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Rybnikov09,
  author       = {Konstantin A. Rybnikov},
  title        = {An efficient local approach to convexity testing of piecewise-linear
                  hypersurfaces},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {2},
  pages        = {147--172},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.02.004},
  doi          = {10.1016/J.COMGEO.2008.02.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Rybnikov09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Salleh09,
  author       = {Ihsan Salleh},
  title        = {K-vertex guarding simple polygons},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {4},
  pages        = {352--361},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.07.004},
  doi          = {10.1016/J.COMGEO.2008.07.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Salleh09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SilveiraK09,
  author       = {Rodrigo I. Silveira and
                  Marc J. van Kreveld},
  title        = {Towards a definition of higher order constrained Delaunay triangulations},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {4},
  pages        = {322--337},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.09.005},
  doi          = {10.1016/J.COMGEO.2008.09.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SilveiraK09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SilveiraK09a,
  author       = {Rodrigo I. Silveira and
                  Marc J. van Kreveld},
  title        = {Optimal higher order Delaunay triangulations of polygons},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {8},
  pages        = {803--813},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.02.006},
  doi          = {10.1016/J.COMGEO.2008.02.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SilveiraK09a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SouvaineT09,
  author       = {Diane L. Souvaine and
                  Csaba D. T{\'{o}}th},
  title        = {A vertex-face assignment for plane graphs},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {388--394},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.06.005},
  doi          = {10.1016/J.COMGEO.2008.06.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/SouvaineT09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Thite09,
  author       = {Shripad Thite},
  title        = {Adaptive spacetime meshing for discontinuous Galerkin methods},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {1},
  pages        = {20--44},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.07.003},
  doi          = {10.1016/J.COMGEO.2008.07.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Thite09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ungor09,
  author       = {Alper {\"{U}}ng{\"{o}}r},
  title        = {Off-centers: {A} new type of Steiner points for computing size-optimal
                  quality-guaranteed Delaunay triangulations},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {2},
  pages        = {109--118},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.06.002},
  doi          = {10.1016/J.COMGEO.2008.06.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Ungor09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WagnerDS09,
  author       = {David P. Wagner and
                  Robert L. Scot Drysdale and
                  Clifford Stein},
  title        = {An O(n\({}^{\mbox{5/2}}\)logn) algorithm for the Rectilinear Minimum
                  Link-Distance Problem in three dimensions},
  journal      = {Comput. Geom.},
  volume       = {42},
  number       = {5},
  pages        = {376--387},
  year         = {2009},
  url          = {https://doi.org/10.1016/j.comgeo.2008.04.006},
  doi          = {10.1016/J.COMGEO.2008.04.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/WagnerDS09.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbellanasBOHRRT08,
  author       = {Manuel Abellanas and
                  Prosenjit Bose and
                  Alfredo Garc{\'{\i}}a Olaverri and
                  Ferran Hurtado and
                  Pedro Ramos and
                  Eduardo Rivera{-}Campo and
                  Javier Tejel},
  title        = {On local transformations in plane geometric graphs embedded on small
                  grids},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {2},
  pages        = {65--77},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2006.12.004},
  doi          = {10.1016/J.COMGEO.2006.12.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AbellanasBOHRRT08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbellanasOHTU08,
  author       = {Manuel Abellanas and
                  Alfredo Garc{\'{\i}}a Olaverri and
                  Ferran Hurtado and
                  Javier Tejel and
                  Jorge Urrutia},
  title        = {Augmenting the connectivity of geometric graphs},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {3},
  pages        = {220--230},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.09.001},
  doi          = {10.1016/J.COMGEO.2007.09.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AbellanasOHTU08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBS08,
  author       = {Hee{-}Kap Ahn and
                  Peter Brass and
                  Chan{-}Su Shin},
  title        = {Maximum overlap and minimum convex hull of two convex polyhedra under
                  translations},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {2},
  pages        = {171--177},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.08.001},
  doi          = {10.1016/J.COMGEO.2007.08.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnBS08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerAGHHHKRV08,
  author       = {Oswin Aichholzer and
                  Franz Aurenhammer and
                  Paola Gonzalez{-}Nava and
                  Thomas Hackl and
                  Clemens Huemer and
                  Ferran Hurtado and
                  Hannes Krasser and
                  Saurabh Ray and
                  Birgit Vogtenhuber},
  title        = {Matching edges and faces in polygonal partitions},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {2},
  pages        = {134--141},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.07.002},
  doi          = {10.1016/J.COMGEO.2007.07.002},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerAGHHHKRV08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerHK08,
  author       = {Oswin Aichholzer and
                  Clemens Huemer and
                  Hannes Krasser},
  title        = {Triangulations without pointed spanning trees},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {1},
  pages        = {79--83},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.07.006},
  doi          = {10.1016/J.COMGEO.2007.07.006},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerHK08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisDLMOST08,
  author       = {Greg Aloupis and
                  Erik D. Demaine and
                  Stefan Langerman and
                  Pat Morin and
                  Joseph O'Rourke and
                  Ileana Streinu and
                  Godfried T. Toussaint},
  title        = {Edge-unfolding nested polyhedral bands},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {1},
  pages        = {30--42},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.05.009},
  doi          = {10.1016/J.COMGEO.2007.05.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AloupisDLMOST08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovBCGHSV08,
  author       = {Boris Aronov and
                  Mark de Berg and
                  Otfried Cheong and
                  Joachim Gudmundsson and
                  Herman J. Haverkort and
                  Michiel H. M. Smid and
                  Antoine Vigneron},
  title        = {Sparse geometric graphs with small dilation},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {3},
  pages        = {207--219},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.07.004},
  doi          = {10.1016/J.COMGEO.2007.07.004},
  timestamp    = {Sun, 25 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AronovBCGHSV08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovBG08,
  author       = {Boris Aronov and
                  Mark de Berg and
                  Chris Gray},
  title        = {Ray shooting and intersection searching amidst fat convex polyhedra
                  in 3-space},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {1-2},
  pages        = {68--76},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.10.006},
  doi          = {10.1016/J.COMGEO.2007.10.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AronovBG08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Aurenhammer08,
  author       = {Franz Aurenhammer},
  title        = {Weighted skeletons and fixed-share decomposition},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {2},
  pages        = {93--101},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.08.002},
  doi          = {10.1016/J.COMGEO.2007.08.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Aurenhammer08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BadoiuC08,
  author       = {Mihai Badoiu and
                  Kenneth L. Clarkson},
  title        = {Optimal core-sets for balls},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {1},
  pages        = {14--22},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.04.002},
  doi          = {10.1016/J.COMGEO.2007.04.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BadoiuC08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarequetDS08,
  author       = {Gill Barequet and
                  Matthew T. Dickerson and
                  Yuval Scharf},
  title        = {Covering points with a polygon},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {3},
  pages        = {143--162},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.05.001},
  doi          = {10.1016/J.COMGEO.2007.05.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BarequetDS08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BenkertGHW08,
  author       = {Marc Benkert and
                  Joachim Gudmundsson and
                  Herman J. Haverkort and
                  Alexander Wolff},
  title        = {Constructing minimum-interference networks},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {3},
  pages        = {179--194},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.06.004},
  doi          = {10.1016/J.COMGEO.2007.06.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BenkertGHW08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BenkertGHW08a,
  author       = {Marc Benkert and
                  Joachim Gudmundsson and
                  Florian H{\"{u}}bner and
                  Thomas Wolle},
  title        = {Reporting flock patterns},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {3},
  pages        = {111--125},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.10.003},
  doi          = {10.1016/J.COMGEO.2007.10.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BenkertGHW08a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bereg08,
  author       = {Sergey Bereg},
  title        = {Efficient algorithms for the d-dimensional rigidity matroid of sparse
                  graphs},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {1},
  pages        = {37--44},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2006.11.005},
  doi          = {10.1016/J.COMGEO.2006.11.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Bereg08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BinucciDG08,
  author       = {Carla Binucci and
                  Walter Didimo and
                  Francesco Giordano},
  title        = {Maximum upward planar subgraphs of embedded planar digraphs},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {3},
  pages        = {230--246},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2008.02.001},
  doi          = {10.1016/J.COMGEO.2008.02.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BinucciDG08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseF08,
  author       = {Prosenjit Bose and
                  Thomas Fevens},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {1},
  pages        = {1},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.06.002},
  doi          = {10.1016/J.COMGEO.2007.06.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseF08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinBW08,
  author       = {Kevin Buchin and
                  Maike Buchin and
                  Carola Wenk},
  title        = {Computing the Fr{\'{e}}chet distance between simple polygons},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {1-2},
  pages        = {2--20},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.08.003},
  doi          = {10.1016/J.COMGEO.2007.08.003},
  timestamp    = {Sun, 12 Nov 2023 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BuchinBW08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinDGJ08,
  author       = {Kevin Buchin and
                  Tamal K. Dey and
                  Joachim Giesen and
                  Matthias John},
  title        = {Recursive geometry of the flow complex and topology of the flow complex
                  filtration},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {2},
  pages        = {115--137},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.05.005},
  doi          = {10.1016/J.COMGEO.2007.05.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BuchinDGJ08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloDSSUV08,
  author       = {Sergio Cabello and
                  Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
                  Carlos Seara and
                  Joan Antoni Sellar{\`{e}}s and
                  Jorge Urrutia and
                  Inmaculada Ventura},
  title        = {Covering point sets with two disjoint disks or squares},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {3},
  pages        = {195--206},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.10.001},
  doi          = {10.1016/J.COMGEO.2007.10.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CabelloDSSUV08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloGKR08,
  author       = {Sergio Cabello and
                  Panos Giannopoulos and
                  Christian Knauer and
                  G{\"{u}}nter Rote},
  title        = {Matching point sets with respect to the Earth Mover's Distance},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {2},
  pages        = {118--133},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2006.10.001},
  doi          = {10.1016/J.COMGEO.2006.10.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CabelloGKR08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CaravantesG08,
  author       = {Jorge Caravantes and
                  Laureano Gonz{\'{a}}lez{-}Vega},
  title        = {Improving the topology computation of an arrangement of cubics},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {3},
  pages        = {206--218},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2008.03.001},
  doi          = {10.1016/J.COMGEO.2008.03.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CaravantesG08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CardinalCHLP08,
  author       = {Jean Cardinal and
                  S{\'{e}}bastien Collette and
                  Ferran Hurtado and
                  Stefan Langerman and
                  Bel{\'{e}}n Palop},
  title        = {Optimal location of transportation devices},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {3},
  pages        = {219--229},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2008.01.001},
  doi          = {10.1016/J.COMGEO.2008.01.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CardinalCHLP08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CardinalCL08,
  author       = {Jean Cardinal and
                  S{\'{e}}bastien Collette and
                  Stefan Langerman},
  title        = {Local properties of geometric graphs},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {1},
  pages        = {55--64},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.05.011},
  doi          = {10.1016/J.COMGEO.2007.05.011},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CardinalCL08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiKL08,
  author       = {Paz Carmi and
                  Matthew J. Katz and
                  Nissan Lev{-}Tov},
  title        = {Polynomial-time approximation schemes for piercing and covering with
                  applications in wireless networks},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {3},
  pages        = {209--218},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.01.001},
  doi          = {10.1016/J.COMGEO.2007.01.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CarmiKL08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChambersVELW08,
  author       = {Erin W. Chambers and
                  {\'{E}}ric Colin de Verdi{\`{e}}re and
                  Jeff Erickson and
                  Francis Lazarus and
                  Kim Whittlesey},
  title        = {Splitting (complicated) surfaces is hard},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {1-2},
  pages        = {94--110},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.10.010},
  doi          = {10.1016/J.COMGEO.2007.10.010},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChambersVELW08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChazalL08,
  author       = {Fr{\'{e}}d{\'{e}}ric Chazal and
                  Andr{\'{e}} Lieutier},
  title        = {Smooth manifold reconstruction from noisy and non-uniform approximation
                  with guarantees},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {2},
  pages        = {156--170},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.07.001},
  doi          = {10.1016/J.COMGEO.2007.07.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChazalL08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChazelleLM08,
  author       = {Bernard Chazelle and
                  Ding Liu and
                  Avner Magen},
  title        = {Approximate range searching in higher dimension},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {1},
  pages        = {24--29},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.05.008},
  doi          = {10.1016/J.COMGEO.2007.05.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChazelleLM08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChengT08,
  author       = {Ho{-}Lun Cheng and
                  Tony Tan},
  title        = {Approximating polyhedral objects with deformable smooth surfaces},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {2},
  pages        = {104--117},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2006.10.003},
  doi          = {10.1016/J.COMGEO.2006.10.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ChengT08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CheongHL08,
  author       = {Otfried Cheong and
                  Herman J. Haverkort and
                  Mira Lee},
  title        = {Computing a minimum-dilation spanning tree is NP-hard},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {3},
  pages        = {188--205},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.12.001},
  doi          = {10.1016/J.COMGEO.2007.12.001},
  timestamp    = {Sun, 25 Jul 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/CheongHL08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DamianFO08,
  author       = {Mirela Damian and
                  Robin Y. Flatland and
                  Joseph O'Rourke},
  title        = {Unfolding Manhattan Towers},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {2},
  pages        = {102--114},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.07.003},
  doi          = {10.1016/J.COMGEO.2007.07.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DamianFO08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DamianO08,
  author       = {Mirela Damian and
                  Joseph O'Rourke},
  title        = {On corners of objects built from parallelepiped bricks},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {1},
  pages        = {43--54},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.05.010},
  doi          = {10.1016/J.COMGEO.2007.05.010},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DamianO08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DrysdaleRS08,
  author       = {Robert L. Scot Drysdale and
                  G{\"{u}}nter Rote and
                  Astrid Sturm},
  title        = {Approximation of an open polygonal curve with a minimum number of
                  circular arcs and biarcs},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {1-2},
  pages        = {31--47},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.10.009},
  doi          = {10.1016/J.COMGEO.2007.10.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DrysdaleRS08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EdelsbrunnerHMPS08,
  author       = {Herbert Edelsbrunner and
                  John Harer and
                  Ajith Mascarenhas and
                  Valerio Pascucci and
                  Jack Snoeyink},
  title        = {Time-varying Reeb graphs for continuous space-time data},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {3},
  pages        = {149--166},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.11.001},
  doi          = {10.1016/J.COMGEO.2007.11.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/EdelsbrunnerHMPS08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EmirisP08,
  author       = {Ioannis Z. Emiris and
                  Leonidas Palios},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {1-2},
  pages        = {1},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2008.02.002},
  doi          = {10.1016/J.COMGEO.2008.02.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/EmirisP08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EzraSE08,
  author       = {Esther Ezra and
                  Micha Sharir and
                  Alon Efrat},
  title        = {On the performance of the {ICP} algorithm},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {1-2},
  pages        = {77--93},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.10.007},
  doi          = {10.1016/J.COMGEO.2007.10.007},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/EzraSE08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GerdjikovW08,
  author       = {Stefan Gerdjikov and
                  Alexander Wolff},
  title        = {Decomposing a simple polygon into pseudo-triangles and convex polygons},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {1-2},
  pages        = {21--30},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.10.005},
  doi          = {10.1016/J.COMGEO.2007.10.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GerdjikovW08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiesenJ08,
  author       = {Joachim Giesen and
                  Matthias John},
  title        = {The flow complex: {A} data structure for geometric modeling},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {3},
  pages        = {178--190},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.01.002},
  doi          = {10.1016/J.COMGEO.2007.01.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GiesenJ08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GoldschmidtG08,
  author       = {Nir Goldschmidt and
                  Dan Gordon},
  title        = {The {BOXEL} framework for 2.5D data with applications to virtual drivethroughs
                  and ray tracing},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {3},
  pages        = {167--187},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.09.003},
  doi          = {10.1016/J.COMGEO.2007.09.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GoldschmidtG08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GopalaM08,
  author       = {Harish Gopala and
                  Pat Morin},
  title        = {Algorithms for bivariate zonoid depth},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {1},
  pages        = {2--13},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.05.007},
  doi          = {10.1016/J.COMGEO.2007.05.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GopalaM08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GruneK08,
  author       = {Ansgar Gr{\"{u}}ne and
                  Sanaz Kamali},
  title        = {On the density of iterated line segment intersections},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {1},
  pages        = {23--36},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.07.005},
  doi          = {10.1016/J.COMGEO.2007.07.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GruneK08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HasanL08,
  author       = {Masud Hasan and
                  Anna Lubiw},
  title        = {Equiprojective polyhedra},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {2},
  pages        = {148--155},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.05.002},
  doi          = {10.1016/J.COMGEO.2007.05.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HasanL08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HershbergerS08,
  author       = {John Hershberger and
                  Subhash Suri},
  title        = {Adaptive sampling for geometric problems over data streams},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {3},
  pages        = {191--208},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2006.10.004},
  doi          = {10.1016/J.COMGEO.2006.10.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HershbergerS08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HurtadoKRT08,
  author       = {Ferran Hurtado and
                  Mikio Kano and
                  David Rappaport and
                  Csaba D. T{\'{o}}th},
  title        = {Encompassing colored planar straight line graphs},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {1},
  pages        = {14--23},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.05.006},
  doi          = {10.1016/J.COMGEO.2007.05.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HurtadoKRT08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KatzR08,
  author       = {Matthew J. Katz and
                  Gabriel S. Roisman},
  title        = {On guarding the vertices of rectilinear domains},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {3},
  pages        = {219--228},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.02.002},
  doi          = {10.1016/J.COMGEO.2007.02.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KatzR08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KeszeghPPT08,
  author       = {Bal{\'{a}}zs Keszegh and
                  J{\'{a}}nos Pach and
                  D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi and
                  G{\'{e}}za T{\'{o}}th},
  title        = {Drawing cubic graphs with at most five slopes},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {2},
  pages        = {138--147},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.05.003},
  doi          = {10.1016/J.COMGEO.2007.05.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KeszeghPPT08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KettnerMPSY08,
  author       = {Lutz Kettner and
                  Kurt Mehlhorn and
                  Sylvain Pion and
                  Stefan Schirra and
                  Chee{-}Keng Yap},
  title        = {Classroom examples of robustness problems in geometric computations},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {1},
  pages        = {61--78},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.06.003},
  doi          = {10.1016/J.COMGEO.2007.06.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KettnerMPSY08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MaheshwariSZ08,
  author       = {Anil Maheshwari and
                  Michiel H. M. Smid and
                  Norbert Zeh},
  title        = {I/O-efficient algorithms for computing planar geometric spanners},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {3},
  pages        = {252--271},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.07.007},
  doi          = {10.1016/J.COMGEO.2007.07.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MaheshwariSZ08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Malamatos08,
  author       = {Theocharis Malamatos},
  title        = {Lower bounds for expected-case planar point location},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {2},
  pages        = {91--103},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.06.001},
  doi          = {10.1016/J.COMGEO.2007.06.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Malamatos08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MoetKK08,
  author       = {Esther Moet and
                  Christian Knauer and
                  Marc J. van Kreveld},
  title        = {Visibility maps of segments and triangles in 3D},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {3},
  pages        = {163--177},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2006.11.001},
  doi          = {10.1016/J.COMGEO.2006.11.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MoetKK08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MoetKS08,
  author       = {Esther Moet and
                  Marc J. van Kreveld and
                  A. Frank van der Stappen},
  title        = {On realistic terrains},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {1-2},
  pages        = {48--67},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.10.008},
  doi          = {10.1016/J.COMGEO.2007.10.008},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/MoetKS08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Morin08,
  author       = {Pat Morin},
  title        = {An optimal randomized algorithm for d-variate zonoid depth},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {3},
  pages        = {229--235},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2006.12.002},
  doi          = {10.1016/J.COMGEO.2006.12.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Morin08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MustafaR08,
  author       = {Nabil H. Mustafa and
                  Saurabh Ray},
  title        = {Weak epsilon-nets have basis of size O(1/epsilonlog(1/epsilon)) in
                  any dimension},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {1},
  pages        = {84--91},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.02.006},
  doi          = {10.1016/J.COMGEO.2007.02.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/MustafaR08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Packer08,
  author       = {Eli Packer},
  title        = {Iterated snap rounding with bounded drift},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {3},
  pages        = {231--251},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.09.002},
  doi          = {10.1016/J.COMGEO.2007.09.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Packer08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Tan08,
  author       = {Xuehou Tan},
  title        = {A unified and efficient solution to the room search problem},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {1},
  pages        = {45--60},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.04.001},
  doi          = {10.1016/J.COMGEO.2007.04.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Tan08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Wulff-Nilsen08,
  author       = {Christian Wulff{-}Nilsen},
  title        = {Steiner hull algorithm for the uniform orientation metrics},
  journal      = {Comput. Geom.},
  volume       = {40},
  number       = {1},
  pages        = {1--13},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.10.002},
  doi          = {10.1016/J.COMGEO.2007.10.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Wulff-Nilsen08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZareiG08,
  author       = {Alireza Zarei and
                  Mohammad Ghodsi},
  title        = {Query point visibility computation in polygons with holes},
  journal      = {Comput. Geom.},
  volume       = {39},
  number       = {2},
  pages        = {78--90},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2007.02.005},
  doi          = {10.1016/J.COMGEO.2007.02.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ZareiG08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZomorodianC08,
  author       = {Afra Zomorodian and
                  Gunnar E. Carlsson},
  title        = {Localized homology},
  journal      = {Comput. Geom.},
  volume       = {41},
  number       = {3},
  pages        = {126--148},
  year         = {2008},
  url          = {https://doi.org/10.1016/j.comgeo.2008.02.003},
  doi          = {10.1016/J.COMGEO.2008.02.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/ZomorodianC08.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbamB07,
  author       = {Mohammad Ali Abam and
                  Mark de Berg},
  title        = {Kinetic sorting and kinetic convex hulls},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {1},
  pages        = {16--26},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.02.004},
  doi          = {10.1016/J.COMGEO.2006.02.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AbamB07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnCPSV07,
  author       = {Hee{-}Kap Ahn and
                  Otfried Cheong and
                  Chong{-}Dae Park and
                  Chan{-}Su Shin and
                  Antoine Vigneron},
  title        = {Maximizing the overlap of two planar convex sets under rigid motions},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {1},
  pages        = {3--15},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.01.005},
  doi          = {10.1016/J.COMGEO.2006.01.005},
  timestamp    = {Tue, 16 Aug 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnCPSV07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerK07,
  author       = {Oswin Aichholzer and
                  Hannes Krasser},
  title        = {Abstract order type extension and new results on the rectilinear crossing
                  number},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {1},
  pages        = {2--15},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2005.07.005},
  doi          = {10.1016/J.COMGEO.2005.07.005},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerK07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerR07,
  author       = {Oswin Aichholzer and
                  Klaus Reinhardt},
  title        = {A quadratic distance bound on sliding between crossing-free spanning
                  trees},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {3},
  pages        = {155--161},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2004.12.010},
  doi          = {10.1016/J.COMGEO.2004.12.010},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/AichholzerR07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlexandronKS07,
  author       = {Giora Alexandron and
                  Haim Kaplan and
                  Micha Sharir},
  title        = {Kinetic and dynamic data structures for convex hulls and upper envelopes},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {2},
  pages        = {144--158},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.01.002},
  doi          = {10.1016/J.COMGEO.2006.01.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AlexandronKS07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AnderssonGL07,
  author       = {Mattias Andersson and
                  Joachim Gudmundsson and
                  Christos Levcopoulos},
  title        = {Approximate distance oracles for graphs with dense clusters},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {3},
  pages        = {142--154},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2004.12.011},
  doi          = {10.1016/J.COMGEO.2004.12.011},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AnderssonGL07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BandyopadhyayS07,
  author       = {Deepak Bandyopadhyay and
                  Jack Snoeyink},
  title        = {Almost-Delaunay simplices: Robust neighbor relations for imprecise
                  3D points using {CGAL}},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {1-2},
  pages        = {4--15},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.11.003},
  doi          = {10.1016/J.COMGEO.2006.11.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BandyopadhyayS07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BekosKSW07,
  author       = {Michael A. Bekos and
                  Michael Kaufmann and
                  Antonios Symvonis and
                  Alexander Wolff},
  title        = {Boundary labeling: Models and efficient algorithms for rectangular
                  maps},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {3},
  pages        = {215--236},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.05.003},
  doi          = {10.1016/J.COMGEO.2006.05.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BekosKSW07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregDSV07,
  author       = {Sergey Bereg and
                  Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
                  Carlos Seara and
                  Inmaculada Ventura},
  title        = {On finding widest empty curved corridors},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {3},
  pages        = {154--169},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2007.02.003},
  doi          = {10.1016/J.COMGEO.2007.02.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BeregDSV07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergGOS07,
  author       = {Mark de Berg and
                  Joachim Gudmundsson and
                  Ren{\'{e}} van Oostrum and
                  Bettina Speckmann},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {1},
  pages        = {1},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.05.001},
  doi          = {10.1016/J.COMGEO.2006.05.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BergGOS07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergHO07,
  author       = {Mark de Berg and
                  Dan Halperin and
                  Mark H. Overmars},
  title        = {An intersection-sensitive algorithm for snap rounding},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {3},
  pages        = {159--165},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.03.002},
  doi          = {10.1016/J.COMGEO.2006.03.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BergHO07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoissonnatGO07,
  author       = {Jean{-}Daniel Boissonnat and
                  Leonidas J. Guibas and
                  Steve Oudot},
  title        = {Learning smooth shapes by probing},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {1},
  pages        = {38--58},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.05.008},
  doi          = {10.1016/J.COMGEO.2006.05.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoissonnatGO07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseD07,
  author       = {Prosenjit Bose and
                  Luc Devroye},
  title        = {On the stabbing number of a random Delaunay triangulation},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {2},
  pages        = {89--105},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.05.005},
  doi          = {10.1016/J.COMGEO.2006.05.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseD07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseMMMSV07,
  author       = {Prosenjit Bose and
                  Anil Maheshwari and
                  Pat Morin and
                  Jason Morrison and
                  Michiel H. M. Smid and
                  Jan Vahrenhold},
  title        = {Space-efficient geometric divide-and-conquer algorithms},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {3},
  pages        = {209--227},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.03.006},
  doi          = {10.1016/J.COMGEO.2006.03.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseMMMSV07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrassCDEEIKLM07,
  author       = {Peter Bra{\ss} and
                  Eowyn Cenek and
                  Christian A. Duncan and
                  Alon Efrat and
                  Cesim Erten and
                  Dan Ismailescu and
                  Stephen G. Kobourov and
                  Anna Lubiw and
                  Joseph S. B. Mitchell},
  title        = {On simultaneous planar graph embeddings},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {2},
  pages        = {117--130},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.05.006},
  doi          = {10.1016/J.COMGEO.2006.05.006},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/BrassCDEEIKLM07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CortesM07,
  author       = {Carmen Cort{\'{e}}s and
                  Alberto M{\'{a}}rquez},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {3},
  pages        = {141},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.08.001},
  doi          = {10.1016/J.COMGEO.2006.08.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CortesM07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeyGG07,
  author       = {Tamal K. Dey and
                  Joachim Giesen and
                  Samrat Goswami},
  title        = {Delaunay triangulations approximate anchor hulls},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {2},
  pages        = {131--143},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.01.001},
  doi          = {10.1016/J.COMGEO.2006.01.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DeyGG07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DujmovicESW07,
  author       = {Vida Dujmovic and
                  David Eppstein and
                  Matthew Suderman and
                  David R. Wood},
  title        = {Drawings of planar graphs with few slopes and segments},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {3},
  pages        = {194--212},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.09.002},
  doi          = {10.1016/J.COMGEO.2006.09.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DujmovicESW07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DujmovicSW07,
  author       = {Vida Dujmovic and
                  Matthew Suderman and
                  David R. Wood},
  title        = {Graph drawings with few slopes},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {3},
  pages        = {181--193},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.08.002},
  doi          = {10.1016/J.COMGEO.2006.08.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DujmovicSW07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuEGKR07,
  author       = {Adrian Dumitrescu and
                  Annette Ebbers{-}Baumann and
                  Ansgar Gr{\"{u}}ne and
                  Rolf Klein and
                  G{\"{u}}nter Rote},
  title        = {On the geometric dilation of closed curves, graphs, and point sets},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {1},
  pages        = {16--38},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2005.07.004},
  doi          = {10.1016/J.COMGEO.2005.07.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DumitrescuEGKR07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ebbers-BaumannGK07,
  author       = {Annette Ebbers{-}Baumann and
                  Ansgar Gr{\"{u}}ne and
                  Rolf Klein},
  title        = {Geometric dilation of closed planar curves: New lower bounds},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {3},
  pages        = {188--208},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2004.12.009},
  doi          = {10.1016/J.COMGEO.2004.12.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Ebbers-BaumannGK07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EfratGHZ07,
  author       = {Alon Efrat and
                  Leonidas J. Guibas and
                  Olaf A. Hall{-}Holt and
                  Li Zhang},
  title        = {On incremental rendering of silhouette maps of a polyhedral scene},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {3},
  pages        = {129--138},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.12.003},
  doi          = {10.1016/J.COMGEO.2006.12.003},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/EfratGHZ07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EppsteinW07,
  author       = {David Eppstein and
                  Kevin A. Wortman},
  title        = {Minimum dilation stars},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {1},
  pages        = {27--37},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.05.007},
  doi          = {10.1016/J.COMGEO.2006.05.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/EppsteinW07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FragoudakisMZ07,
  author       = {Christodoulos Fragoudakis and
                  Euripides Markou and
                  Stathis Zachos},
  title        = {Maximizing the guarded boundary of an Art Gallery is APX-complete},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {3},
  pages        = {170--180},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.12.001},
  doi          = {10.1016/J.COMGEO.2006.12.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FragoudakisMZ07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Freedman07,
  author       = {Daniel Freedman},
  title        = {An incremental algorithm for reconstruction of surfaces of arbitrary
                  codimension},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {2},
  pages        = {106--116},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.05.004},
  doi          = {10.1016/J.COMGEO.2006.05.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Freedman07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GartnerV07,
  author       = {Bernd G{\"{a}}rtner and
                  Remco C. Veltkamp},
  title        = {A decade of {CGAL}},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {1-2},
  pages        = {1--3},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2007.02.001},
  doi          = {10.1016/J.COMGEO.2007.02.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GartnerV07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Gonzalez-GutierrezG07,
  author       = {Arturo Gonzalez{-}Gutierrez and
                  Teofilo F. Gonzalez},
  title        = {Complexity of the minimum-length corridor problem},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {2},
  pages        = {72--103},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.10.002},
  doi          = {10.1016/J.COMGEO.2006.10.002},
  timestamp    = {Sun, 02 Oct 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/Gonzalez-GutierrezG07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonL07,
  author       = {Joachim Gudmundsson and
                  Christos Levcopoulos},
  title        = {Minimum weight pseudo-triangulations},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {3},
  pages        = {139--153},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2007.05.004},
  doi          = {10.1016/J.COMGEO.2007.05.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GudmundssonL07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonNS07,
  author       = {Joachim Gudmundsson and
                  Giri Narasimhan and
                  Michiel H. M. Smid},
  title        = {Distance-preserving approximations of polygonal paths},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {3},
  pages        = {183--196},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.05.002},
  doi          = {10.1016/J.COMGEO.2006.05.002},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GudmundssonNS07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HachenbergerKM07,
  author       = {Peter Hachenberger and
                  Lutz Kettner and
                  Kurt Mehlhorn},
  title        = {Boolean operations on 3D selective Nef complexes: Data structure,
                  algorithms, optimized implementation and experiments},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {1-2},
  pages        = {64--99},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.11.009},
  doi          = {10.1016/J.COMGEO.2006.11.009},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HachenbergerKM07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Har-Peled07,
  author       = {Sariel Har{-}Peled},
  title        = {How to get close to the median shape},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {1},
  pages        = {39--51},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.02.003},
  doi          = {10.1016/J.COMGEO.2006.02.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Har-Peled07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HertHKPS07,
  author       = {Susan Hert and
                  Michael Hoffmann and
                  Lutz Kettner and
                  Sylvain Pion and
                  Michael Seel},
  title        = {An adaptable and extensible geometry kernel},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {1-2},
  pages        = {16--36},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.11.004},
  doi          = {10.1016/J.COMGEO.2006.11.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HertHKPS07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HurtadoM07,
  author       = {Ferran Hurtado and
                  Joseph S. B. Mitchell},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {1},
  pages        = {1--2},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.07.002},
  doi          = {10.1016/J.COMGEO.2006.07.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HurtadoM07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KnauerSSW07,
  author       = {Christian Knauer and
                  {\'{E}}tienne Schramm and
                  Andreas Spillner and
                  Alexander Wolff},
  title        = {Configurations with few crossings in topological graphs},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {2},
  pages        = {104--114},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.06.001},
  doi          = {10.1016/J.COMGEO.2006.06.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KnauerSSW07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KokKL07,
  author       = {Thierry de Kok and
                  Marc J. van Kreveld and
                  Maarten L{\"{o}}ffler},
  title        = {Generating realistic terrains with higher-order Delaunay triangulations},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {1},
  pages        = {52--65},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2005.09.005},
  doi          = {10.1016/J.COMGEO.2005.09.005},
  timestamp    = {Fri, 09 Apr 2021 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/KokKL07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KosowskiMZ07,
  author       = {Adrian Kosowski and
                  Michal Malafiejski and
                  Pawel Zylinski},
  title        = {Cooperative mobile guards in grids},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {2},
  pages        = {59--71},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.11.002},
  doi          = {10.1016/J.COMGEO.2006.11.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KosowskiMZ07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KreveldS07,
  author       = {Marc J. van Kreveld and
                  Bettina Speckmann},
  title        = {On rectangular cartograms},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {3},
  pages        = {175--187},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.06.002},
  doi          = {10.1016/J.COMGEO.2006.06.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KreveldS07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KruithofV07,
  author       = {Nico Kruithof and
                  Gert Vegter},
  title        = {Meshing skin surfaces with certified topology},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {3},
  pages        = {166--182},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.01.003},
  doi          = {10.1016/J.COMGEO.2006.01.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KruithofV07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PourninL07,
  author       = {Lionel Pournin and
                  Thomas M. Liebling},
  title        = {Constrained paths in the flip-graph of regular triangulations},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {2},
  pages        = {134--140},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.07.001},
  doi          = {10.1016/J.COMGEO.2006.07.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/PourninL07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RineauY07,
  author       = {Laurent Rineau and
                  Mariette Yvinec},
  title        = {A generic software design for Delaunay refinement meshing},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {1-2},
  pages        = {100--110},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.11.008},
  doi          = {10.1016/J.COMGEO.2006.11.008},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/RineauY07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Rote07,
  author       = {G{\"{u}}nter Rote},
  title        = {Computing the Fr{\'{e}}chet distance between piecewise smooth
                  curves},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {3},
  pages        = {162--174},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2005.01.004},
  doi          = {10.1016/J.COMGEO.2005.01.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Rote07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RoyDN07,
  author       = {Sasanka Roy and
                  Sandip Das and
                  Subhas C. Nandy},
  title        = {Shortest monotone descent path problem in polyhedral terrain},
  journal      = {Comput. Geom.},
  volume       = {37},
  number       = {2},
  pages        = {115--133},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.06.003},
  doi          = {10.1016/J.COMGEO.2006.06.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/RoyDN07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RusselKG07,
  author       = {Daniel Russel and
                  Menelaos I. Karavelas and
                  Leonidas J. Guibas},
  title        = {A package for exact kinetic data structures and sweepline algorithms},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {1-2},
  pages        = {111--127},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.11.006},
  doi          = {10.1016/J.COMGEO.2006.11.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/RusselKG07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SchindelhauerVZ07,
  author       = {Christian Schindelhauer and
                  Klaus Volbert and
                  Martin Ziegler},
  title        = {Geometric spanners with applications in wireless networks},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {3},
  pages        = {197--214},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.02.001},
  doi          = {10.1016/J.COMGEO.2006.02.001},
  timestamp    = {Tue, 07 May 2024 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/SchindelhauerVZ07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Vahrenhold07,
  author       = {Jan Vahrenhold},
  title        = {Line-segment intersection made in-place},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {3},
  pages        = {213--230},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.09.001},
  doi          = {10.1016/J.COMGEO.2006.09.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Vahrenhold07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WeinBH07,
  author       = {Ron Wein and
                  Jur P. van den Berg and
                  Dan Halperin},
  title        = {The visibility-Voronoi complex and its applications},
  journal      = {Comput. Geom.},
  volume       = {36},
  number       = {1},
  pages        = {66--87},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2005.11.007},
  doi          = {10.1016/J.COMGEO.2005.11.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/WeinBH07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WeinFZH07,
  author       = {Ron Wein and
                  Efi Fogel and
                  Baruch Zukerman and
                  Dan Halperin},
  title        = {Advanced programming techniques applied to Cgal's arrangement package},
  journal      = {Comput. Geom.},
  volume       = {38},
  number       = {1-2},
  pages        = {37--63},
  year         = {2007},
  url          = {https://doi.org/10.1016/j.comgeo.2006.11.007},
  doi          = {10.1016/J.COMGEO.2006.11.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/WeinFZH07.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbellanasBHORT06,
  author       = {Manuel Abellanas and
                  Sergey Bereg and
                  Ferran Hurtado and
                  Alfredo Garc{\'{\i}}a Olaverri and
                  David Rappaport and
                  Javier Tejel},
  title        = {Moving coins},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {1},
  pages        = {35--48},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.06.005},
  doi          = {10.1016/J.COMGEO.2005.06.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AbellanasBHORT06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AgarwalM06,
  author       = {Pankaj K. Agarwal and
                  Nabil H. Mustafa},
  title        = {Independent set of intersection graphs of convex objects in 2D},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {2},
  pages        = {83--95},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.12.001},
  doi          = {10.1016/J.COMGEO.2005.12.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AgarwalM06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBCNSV06,
  author       = {Hee{-}Kap Ahn and
                  Peter Bra{\ss} and
                  Otfried Cheong and
                  Hyeon{-}Suk Na and
                  Chan{-}Su Shin and
                  Antoine Vigneron},
  title        = {Inscribing an axially symmetric polygon and other approximation algorithms
                  for planar convex sets},
  journal      = {Comput. Geom.},
  volume       = {33},
  number       = {3},
  pages        = {152--164},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.06.001},
  doi          = {10.1016/J.COMGEO.2005.06.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AhnBCNSV06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkiyamaHKN06,
  author       = {Jin Akiyama and
                  Koichi Hirata and
                  Midori Kobayashi and
                  Gisaku Nakamura},
  title        = {Convex developments of a regular tetrahedron},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {1},
  pages        = {2--10},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.07.003},
  doi          = {10.1016/J.COMGEO.2005.07.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AkiyamaHKN06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkiyamaKT06,
  author       = {Jin Akiyama and
                  Mikio Kano and
                  Xuehou Tan},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {1},
  pages        = {1},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.09.001},
  doi          = {10.1016/J.COMGEO.2005.09.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AkiyamaKT06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovBCC06,
  author       = {Boris Aronov and
                  Herv{\'{e}} Br{\"{o}}nnimann and
                  Allen Y. Chang and
                  Yi{-}Jen Chiang},
  title        = {Cost prediction for ray shooting in octrees},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {3},
  pages        = {159--181},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.09.002},
  doi          = {10.1016/J.COMGEO.2005.09.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/AronovBCC06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BenkertWWS06,
  author       = {Marc Benkert and
                  Alexander Wolff and
                  Florian Widmann and
                  Takeshi Shirabe},
  title        = {The minimum Manhattan network problem: Approximations and exact solutions},
  journal      = {Comput. Geom.},
  volume       = {35},
  number       = {3},
  pages        = {188--208},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.09.004},
  doi          = {10.1016/J.COMGEO.2005.09.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BenkertWWS06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregBK06,
  author       = {Sergey Bereg and
                  Prosenjit Bose and
                  David G. Kirkpatrick},
  title        = {Equitable subdivisions within polygonal regions},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {1},
  pages        = {20--27},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.06.003},
  doi          = {10.1016/J.COMGEO.2005.06.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BeregBK06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergS06,
  author       = {Mark de Berg and
                  Micha Streppel},
  title        = {Approximate range searching using binary space partitions},
  journal      = {Comput. Geom.},
  volume       = {33},
  number       = {3},
  pages        = {139--151},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.08.003},
  doi          = {10.1016/J.COMGEO.2005.08.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BergS06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BhattacharyaGS06,
  author       = {Binay K. Bhattacharya and
                  Subir Kumar Ghosh and
                  Thomas C. Shermer},
  title        = {A linear time algorithm to remove winding of a simple polygon},
  journal      = {Comput. Geom.},
  volume       = {33},
  number       = {3},
  pages        = {165--173},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.05.001},
  doi          = {10.1016/J.COMGEO.2005.05.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BhattacharyaGS06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoissonnatS06,
  author       = {Jean{-}Daniel Boissonnat and
                  Jack Snoeyink},
  title        = {Editorial},
  journal      = {Comput. Geom.},
  volume       = {35},
  number       = {1-2},
  pages        = {1},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.10.007},
  doi          = {10.1016/J.COMGEO.2005.10.007},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoissonnatS06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseHRW06,
  author       = {Prosenjit Bose and
                  Ferran Hurtado and
                  Eduardo Rivera{-}Campo and
                  David R. Wood},
  title        = {Partitions of complete geometric graphs into plane trees},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {2},
  pages        = {116--125},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.08.006},
  doi          = {10.1016/J.COMGEO.2005.08.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BoseHRW06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BronnimannC06,
  author       = {Herv{\'{e}} Br{\"{o}}nnimann and
                  Timothy M. Chan},
  title        = {Space-efficient algorithms for computing the convex hull of a simple
                  polygonal line in linear time},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {2},
  pages        = {75--82},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.11.005},
  doi          = {10.1016/J.COMGEO.2005.11.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BronnimannC06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BronnimannG06,
  author       = {Herv{\'{e}} Br{\"{o}}nnimann and
                  Marc Glisse},
  title        = {Octrees with near optimal cost for ray-shooting},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {3},
  pages        = {182--194},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.09.003},
  doi          = {10.1016/J.COMGEO.2005.09.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/BronnimannG06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiKM06,
  author       = {Paz Carmi and
                  Matthew J. Katz and
                  Joseph S. B. Mitchell},
  title        = {The minimum-area spanning tree problem},
  journal      = {Comput. Geom.},
  volume       = {35},
  number       = {3},
  pages        = {218--225},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2006.03.001},
  doi          = {10.1016/J.COMGEO.2006.03.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/CarmiKM06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Chan06,
  author       = {Timothy M. Chan},
  title        = {Faster core-set constructions and data-stream algorithms in fixed
                  dimensions},
  journal      = {Comput. Geom.},
  volume       = {35},
  number       = {1-2},
  pages        = {20--35},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.10.002},
  doi          = {10.1016/J.COMGEO.2005.10.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Chan06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Chan06a,
  author       = {Timothy M. Chan},
  title        = {Three problems about simple polygons},
  journal      = {Comput. Geom.},
  volume       = {35},
  number       = {3},
  pages        = {209--217},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.11.002},
  doi          = {10.1016/J.COMGEO.2005.11.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Chan06a.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Cheng06,
  author       = {Siu{-}Wing Cheng},
  title        = {On the sizes of Delaunay meshes},
  journal      = {Comput. Geom.},
  volume       = {33},
  number       = {3},
  pages        = {130--138},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.08.002},
  doi          = {10.1016/J.COMGEO.2005.08.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Cheng06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DaescuLM06,
  author       = {Ovidiu Daescu and
                  Jun Luo and
                  David M. Mount},
  title        = {Proximity problems on line segments spanned by points},
  journal      = {Comput. Geom.},
  volume       = {33},
  number       = {3},
  pages        = {115--129},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.08.007},
  doi          = {10.1016/J.COMGEO.2005.08.007},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/DaescuLM06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DaescuMSW06,
  author       = {Ovidiu Daescu and
                  Ningfang Mi and
                  Chan{-}Su Shin and
                  Alexander Wolff},
  title        = {Farthest-point queries with geometric and combinatorial constraints},
  journal      = {Comput. Geom.},
  volume       = {33},
  number       = {3},
  pages        = {174--185},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.07.002},
  doi          = {10.1016/J.COMGEO.2005.07.002},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DaescuMSW06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DancigerDS06,
  author       = {Jeff Danciger and
                  Satyan L. Devadoss and
                  Don Sheehy},
  title        = {Compatible triangulations and point partitions by series-triangular
                  graphs},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {3},
  pages        = {195--202},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.11.003},
  doi          = {10.1016/J.COMGEO.2005.11.003},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DancigerDS06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DevillersG06,
  author       = {Olivier Devillers and
                  Philippe Guigue},
  title        = {Inner and outer rounding of Boolean operations on lattice polygonal
                  regions},
  journal      = {Comput. Geom.},
  volume       = {33},
  number       = {1-2},
  pages        = {3--17},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2004.08.005},
  doi          = {10.1016/J.COMGEO.2004.08.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DevillersG06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeyG06,
  author       = {Tamal K. Dey and
                  Samrat Goswami},
  title        = {Provable surface reconstruction from noisy samples},
  journal      = {Comput. Geom.},
  volume       = {35},
  number       = {1-2},
  pages        = {124--141},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.10.006},
  doi          = {10.1016/J.COMGEO.2005.10.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DeyG06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DykenF06,
  author       = {Christopher Dyken and
                  Michael S. Floater},
  title        = {Preferred directions for resolving the non-uniqueness of Delaunay
                  triangulations},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {2},
  pages        = {96--101},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.08.004},
  doi          = {10.1016/J.COMGEO.2005.08.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/DykenF06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EfratKL06,
  author       = {Alon Efrat and
                  Stephen G. Kobourov and
                  Anna Lubiw},
  title        = {Computing homotopic shortest paths efficiently},
  journal      = {Comput. Geom.},
  volume       = {35},
  number       = {3},
  pages        = {162--172},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2006.03.003},
  doi          = {10.1016/J.COMGEO.2006.03.003},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/EfratKL06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Eidenbenz06,
  author       = {Stephan J. Eidenbenz},
  title        = {Finding minimum hidden guard sets in polygons - tight approximability
                  results},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {2},
  pages        = {49--57},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2006.01.004},
  doi          = {10.1016/J.COMGEO.2006.01.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/Eidenbenz06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EigenwilligKSW06,
  author       = {Arno Eigenwillig and
                  Lutz Kettner and
                  Elmar Sch{\"{o}}mer and
                  Nicola Wolpert},
  title        = {Exact, efficient, and complete arrangement computation for cubic curves},
  journal      = {Comput. Geom.},
  volume       = {35},
  number       = {1-2},
  pages        = {36--73},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.10.003},
  doi          = {10.1016/J.COMGEO.2005.10.003},
  timestamp    = {Sat, 30 Sep 2023 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/EigenwilligKSW06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EmirisK06,
  author       = {Ioannis Z. Emiris and
                  Menelaos I. Karavelas},
  title        = {The predicates of the Apollonius diagram: Algorithmic analysis and
                  implementation},
  journal      = {Comput. Geom.},
  volume       = {33},
  number       = {1-2},
  pages        = {18--57},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2004.02.006},
  doi          = {10.1016/J.COMGEO.2004.02.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/EmirisK06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FeketeKN06,
  author       = {S{\'{a}}ndor P. Fekete and
                  Rolf Klein and
                  Andreas N{\"{u}}chter},
  title        = {Online searching with an autonomous robot},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {2},
  pages        = {102--115},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.08.005},
  doi          = {10.1016/J.COMGEO.2005.08.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/FeketeKN06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GaoGN06,
  author       = {Jie Gao and
                  Leonidas J. Guibas and
                  An Thai Nguyen},
  title        = {Deformable spanners and applications},
  journal      = {Comput. Geom.},
  volume       = {35},
  number       = {1-2},
  pages        = {2--19},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.10.001},
  doi          = {10.1016/J.COMGEO.2005.10.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/GaoGN06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GrimaMO06,
  author       = {Clara I. Grima and
                  Alberto M{\'{a}}rquez and
                  Lidia M. Ortega},
  title        = {A new 2D tessellation for angle problems: The polar diagram},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {2},
  pages        = {58--74},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.11.004},
  doi          = {10.1016/J.COMGEO.2005.11.004},
  timestamp    = {Tue, 14 Jun 2022 01:00:00 +0200},
  biburl       = {https://dblp.org/rec/journals/comgeo/GrimaMO06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HillarR06,
  author       = {Christopher J. Hillar and
                  Darren L. Rhea},
  title        = {A result about the density of iterated line intersections in the plane},
  journal      = {Comput. Geom.},
  volume       = {33},
  number       = {3},
  pages        = {106--114},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.07.001},
  doi          = {10.1016/J.COMGEO.2005.07.001},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HillarR06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HoffmannO06,
  author       = {Michael Hoffmann and
                  Yoshio Okamoto},
  title        = {The minimum weight triangulation problem with few inner points},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {3},
  pages        = {149--158},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.11.006},
  doi          = {10.1016/J.COMGEO.2005.11.006},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/HoffmannO06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KakoulisT06,
  author       = {Konstantinos G. Kakoulis and
                  Ioannis G. Tollis},
  title        = {Algorithms for the multiple label placement problem},
  journal      = {Comput. Geom.},
  volume       = {35},
  number       = {3},
  pages        = {143--161},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2006.03.005},
  doi          = {10.1016/J.COMGEO.2006.03.005},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KakoulisT06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KeilV06,
  author       = {J. Mark Keil and
                  Tzvetalin S. Vassilev},
  title        = {Algorithms for optimal area triangulations of a convex polygon},
  journal      = {Comput. Geom.},
  volume       = {35},
  number       = {3},
  pages        = {173--187},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2006.03.004},
  doi          = {10.1016/J.COMGEO.2006.03.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KeilV06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KleinLL06,
  author       = {Rolf Klein and
                  Christos Levcopoulos and
                  Andrzej Lingas},
  title        = {A {PTAS} for minimum vertex dilation triangulation of a simple polygon
                  with a constant number of sources of dilation},
  journal      = {Comput. Geom.},
  volume       = {34},
  number       = {1},
  pages        = {28--34},
  year         = {2006},
  url          = {https://doi.org/10.1016/j.comgeo.2005.06.004},
  doi          = {10.1016/J.COMGEO.2005.06.004},
  timestamp    = {Thu, 11 Feb 2021 00:00:00 +0100},
  biburl       = {https://dblp.org/rec/journals/comgeo/KleinLL06.bib},
  bibsource    = {dblp computer science bibliography, https://dblp.org}
}
a service of  Schloss Dagstuhl - Leibniz Center for Informatics